Bộ sưu tập đề thi thử THPT Quốc gia năm 2016 môn Hóa

Chia sẻ: Lê Na | Ngày: | 10 đề thi

0
3.853
lượt xem
943
download
Xem 10 đề thi khác
  Download Vui lòng tải xuống để xem file gốc
   Like fanpage Thư viện Đề thi Kiểm tra để cùng chia sẻ kinh nghiệm làm bài
Bộ sưu tập đề thi thử THPT Quốc gia năm 2016 môn Hóa

Mô tả BST Bộ sưu tập đề thi thử THPT Quốc gia năm 2016 môn Hóa

Mời các em học sinh 12 cùng các thầy cô giáo bộ môn tham khảo các đề thi trong Bộ sưu tập đề thi thử THPT Quốc gia năm 2016 môn Hóa sau đây. Bộ sưu tập tổng hợp các đề thi thử tốt nghiệp THPT Quốc gia năm 2016 của môn Hóa ở các trường THPT khác nhau trên toàn quốc nhằm phục vụ cho nhu cầu ôn thi tốt nghiệp THPT Quốc gia sắp tới. Chúc các em ôn thi đạt kết quả cao.

LIKE NẾU BẠN THÍCH BỘ SƯU TẬP
Xem Giáo viên khác thảo luận gì về BST
SỞ GD & ĐT VĨNH PHÚC ĐỀ THI KHẢO SÁT CHẤT LƯỢNG LẦN 2 - LỚP 12 TRƯỜNG THPT YÊN LẠC NĂM HỌC: 2015 - 2016 ĐỀ THI MÔN: HÓA HỌC (Đề thi có 04 trang) Thời gian làm bài: 90 phút; (50 câu trắc nghiệm) Mã đề thi 352 Họ, tên thí sinh:...................................................................Số báo danh:.................. Cho: H = 1; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; S = 32; P = 31; Cl = 35,5; K = 39; Be = 9; Li = 7; Ca = 40; Ba = 137; Cr = 52; F = 19; Mn = 55; Ni =59; Fe = 56; Cu = 64; Zn = 65; Br = 80; Ag = 108; Ba = 137; I = 127; Si = 28; Rb = 85. Câu 1: Trong dãy các chất sau: (1): CH3NH2, (2): CH3-NH-CH3, (3): NH3, (4): C6H5NH2, (5): KOH. Dãy sắp xếp các chất theo chiều tăng dần tính bazơ là A. (5) < (4) < (3) < (1) < (2). B. (5) < (4) < (3) < (2) < (1). C. (4) < (3) < (1) < (2) < (5). D. (4) < (3) < (2) < (1) < (5). Câu 2: Kim cương có cấu tạo kiểu mạng tinh thể A. nguyên tử. B. kim loại. C. phân tử. D. ion. Câu 3: Cho 18,4 gam hỗn hợp X gồm Cu2S, CuS, FeS2 và FeS tác dụng hết với HNO3 (đặc nóng, dư) thu được V lít khí chỉ có NO2 (ở đktc, sản phẩm khử duy nhất ) và dung dịch Y. Cho toàn bộ Y vào một lượng dư dung dịch BaCl2, thu được 46,6 gam kết tủa; còn khi cho toàn bộ Y tác dụng với dung dịch NH3 dư thu được 10,7 gam kết tủa. Giá trị của V là A. 24,64. B. 11,2. C. 16,8. D. 38,08. Câu 4: Cho sơ đồ phản ứng sau: +H2SO4d +H2O +CuO CH3CH2CH2OH A B D t0 H+ t0 (A, B, D là những sản phẩm chính). Xác định công thức cấu tạo của D? A. CH3COOH. B. CH3CH2CHO. C. CH3CH2COOH. D. CH3COCH3. Câu 5: Phân tử tinh bột được cấu tạo từ A. các gốc  fructozơ. B. các gốc  glucozơ. C. các gốc  glucozơ. D. các gốc  fructozơ. Câu 6: Cho các chất sau: Al(OH)3 (1), H2O (2), NaHCO3 (3), CuO (4), Na2CO3 (5). Theo thuyết Bronsted, trong dãy các chất sau đây, dãy chất nào mà tất cả các chất đều là lưỡng tính ? A. (1), (3). B. (1), (2), (3), (4) C. (1), (2), (3), (4), (5). D. (1), (2), (3). Câu 7: Để nhận biết ba dung dịch H2NCH2COOH, CH3CH2COOH và CH3NH2 người ta dùng một hoá chất duy nhất nào sau đây? A. Quỳ tím. B. Dung dịch HCl. C. Dung dịch H2SO4. D. Dung dịch NaOH. Câu 8: Một loại phân kali có thành phần chính là KCl (còn lại là tạp chất không chứa kali) được sản xuất từ quặng xinvinit có độ dinh dưỡng 55 %. Phần trăm khối lượng của KCl trong loại phân kali đó là A. 88,52 %. B. 87,18 %. C. 65,75 %. D. 95,51 %. Câu 9: Cho 5,9 gam amin đơn chất X tác dụng vừa đủ với