Tổng hợp bài tập về Este và chất béo

Chia sẻ: Nguyễn Thị Lan Phương | Ngày: | 1 tài liệu

0
235
lượt xem
2
download
  Download Vui lòng tải xuống để xem file gốc
Tổng hợp bài tập về Este và chất béo

Tổng hợp bài tập về Este và chất béo
Mô tả bộ sưu tập

Mời quý thầy cô giáo và các em học sinh tham khảo bộ sưu tập Tổng hợp bài tập về Este và chất béo trên thư viện eLib của chúng tôi. Hi vọng rằng, các tài liệu trong bộ sưu tập do chúng tôi sưu tầm và tổng hợp sẽ giúp ích cho công tác dạy và học của quý thầy cô giáo và các em học sinh. Chúc quý thầy cô giáo giảng dạy hay, các em học sinh học tập tốt.

LIKE NẾU BẠN THÍCH BỘ SƯU TẬP
Tổng hợp bài tập về Este và chất béo

Tổng hợp bài tập về Este và chất béo
Tóm tắt nội dung

Bộ sưu tập Tổng hợp bài tập về Este và chất béo là một trong những BST đặc sắc của eLib, được chọn lọc từ hàng trăm mẫu tư liệu một cách kỹ lưỡng, mời các bạn tham khảo đoạn trích sau đây:

1. So sánh chất béo và este về thành phần nguyên tố, đặc điểm cấu tạo phân tử và tính chất hóa học.
2. Khi đun hỗn hợp 2 axit cacboxylic với glixerol ( axit H2SO4 làm xúc tác ) có thể thu được mấy Trieste ? Viết công thức cấu tạo của các chất này.
Hướng dẫn.
Có thể thu được 6 trieste.
3. Khi thủy phân (xúc tác axit) một este thu được một glixerol và hỗn hợp axit stearic (C17H35COOH) và axit panmitic (C15H31COOh) theo tỉ lệ 2 : 1.
Este có thể có công thức cấu tạo nào sau đây?
Hướng dẫn.
Đáp án B.
4. Làm bay hơi 7,4 gam một este A no, đơn chức thu được một thể tích hơi bằng thể tích của 3,2 gam khí oxi ở cùng điều kiện nhiệt độ, áp suất.
a) Tìm công thức phân tử của A.
b) Thực hiện phản ứng xà phòng hóa 7,4 gam A với dung dịch NaOH khi đến phản ứng hoàn toàn thu được sản phẩm có 6,8 gam muối. Tìm công thức cấu tạo và tên gọi của A.
Hướng dẫn.
Vì A là este no, đơn chức nên có công thức phân tử là Cn¬H2nO2.
Ta có (mol)
=> MA = 74 g/mol =>14n+32 = 74 => n = 3.
=> Công thức phân tử của A là C3H6O2.
b)
nRCOONa = 0,1 (mol) => MRCOONa = 68 g/mol =>R là H
Công thức cấu tạo của A là HCOOC2H5 (etyl fomat).

5. Khi thủy phân a gam một este X thu được 0,92 gam glixerol, 3,02 gam natri linoleat C17H33COONa.
Tính giá trị của a, m. Viết công thức cấu tạo có thể có của X.
Hướng dẫn giải.
(mol) ; (mol).
(mol) => m = 0,02.304 = 6,08 (gam).
X là C17H31COOC3H5(C17H33COO)2 ; nX = nglixerol = 0,01 mol
=> a = 0,01.882 = 8,82 (gam).
6. Thủy phân hoàn toàn 8,8 gam este đơn chức, mạch hở X với 100ml dung dịch KOH 1M (vừa đủ) thu được 4,6 gam một ancol Y. Tên gọi của X là
A. etyl fomat.
B. etyl propionate.
C. etyl axetat.
D. propyl axetat.
Trả lời.
Đáp án C

ELib mong BST Tổng hợp bài tập về Este và chất béo sẽ giúp cho các em có thêm nguồn tư liệu tham khảo.
Đồng bộ tài khoản