Bài tập Andehit Xeton

Chia sẻ: Trần Phương Mai Ly | Ngày: | 6 tài liệu

lượt xem
Xem 6 tài liệu khác
  Download Vui lòng tải xuống để xem file gốc
Bài tập Andehit Xeton

Bài tập Andehit Xeton
Mô tả BST Bài tập Andehit Xeton

Nhằm giúp quý thầy cô giáo có thêm tài liệu để giảng dạy, các em học sinh có thêm nhiều tài liệu để học tập, Thư viện eLib đã sưu tầm và tổng hợp bộ sưu tập Bài tập Andehit Xeton. Bao gồm các tài liệu hay, chất lượng giúp các em nắm được những kiến thức cần thiết trong chương học. Đồng thời, giúp thầy cô giáo có thêm tư liệu để giảng dạy giúp các em học sinh tiếp thu tốt hơn. Mời quý thầy cô giáo và các em học sinh tham khảo.


Bài tập Andehit Xeton
Tóm tắt Bài tập Andehit Xeton

Chúng tôi xin trích dẫn một phần tài liệu đầu tiên trong bộ sưu tập Bài tập Andehit Xeton dưới đây:

 Câu 1: Cho các dung dịch thuốc thử: AgNO3/NH3; Br2; Na2CO3; quì tím, KMnO4. Số thuốc thử có thể dùng để phân biệt 3 chất: etanal (anđehit axetic), propan−2−on (axeton) và pent−1−in (pentin−1) là:A. 1. B. 4. C. 3. D. 2.
Câu 2: Cho 2,44 g hỗn hợp A gồm hai andehit no, đơn chức có phân tử khối hơn kém nhau 14 đvc tác dụng với dung dịch AgNO3 trong NH3 sinh ra 6,48 g Ag. CTPT các chất trong hỗn hợp A là:
Câu 3: Đốt cháy một hỗn hợp các đồng đẳng của anđehit ta thu được nCO2= nH2O. Các chất đó thuộc đồng đẳng nào trong các chất sau?
A. Anđehit đơn chức no B. Anđehit vòng no C. Anđehit hai chức no D. Anđehit không no đơn chức
Câu 4: Cho Andehit có CTCT: CH3-CH(C2H5)-CH2-CH(CH3)-CH2-CHO. Theo danh pháp IUPAC andehit trên có tên gọi là:
A. 5-etyl-3-metylhexanal B. 3,5-dimetylhept-7-al C. 3,5-dimetylheptanal D. 2-etyl-4-metylheptanl
Câu 5: CH3CHO phản ứng với những chất nào?
A. H2, CuO, H2O B. dung dịch Br2, Na C. Na, O2, dung dịch Cu(OH)2 D. H2, dung dịch AgNO3/NH3
Câu 6: Một hỗn hợp X gồm hai anđehit A, B đơn chức. Cho 0,25 mol hỗn hợp X tác dụng với dung dịch AgNO3/NH3 dư tạo ra 86,40 gam kết tủa. Biết MA < MB. A ứng với công thức phân tử nào dưới đây?
Câu 7: Hợp chất hữu cơ X (CxHyOz) có phân tử khối nhỏ hơn 90 g/mol. X tham gia phản ứng tráng gương và có thể tác dụng với H2/Ni, t0, sinh ra một ancol có cacbon bậc bốn trong phân tử. Công thức của X là:
Câu 8: Cho các chất: HCN, H2, dung dịch KMnO4, dung dịch Br2. Số chất có phản ứng với C2H5CHO là:A. 1. B. 2. C. 3. D. 4.

Mời quý thầy cô giáo và các em học sinh xem tiếp nội dung tài liệu này trong bộ sưu tập Bài tập Andehit Xeton. Ngoài ra, có thể tham khảo thêm nhiều tài liệu khác cùng chủ đề trong bộ sưu tập này. Hoặc download về làm tài liệu tham khảo bằng cách đăng nhập vào hệ thống eLib.vn của chúng tôi để tải bộ sưu tập này.
Đồng bộ tài khoản