dung dịch HCl, sau phản ứng xảy ra hoàn toàn thu được dung dịch Y. Làm bay hơi dung dịch Y được 9,55 gam muối khan. Số công thức cấu tạo ứng với công thức phân tử của X là A. 4. B. 3. C. 5. D. 2. Câu 10: Cho các dung dịch sau: KCl, AlCl3, Na2CO3, NH4NO3, Na2S, Fe2(SO4)3, BaCl2, KHSO4. Nhận xét đúng là A. Có 4 dung dịch không làm đổi màu quỳ tím. B. Có 3 dung dịch có pH = 7. C. Có 5 dung dịch có pH < 7. D. Có 2 dung dịch làm quỳ tím hóa xanh. Câu 11: Cho 18,5 gam hỗn hợp gồm Fe và Fe3O4 tác dụng với 200 ml dung dịch HNO3 loãng, nóng, khuấy đều đến phản ứng hoàn toàn thu được 2,24 lít khí NO duy nhất (ở đktc), dung dịch X và 1,46 gam kim loại dư. Tính nồng độ mol của dung dịch HNO3 ? A. 3,2 M. B. 3,35 M. C. 3,3 M. D. 3,4 M. Câu 12: Axit fomic phản ứng được với tất cả các chất trong nhóm chất nào sau đây? Trang 1/5 - Mã đề thi 352 A. Na, Cu(OH)2, AgNO3/NH3. B. Ag, AgNO3/NH3, Cu(OH)2. C. Zn, H2SO4, AgNO3/NH3. D. Cu, NaOH, Cu(OH)2. Câu 13: Cho 26,4 gam hỗn hợp hai chất hữu cơ có cùng công thức phân tử C 4H8O2 tác dụng với dung dịch NaOH vừa đủ, thu được dung dịch X chứa 28,8 gam hỗn hợp muối và m gam ancol Y. Đun Y với dung dịch H2SO4 đặc ở nhiệt độ thích hợp, thu được chất hữu cơ Z có tỉ khối hơi so với Y bằng 0,7. Biết các phản ứng xảy ra hoàn toàn. Giá trị của m là A. 6,0. B. 6,4. C. 9,6. D. 4,6. Câu 14: Có các nhận định sau: (1) Lipit là một loại chất béo. (2) Lipit gồm chất béo, sáp, sterit, photpholipit,.... (3) Chất béo là các chất lỏng. (4) Chất béo chứa các gốc axit không no thường là chất lỏng ở nhiệt độ thường. (5) Phản ứng thủy phân chất béo trong môi trường kiềm là phản ứng thuận nghịch. (6) Chất béo là thành phần chính của dầu mỡ động,thực vật. Các nhận định đúng là A. 3, 4, 5. B. 2, 4, 6. C. 1, 2, 4, 5. D. 1, 2, 4, 6. Câu 15: Đốt cháy hoàn toàn 3 lít hỗn hợp X gồm 2 anken kế tiếp nhau trong dãy đồng đẳng cần vừa đủ 10,5 lít O2 (các thể tích khí đo trong cùng điều kiện nhiệt độ, áp suất). Hiđrat hóa hoàn toàn X trong điều kiện thích hợp thu được hỗn hợp ancol Y, trong đó khối lượng ancol bậc hai bằng 6/13 lần tổng khối lượng các ancol bậc một. Phần trăm khối lượng của ancol bậc một (có số nguyên tử cacbon lớn hơn) trong Y là A. 7,89 %. B. 31,58 %. C. 10,88 %. D. 46,43 %. Câu 16: Cho phản ứng : Br2 + HCOOH  2HBr + CO2. Nồng độ ban đầu của Br2 là a mol/lít, sau 50 giây nồng độ Br2 còn lại là 0,01 mol/lít. Tốc độ trung bình của phản ứng trên tính theo Br2 là 4.10-5 mol/(l.s). Giá trị của a là A. 0,018. B. 0,014. C. 0,016. D. 0,012. Câu 17: Tơ nào sau đây là tơ bán tổng hợp? A. Tơ nilon-6. B. Tơ nitron. C. Tơ visco. D. Tơ tằm. Câu 18: Cho 200 ml dung dịch H3PO4 1M vào 250 ml dung dịch hỗn hợp NaOH 0,5M và KOH 1,5. Sau khi phản ứng hoàn toàn thu được dung dịch X. Số gam muối có trong dung dịch X là A. 38,4 gam. B. 32,6 gam. C. 36,6 gam. D. 40,2 gam. Câu 19: Trong các nhóm chất sau, nhóm nào mà tất cả các chất đều phản ứng thế với clo khi có mặt của ánh sáng khuếch tán ? A. Metan, etan, benzen. B. Metan, etan, etilen. C. Metan, etan, stiren. D. Metan, toluen, etan. Câu 20: Trong công nghiệp HNO3 được điều chế theo sơ đồ sau: NH3  NO  NO2  HNO3 O2 t o ,xúc tác  O2  O2 , H2O  Nếu ban đầu có 10 mol NH3 và hiệu suất của toàn bộ quá trình là 80% thì khối lượng HNO3 