Chuyên đề Bài tập Este

Chia sẻ: Mai Hữu Hoài | Ngày: | 3 tài liệu

0
291
lượt xem
20
download
Xem 3 tài liệu khác
  Download Vui lòng tải xuống để xem file gốc
Chuyên đề Bài tập Este

Chuyên đề Bài tập Este
Mô tả bộ sưu tập

Thư viện eLib đã biên soạn và sắp xếp các tài liệu hay tạo thành bộ sưu tập Chuyên đề Bài tập Este dưới đây để quý thầy cô và các em thuận tiện trong quá trình tham khảo. Chúc thầy cô và các em có những trải nghiệm thật thú vị.

LIKE NẾU BẠN THÍCH BỘ SƯU TẬP
Chuyên đề Bài tập Este

Chuyên đề Bài tập Este
Tóm tắt nội dung

Đây là một đoạn trích hay trong BST Chuyên đề Bài tập Este. Mời quý thầy cô tham khảo:

Câu 1. Sắp xếp theo thứ tự tăng dần nhiệt độ sôi của các chất sau: CH3OH(1), C2H5OH(2), CH3COOH(3), CH3COOC2H5(4), HCHO(5).
A. 5, 4, 1, 2, 3. B. 1, 2, 3, 4, 5. C. 5, 4, 3, 2, 1. D. 3, 2, 1, 5, 4.
Câu 2. Bốn este có công thưc phân tử: C3H4O2, C3H6O2, C4H6O2, C4H8O2. Công thức phân tử ứng với 2 este khi bị thuỷ phân cho ra hai chất hữu cơ đều có khả năng tham gia phản ứng tráng gương:
A. C3H4O2 và C4H8O2. B. C3H4O2 và C4H6O2.
C. C3H4O2 và C3H6O2. D. C4H6O2 và C4H8O2.
Câu 3. Một chất béo có công thức: CH2(OCOC17H33)-CH(OCOC15H31)-CH2(OCOC17H29). Số mol H2 cần để hiđro hoá hoàn toàn 1 mol chất béo là :
A. 6. B. 3. C. 4. D. 5.
Câu 4. Polivinyl axetat là polime được điều chế từ sản phẩm trùng hợp monome nào sau đây:
A. CH2¬=CH-COOCH3. B. CH2=CH-COOH.
C. CH2=CH-COOC2H5. D. CH2=CH-OCOCH3.
Câu 5 Khối lượng axit CH3COOH cần lấy để tác dụng vừa đủ với 10,65 gam C3H7OH (phản ứng có H2SO4 xúc tác, đun nóng, giả thiết hiệu suất phản ứng 100% ) là:
A. 9,90g B. 10,12g C.12,65g D. 10,65g
Câu 6. Một hỗn hợp gồm 2 este đơn chức X, Y có khối lượng 32,6 gam. Chia hỗn hợp trên thành 2 phần đều nhau. Xà phòng hoá hoàn toàn phần 1 bằng một lượng vừa đủ 125 ml dung dịch NaOH 2M đun nóng, thu được 1 rượu và 2 muối.Cho phần 2 tác dụng với lượng dư dung dịch AgNO3 /NH3 thu được 43,2 gam Ag. Khối lượng và công thức của các este X, Y có trong hỗn hợp ban đầu lần lượt là:
A. 24 gam HCOOCH3 và 8,6 gam C2H3COOCH3
B. B. 24 gam HCOOCH3 và 8,6 gam C2H5COOCH3
C.12 gam HCOOCH3 và 20,6 gam C2H3COOCH3
D. 12 gam HCOOCH3 và 20,6 gam CH3COOCH3
Câu 7. Xà phòng hoá hoàn toàn 0,01 mol este E (có khối lượng 8,9 gam) cần dùng vừa đủ lượng NaOH có trong 300 ml dung dịch NaOH 0,1 M thu được một rượu và 9,18 gam muối của một axit hữu cơ đơn chức, mạch hở, có mạch cacbon không phân nhánh. Công thức của E: A. C3H5(OOCC17H35)3. B. C3H5(OOCC17H33)3.
C. C3H5(OOCC17H31)3. D. C3H5(OOCC15H31)3.
Câu 8. Hợp chất hữu cơ E mạch hở, chỉ chứa một loại nhóm chức,có công thức phân tử C8H14O4. Cho E tác dụng với dung dịch NaOH thu được một rượu duy nhất là CH3OH và một muối natri của axit hữu cơ F có mạch cacbon không phân nhánh. E có công thức cấu tạo là:
A. CH3OCOCH2CH(CH3)CH2COOCH3.
B. CH3OCOCH(CH3)CH(CH3)COOCH3.
C. CH3OCOCH2C(CH3)2COOCH3.
D. CH3OCOCH2CH2CH2CH2COOCH3.
Câu. 9. Hợp chất hữu cơ E có công thức phân tử C4H6O2, thoã mãn điều kiện sau:
1) cộng H2 (xúc tác Ni, to) theo tỉ lệ mol 1:1.
2) phản ứng chậm với dung dịch NaOH ở nhiệt độ thường, chỉ phản ứng mạnh khi đun nóng.
3) sản phẩm thu được trong phản ứng với dung dịch NaOH cho phản ứng tráng gương.
Công thức cấu tạo của E là:
A. CH3-COO-CH=CH2. B. CH2=CH-CH2-COOH.
C. CH2=CH-O-CH2-CHO. D. CH3-CH=CH-COOH.
Câu 10. Trong dãy biến hoá sau
C2H6 C2H5Cl C2H5OH CH3CHO CH3COOH CH3COOC2H5 C2H5OH
Số phản ứng oxi hoá khử là:
A. 2 B. 3 C. 4 D. 6

Thư viện eLib mong rằng BST Chuyên đề Bài tập Este sẽ là tài liệu hữu ích cho quý thầy cô và các bạn học sinh.
Đồng bộ tài khoản