thu được là A. 630 gam. B. 322,56 gam. C. 504 gam. D. 787,5 gam. Câu 21: Cho các phản ứng sau: (a) Sục khí etin vào dung dịch KMnO4 loãng. (b) Cho hơi ancol etylic đi qua bột CuO nung nóng. (c) Sục khí etilen vào dung dịch Br2 trong CCl4. (d) Cho dung dịch glucozơ vào dung dịch AgNO3 trong NH3 dư, đun nóng. (e) Cho Fe2O3 vào dung dịch H2SO4 đặc, nóng. (f) Cho dung dịch saccarozơ tác dụng với Cu(OH)2. Trong các thí nghiệm trên, số thí nghiệm có xảy ra phản ứng oxi hóa - khử là A. 5. B. 6. C. 4. D. 3. Câu 22: Cho các phản ứng sau: (1) X + 2NaOH  2Y + H2O to  (2) Y + HClloãng  Z + NaCl Biết X là hợp chất hữu cơ có công thức phân tử là C4H6O5. Cho 11,4 gam Z tác dụng với Na dư thì số mol khí H2 thu được là A. 0,450. B. 0,150. C. 0,300. D. 0,075. Trang 2/5 - Mã đề thi 352 Câu 23: Hòa tan hoàn toàn 20,88 gam một oxit sắt bằng dung dịch H2SO4 đặc nóng thu được dung dịch X vầ 3,248 lít khí SO2 (sản phẩm khử duy nhất, ở đktc). Cô cạn dung dịch X thu được m gam muối sunfat khan. Giá trị của m là A. 52,2. B. 54,0. C. 48,4. D. 58,0. Câu 24: Kim loại dẫn điện tốt nhất là A. Ag. B. Cu. C. Al. D. Au. Câu 25: Trong các thí nghiệp sau: (1) Cho SiO2 tác dụng với axit HF. (2) Cho khí SO2 tác dụng với khí H2S. (3) Cho khí NH3 tác dụng với CuO đun nóng. (4) Cho CaOCl2 tác dụng với HCl đặc. (5) Cho Si đơn chất tác dụng với dung dịch NaOH. (6) Cho khí O3 tác dụng với Ag. (7) Cho dung dịch NH4Cl tác dụng với dung dịch NaNO2 đun nóng. Số thí nghiệm tạo ra đơn chất là A. 4. B. 5. C. 7. D. 6. Câu 26: Trong phòng thí nghiệm HX được điều chế từ phản ứng sau: NaX(rắn) + H2SO4 (đặc, nóng)  NaHSO4(hoặc Na2SO4) + HX(khí) Hãy cho biết phương pháp trên có thể dùng để điều chế được dãy HX nào sau đây ? A. HF, HCl, HBr, HI. B. HF, HCl, HNO3. C. HCl, HBr, HI. D. HBr và HI. Câu 27: Tripeptit mạch hở X và tetrapeptit mạch hở Y đều được cấu tạo từ một aminoaxit no, mạch hở có 1 nhóm -COOH và 1 nhóm -NH2. Đốt cháy hoàn toàn 0,1 mol X thu được sản phẩm gồm CO2, H2O, N2 trong đó tổng khối lượng của CO2 và H2O là 36,3 gam. Nếu đốt cháy hoàn toàn 0,2 mol Y cần số mol O2 là A. 1,875 B. 3,375 C. 2,8 D. 1,8 Câu 28: Điện phân 150ml dd AgNO3 1M với điện cực trơ trong t giờ, cường độ dòng điện không đổi 1,34A (hiệu suất quá trình điện phân là 100%) thu được chất rắn X, dd Y và khí Z. Cho 13 gam Fe vào dd Y , sau khi các phản ứng kết thúc thu được 14,9 gam hỗn hợp kim loại và khí NO (sản phẩm khử duy nhất của N +5). Giá trị của t là A. 1,0. B. 1,5. C. 3,0. D. 2,0. Câu 29: Cho dung dịch A chứa H2SO4 0,1 M; HNO3 0,2 M và HCl 0,3 M. Trộn 300 ml dung dịch A với V lít dung dịch B gồm NaOH 0,2 M và KOH 0,29 M thu được dung dịch C có pH = 2. Giá trị của V là A. 0,441. B. 0,134. C. 0,424. D. 0,414. Câu 30: Công thức của metyl fomat là A. HCOOC2H5. B. CH3COOCH3. C. HCOOCH3. D. CH3COOH. Câu 31: Hòa tan hoàn toàn 8,8 gam hợp kim Mg - Cu bằng axit HNO3, sau phản ứng thu được 4,48 lít hỗn hợp khí B gồm NO và NO2 (ở đktc, ngoài ra không còn sản phẩm khử nào khác). Biết tỉ khối của B so với H2 bằng 19. Thành phần của Mg trong hợp kim là A. 27,27 %. B. 22,77 %. C. 72,72 %. D. 50,00 %. Câu 32: Trong những đồng phân mạch hở của C4H6 có bao nhiêu chất khi cộng Br2 theo tỉ lệ mol 1 : 1 thì tạo thành cặp đồng phân cis - trans ? A. 3 chất. B. 4 chất. C. 5 chất. D. 6 chất. Câu 33: Trộn 0,05 mol HCHO với một anđehit D thu được hỗn hợp X. Cho hỗn hợp X tác dụng với dung dịch AgNO3/NH3 dư thu được 25,92 gam Ag. Mặt khác khi đốt hoàn toàn X thu được 1,568 lít CO2 (ở đktc). Xác định công thức cấu tạo của D ? A. OHC-CH2-CHO. B. OHC-CHO. C. CH3-CH2-CHO. D. CH3CHO. Câu 34: Khi thủy phân một phân tử peptit X thu được một phân tử glyxin, hai phân tử alanin và một phân tử valin. Số đồng phân vị trí của peptit X là A. 10. B. 6. C. 12. D. 24. Câu 35: Cho 8,8 gam anđehit axetic (CH3CHO) tham gia phản ứng tráng gương trong dung dịch AgNO3/NH3 dư thì thu được m gam Ag. Giá trị của m là A. 21,6. B. 4,32. C. 43,2. D. 10,8. Câu 36: Đốt cháy m gam hỗn hợp X gồm hai ancol kế tiếp nhau trong dãy đồng đẳng, thu được 4,48 lít khí CO2 (đktc) và 5,85 gam H2O. Mặt khác, nếu cho 2m gam X đi qua CuO ( dư ) nung nóng, rồi cho toàn bộ lượng anđehit sinh ra tác dụng với AgNO3/NH3 thì thu được x gam Ag. Biết các phản ứng xảy ra hoàn toàn. Giá trị của x là A. 75,6. B. 27,0. C. 54,0. D. 37,8. Câu 37: Cho 3,24 gam Al2(SO4)3 phản ứng với 25 ml dung dịch NaOH thu được 0,78 gam kết tủa trắng. Xác định nồng độ mol dung dịch NaOH đã dùng ? Trang 3/5 - Mã đề thi 352 A. 1,2M và 2,4M. B. 1,2M và 2,8M. C. 1,2M. D. 2,8M. Câu 38: Cho hỗn hợp X gồm Al và Al2O3 có tỷ lệ khối lượng tương ứng là 0,18 : 1,02. Cho X tan trong dung dịch NaOH vừa đủ thu được dung dịch Y và 0,672 lít khí H2 (ở đktc). Cho Y tác dụng với 200 ml dung dịch HCl được kết tủa Z. Nung Z ở nhiệt độ cao đến khối lượng không đổi được 3,57 gam chất rắn. Nồng độ mol của dung dịch HCl là A. 0,07 M hoặc 0,09 M. B. 0,35 M hoặc 0,45 M. C. 0,07 M hoặc 0,11 M. D. 0,35 M hoặc 0,55 M. Câu 39: Nhiệt phân hoàn toàn 18,8 gam Cu(NO3)2 ta thu được sản phẩm khí, dẫn vào nước để được 200 ml dung dịch X. Tính nồng độ mol của dung dịch X? A. 0,5 M. B. 2,0 M. C. 1,0 M. D. 1,5 M. Câu 40: Cho dãy các chất sau: axit axetic, anđehit fomic, ancol benzylic, cumen, etylaxetat, glucozơ, etylamin. Số chất trong dãy có thể tác dụng với Cu(OH)2 là A. 4. B. 2. C. 3. D. 5. Câu 41: Một dung dịch gồm: 0,03 mol, K+; 0,04 mol Ba2+; 0,05 mol HCO3- và a mol ion X (bỏ qua sự điện li của nước). Ion X và giá trị của a lần lượt là A. Cl- và 0,03. B. NO3- và 0,06. C. OH- và 0,06. D. SO42- và 0,03. Câu 42: Cho hình vẽ về cách thu khí dời nước như sau: Hình vẽ bên có thể áp dụng để thu được những khí nào trong các khí sau đây ? A. NH3, O2, N2, HCl, CO2. B. H2, N2, O2, CO2, HCl, H2S. C. CO2, O2, N2, H2. D. NH3, HCl, CO2, SO2, Cl2. Câu 43: Trong số các loại hợp chất sau, loại hợp chất nào được gọi là “mang hương sắc cho đời” ? A. Hiđrocacbon thơm. B. Tecpen. C. Este. D. Lipit. Câu 44: Hợp chất nào sau đây thuộc loại đipeptit ? A. H2N-CH2-CO-NH-CH(CH3)-COOH. B. H2N-CH2-NH-CH2COOH. C. H2N-CH2-CH2-CO-NH-CH2-CH2-COOH. D. H2N-CH2-CH2-CO-NH-CH2-COOH. Câu 45: Một nguyên tử có tổng số e ở 2 lớp M và N là 9. Vị trí của nguyên tố đó trong bảng tuần hoàn là A. Chu kì 3, nhóm IIA. B. Chu kì 4, nhóm IA. C. Chu kì 4, nhóm IIA. D. Chu kì 4, nhóm IA. Câu 46: Cho phản ứng: Fe + X  FeCl2 + ...Chất X nào sau đây đã chọn không đúng? A. HCl. B. CuCl2. C. Cl2. D. FeCl3. Câu 47: Cho hợp chất hữu cơ có công thức phân tử C6H10. Điều khẳng địmh nào sau đây là đúng ? A. Phân tử C6H10 có tổng số liên kết π và vòng bằng 2. B. Phân tử C6H10 là ankađien. C. Phân tử C6H10 có hai liên kết π D. Phân tử C6H10 là ankin. Câu 48: Đốt cháy hoàn toàn m gam FeS2 bằng một lượng O2 vừa đủ, thu được khí X. Hấp thụ hết X vào 1 lít dung dịch chứa Ba(OH)2 0,15 M và KOH 0,1 M, thu được dung dịch Y và 21,7 gam kết tủa. Cho Y vào dung dịch NaOH, thấy xuất hiện thêm kết tủa. Giá trị của m là A. 12,6. B. 18,0. C. 24,0. D. 23,2. Câu 49: Hỗn hợp A gồm FeS2 và Cu2S. Hòa tan hoàn toàn A bằng dd HNO3 đặc nóng, thu được 26,88 lít (đktc) khí X là sản phẩm khử duy nhất và dd B chỉ chứa 2 muối. Khối lượng của Cu2S trong hỗn hợp đầu là A. 14,4 gam. B. 9,6 gam. C. 7,2 gam. D. 4,8 gam. Câu 50: Có thể làm khô khí NH3 bằng: A. Khí HCl. B. P2O5. C. H2SO4 đặc. D. CaO. ----------------------------------------------- ----------- HẾT ---------- Giám thị coi thi không giải thích gì thêm. Trang 4/5 - Mã đề thi 352 ĐÁP ÁN 352 Đáp án 352 Đáp án 352 Đáp án 352 Đáp án 352 Đáp án 1 C 11 A 21 C 31 A 41 B 2 A 12 A 22 B 32 B 42 C 3 D 13 A 23 D 33 B 43 B 4 D 14 B 24 A 34 C 44 A 5 B 15 A 25 D 35 C 45 B 6 D 16 D 26 B 36 A 46 C 7 A 17 C 27 D 37 B 47 A 8 B 18 C 28 D 38 D 48 B 9 A 19 D 29 D 39 C 49 D 10 D 20 C 30 C 40 C 50 D Trang 5/5 - Mã đề thi 352

 

SỞ GD & ĐT VĨNH PHÚC ĐỀ KHẢO SÁT CHẤT LƯỢNG LẦN 1 LỚP 12 TRƯỜNG THPT YÊN LẠC NĂM HỌC 2015-2016 Đề thi có 04 trang ĐỀ THI MÔN: HÓA HỌC Thời gian làm bài : 90 phút , không kể thời gian giao đề Mã đề thi 132 Họ, tên thí sinh:........................................................................................................Số báo danh:.................. Cho: H = 1; C = 12; N = 14; O = 16; F = 19; Na = 23; Mg = 24; Al = 27; Si = 28; P = 31; S = 32; Cl = 35,5; K = 39; Ca = 40; Cr = 52; Mn = 55; Fe = 56; Cu = 64; Zn = 65; Br = 80; Ag = 108; Sn = 119; Ba = 137; Pb = 207. Câu 1: Hòa tan hoàn toàn 52,2 gam MnO2 trong dung dịch HCl đặc, nóng, dư thì sau phản ứng thu được bao nhiêu lít khí Cl2 ở đkc? A. 11,2. B. 13,44. C. 8,96. D. 6,72. Câu 2: Chất nào sau đây có phản ứng trùng hợp tạo polime? A. Ancol etylic B. Etilen C. Benzen D. Toluen Câu 3: Cho 0,02 mol amino axit X (trong phân tử có một nhóm -NH2) phản ứng vừa đủ với 40 ml dung dịch NaOH 1M, thu được dung dịch chứa 3,82 gam muối. Công thức của X là A. H2N-C2H4-COOH. B. H2N-C2H3-(COOH)2. C. H2N-CH2-COOH. D. H2N-C3H5-(COOH)2. Câu 4: Hòa tan hoàn toàn 3,6 gam Mg bằng dung dịch HNO3 (loãng, dư), thu được V ml khí N2 (đktc, sản phẩm khử duy nhất). Giá trị của V là A. 560. B. 840. C. 784. D. 672. Câu 5: Thêm 250 ml dung dịch NaOH 2M vào 200 ml dung dịch H3PO4 1,5M. Muối tạo thành và khối lượng tương ứng là: A. 28,4 gam Na2HPO4; 16,4 gam Na3PO4. B. 24,0 gam NaH2PO4; 14,2 gam Na2HPO4. C. 14,2 gam Na2HPO4; 32,8 gam Na3PO4. D. 12,0 gam NaH2PO4; 28,4 gam Na2HPO4. Câu 6: Dung dịch X gồm Ba(OH)2 1M và NaOH 1M; dung dịch Y gồm HCl 0,125M và H2SO4 0,375M. Trộn 10 ml X với 40 ml Y, được dung dịch Z. Giá trị pH của Z là A. 1. B. 12. C. 2. D. 13. Câu 7: Dung dịch X gồm 0,3 mol K ; 0,6 mol Mg ; 0,3 mol Na ; 0,6 mol Cl và a mol Y2-. Cô cạn dung dịch X, thu + 2+ + - được m gam muối khan. Ion Y2- và giá trị của m là A. SO2 và 169,5. 4 B. CO3  và 126,3. 2 C. SO2 và 111,9. 4 D. CO3  và 90,3. 2 Câu 8: Ở trạng thái cơ bản, cấu hình electron lớp ngoài cùng của nguyên tử X là 3p1. Số hiệu nguyên tử của nguyên tố X là A. 13. B. 14. C. 12. D. 11. Câu 9: Hòa tan hoàn toàn 12,05 gam hỗn hợp X gồm CuO, ZnO, Fe2O3 bằng 171,5 gam dung dịch H2SO4 20% thì phản ứng vừa đủ. Khối lượng muối khan thu được sau phản ứng là A. 46,35 gam. B. 183,55 gam. C. 40,05 gam. D. 45,65 gam. Câu 10: Phenol không tham gia phản ứng với tác nhân nào cho dưới đây? A. Dung dịch Br2. B. Dung dịch NaOH. C. Dung dịch HCl. D. Kim loại K. Câu 11: Xà phòng hóa hoàn toàn 3,7 gam HCOOC2H5 trong dung dịch NaOH (vừa đủ), thu được dung dịch chứa m gam muối. Giá trị của m là A. 4,1. B. 8,2. C. 6,8. D. 3,4. Câu 12: Có bao nhiêu este có cùng công thức phân tử C4H8O2: A. 4. B. 2. C. 5. D. 3. Câu 13: Kim loại M phản ứng được với các dung dịch HCl, Cu(NO3)2, HNO3 (đặc, nguội). M là kim loại nào dưới đây? A. Zn. B. Ag. C. Al. D. Fe. Câu 14: Thủy phân hoàn toàn 16,12 gam tripanmitin ((C15H31COO)3C3H5) cần vừa đủ V ml dung dịch NaOH 0,5M. Giá trị của V là A. 240. B. 80. C. 160. D. 120. Câu 15: Nung 17,22 gam natri axetat với NaOH (dư) với CaO làm xúc tác đến phản ứng hoàn toàn thu được V lít khí Y (đktc). Giá trị của V là A. 7,056 lít. B. 2,352 lít. C. 4,704 lít. D. 10,080 lít. Câu 16: Amin X đơn chức. X tác dụng với HCl thu được muối Y có công thức là RNH3Cl. Trong Y, clo chiếm 32,42% về khối lượng. Hãy cho biết X có bao nhiêu công thức cấu tạo? Trang 1/5 – Mã đề thi 132 A. 3. B. 5. C. 4. D. 2. Câu 17: Chất không phải axit béo là A. axit oleic. B. axit panmitic. C. axit fomic. D. axit stearic. Câu 18: Cho phương trình hóa học: aFe3O4 + bHNO3  cFe(NO3)3 + dNO + eH2O Tỉ lệ a:e nguyên, tối giản là: A. 3:28. B. 3:14. C. 9:14. D. 9:28. Câu 19: Dẫn V lít khí CO (đktc) qua ống sứ nung nóng đựng lượng dư CuO. Sau khi phản ứng hoàn toàn, khối lượng chất rắn giảm 3,2 gam. Giá trị của V là A. 2,24. B. 3,36. C. 4,48. D. 5,60. Câu 20: Chất nào sau đây không có phản ứng tráng bạc? A. HCOOCH=CH2. B. C2H2. C. CH3CH=O. D. HCOOCH3. Câu 21: Cho các phát biểu sau: (1). Nitơ lỏng được dùng để bảo quản máu và các mẫu vật sinh học. (2). Phân amophot là hỗn hợp các muối (NH4)2HPO4 và KNO3 (3). Fomalin được dùng để ngâm xác động vật. (4). Axit flohiđric được dùng để khắc chữ lên thủy tinh. (5). Naphtalen được dùng làm chất chống gián. (6). Axit glutamic là thuốc hỗ trợ thần kinh. (7). Khí CO2 được dùng để dập tắt đám cháy magie hoặc nhôm. (8). Trong y khoa, ozon được dùng chữa sâu răng. Số phát biểu đúng là A. 3. B. 6. C. 5. D. 4. Câu 22: Cho 3,36 lít khí CO2 (đktc) vào dung dịch chứa 500 ml KOH 0,1M và Ba(OH)2 0,12M kết thúc phản ứng thu được m gam kết tủa. Giá trị của m là A. 2,55. B. 3,94. C. 1,97. D. 4,925. Câu 23: Cho các polime sau: nilon-6,6; teflon; thủy tinh hữu cơ; poli (vinyl clorua); tơ lapsan; cao su Buna-S; nilon-6; tơ nitron; tơ capron; nilon-7. Số polime được điều chế bằng phản ứng trùng ngưng là A. 4. B. 5. C. 6. D. 3. Câu 24: Dung dịch X chứa đồng thời 0,02 mol Cu(NO3)2 và 0,1 mol H2SO4 loãng. Khối lượng Fe tối đa có khả năng  tác dụng với dung dịch X là (biết sản phẩm khử của NO 3 là khí NO duy nhất) A. 5,6 gam. B. 4,48 gam. C. 2,24 gam. D. 3,36 gam. Câu 25: Trong một bình kín chứa 0,10 mol SO2; 0,06 mol O2 (xúc tác V2O5). Nung nóng bình một thời gian, thu được hỗn hợp khí X (hiệu suất phản ứng bằng 80%). Cho toàn bộ X vào dung dịch BaCl2 dư, đến khi phản ứng xảy ra hoàn toàn, thu được m gam kết tủa. Giá trị của m là A. 23,30. B. 18,64. C. 13,98. D. 22,98. Câu 26: Cho các dung dịch sau: anilin, axit glutamic, alanin, trimetylamin, natri cacbonat, kali sunfua, nhôm clorua, natri hiđrosunfat, lysin, valin. Số dung dịch làm quỳ tím chuyển sang màu xanh là A. 5. B. 3. C. 6. D. 4. Câu 27: Thủy phân hết m gam tetrapeptit Ala-Ala-Ala-Ala thu được hỗn hợp gồm 28,48 gam Ala; 32,00 gam đipeptit Ala – Ala và 27,72 gam tripeptit Ala – Ala – Ala. Giá trị của m là A. 111,74 gam. B. 90,6 gam. C. 66,44 gam. D. 81,54 gam. Câu 28: Thủy phân dung dịch chứa 34,2 gam mantozơ một thời gian thu được dung dịch X. Lấy toàn bộ dung dịch X cho tác dụng với lượng dư dung dịch AgNO3 trong NH3 đun nóng, sau phản ứng hoàn toàn thu được 31,32 gam Ag. Hiệu suất của phản ứng thủy phân mantozơ là A. 50%. B. 55,5%. C. 72,5%. D. 45%. Câu 29: Cho đồ thị biểu diễn nhiệt độ sôi của một số chất sau: Trang 2/5 – Mã đề thi 132 ĐỒ THỊ BIỂU DIỄN NHIỆT ĐỘ SÔI MỘT SỐ CHẤT 150 118 100 78 50 21 0 A B C Chất A, B, C lần lượt là các chất sau: A. CH3CHO, CH3COOH, C2H5OH B. CH3COOH, C2H5OH, CH3CHO. C. C2H5OH, CH3CHO, CH3COOH. D. CH3CHO, C2H5OH, CH3COOH. Câu 30: Xác định các chất (hoặc hỗn hợp) X và Y tương ứng không thỏa mãn thí nghiệm sau: A. NaHCO3, CO2. B. NH4NO3; N2. C. Cu(NO3)2; (NO2, O2). D. KMnO4; O2. Câu 31: Cho 3,9 gam hỗn hợp X gồm hai ancol no, đơn chức, kế tiếp nhau trong dãy đồng đẳng tác dụng với CuO (dư) nung nóng, thu được chất rắn Z và hỗn hợp hơi Y (có tỉ khối so với H2 là 13,75). Cho toàn bộ Y phản ứng với một lượng dư dung dịch AgNO3 trong NH3 đun nóng, sinh ra m gam Ag. Giá trị của m là A. 32,4 gam. B. 43,2 gam. C. 21,6 gam. D. 10,8 gam. Câu 32: Chia m gam hỗn hợp gồm 3 kim loại Mg, Al, Cu thành 2 phần bằng nhau: - Phần 1: Cho tác dụng với dung dịch HNO3 đặc, nóng dư thu được 10,528 lít khí NO2 (đktc, là sản phẩm khử duy nhất). - Phần 2: Tác dụng với Cl2 dư thu được 27,875g hỗn hợp muối clorua. Khối lượng m gam hỗn hợp kim loại là A. 22,38 gam. B. 20,38 gam. C. 11,19 gam. D. 10,19 gam. Câu 33: Cho các thí nghiệm sau: (1) Cho khí CO2 dư vào dung dịch natri aluminat. (2) Cho dung dịch NH3 dư vào dung dịch AlCl3. (3) Cho khí etilen vào dung dịch KMnO4. (4) Cho dung dịch NaOH dư vào dung dịch AlCl3. (5) Cho dung dịch NaOH dư vào dung dịch (NH4)3PO4, đun nóng. (6) Cho khí SO2 vào dung dịch H2S. (7) Cho khí axetilen đi qua dung dịch AgNO3 trong NH3. Số trường hợp thu được kết tủa sau khi phản ứng kết thúc là: A. 5. B. 6. C. 4. D. 7. Câu 34: Cho các dung dịch sau: vinyl axetat, saccarozơ, metanol, propan-1,3-điol, anđehit axetic, glixerol, glucozơ, tinh bột, gly-gly, lòng trắng trứng. Số dung dịch phản ứng được với Cu(OH)2 ở nhiệt thường tạo thành dung dịch có màu xanh lam là A. 4. B. 3. C. 5. D. 6. Câu 35: Cho các chất sau đây: triolein, etyl axetat, saccarozơ, fructozơ, ala-gly-ala, glucozơ, xenlulozơ, mantozơ, vinyl fomat, anbumin. Số chất bị thủy phân trong môi trường kiềm là A. 8. B. 7. C. 6. D. 5. Câu 36: Cho các chất sau đây: propin, glucozơ, propyl fomat, etilen, saccarozơ, mantozơ, etyl axetat, vinyl axetilen, tinh bột, anđehit oxalic. Số chất có phản ứng với dung dịch AgNO3 trong NH3 đun nóng là A. 6. B. 7. C. 8. D. 9. Câu 37: Cho dãy các chất: CH4; C2H2; C2H4; C2H5OH; CH2=CH-COOH; C6H5NH2 (anilin); C6H5OH (phenol); C6H6 (benzen); CH3CHO. Số chất trong dãy phản ứng được với nước brom là Trang 3/5 – Mã đề thi 132 A. 5. B. 7. C. 8. D. 6. Câu 38: Để 4,2 gam sắt trong không khí một thời gian thu được 5,32 gam hỗn hợp X gồm sắt và các oxit của nó. Hòa tan hết X bằng dung dịch HNO3, thấy sinh ra 0,448 lít khí NO (đktc, sản phẩm khử duy nhất) và dung dịch Y. Vậy khối lượng muối khan thu được khi cô cạn dung dịch Y là A. 13,5 gam. B. 15,98 gam. C. 16,6 gam. D. 18,15 gam. Câu 39: Hòa tan 8,4 gam Fe trong dung dịch chứa 0,4 mol H2SO4 đặc, nóng đến khi phản ứng hoàn toàn thu được dung dịch A và V lít khí SO2 (đktc). Cô cạn dung dịch A thu được m gam muối khan. Giá trị V và m lần lượt là A. 5,04 và 30,0. B. 4,48 và 27,6. C. 5,60 và 27,6. D. 4,48 và 22,8. Câu 40: Dung dịch X chứa 0,02 mol Al ; 0,04 mol Mg ; 0,04 mol NO3 ; x mol Cl- và y mol Cu2+. Cho X tác dụng 3+ 2+ - hết với dung dịch AgNO3 dư, thu được 17,22 gam kết tủa. Mặt khác, cho 170 ml dung dịch NaOH 1M vào X, thu được m gam kết tủa. Biết các phản ứng đều xảy ra hoàn toàn. Giá trị của m là A. 4,86. B. 5,06. C. 4,08. D. 3,30. Câu 41: Chất hữu cơ X (chỉ chứa C, H, O và có công thức phân tử trùng với công thức đơn giản nhất). Cho 2,76 gam X tác dụng với dung dịch NaOH vừa đủ, sau đó chưng khô thì thu được hơi nước, phần chất rắn chứa hai muối của natri có khối lượng 4,44 gam. Đốt cháy hoàn toàn 4,44 gam hỗn hợp hai muối này trong oxi thì thu được 3,18 gam Na2CO3; 2,464 lít CO2 (đktc) và 0,9 gam nước. Phần trăm khối lượng của nguyên tố O trong X gần nhất với giá trị nào sau đây? A. 40%. B. 45%. C. 30%. D. 35%. Câu 42: Hòa tan hết 2,52 gam bột Fe vào 130 ml dung dịch HCl 1M, thu được dung dịch X. Cho X tác dụng với lượng dư dung dịch AgNO3, sau khi kết thúc các phản ứng thu được khí NO (sản phẩm khử duy nhất, đktc) và m gam chất rắn. Giá trị của m là A. 18,655. B. 4,86. C. 23,415. D. 20,275. Câu 43: Hòa tan hoàn toàn 28,11 gam hỗn hợp gồm 2 muối R2CO3 và RHCO3 vào nước, thu được dung dịch X. Chia X thành 3 phần bằng nhau. Phần một tác dụng hoàn toàn với dung dịch Ca(OH)2 dư, thu được 11 gam kết tủa. Phần hai tác dụng hoàn toàn với dung dịch CaCl2 dư, thu được 4 gam kết tủa. Phần ba phản ứng vừa đủ với V ml dung dịch NaOH 1M. Giá trị của V là A. 110. B. 220. C. 70. D. 140. Câu 44: Hòa tan hoàn toàn 25,3 gam hỗn hợp X gồm Mg, Al, Zn bằng dung dịch HNO 3. Sau khi phản ứng kết thúc thu được dung dịch Y và 4,48 lít (đktc) khí Z (gồm hai hợp chất khí không màu) có khối lượng 7,4 gam. Cô cạn dung dịch Y thu được 122,3 gam hỗn hợp muối. Tính số mol HNO3 đã tham gia phản ứng. A. 0,4 mol. B. 1,9 mol. C. 1,4 mol. D. 1,5 mol. Câu 45: Đốt cháy hoàn toàn 40,08 gam hỗn hợp X gồm axit metacrylic, axit ađipic, axit axetic và glixerol (trong đó số mol axit metacrylic bằng số mol axit axetic) bằng O2 dư, thu được hỗn hợp Y gồm khí và hơi. Dẫn Y vào dung dịch chứa 1,14 mol Ba(OH)2, thu được 147,75 gam kết tủa và dung dịch Z. Đun nóng Z lại xuất hiện kết tủa. Cho 40,08 gam hỗn hợp X tác dụng với 140 ml dung dịch KOH 3M, sau khi các phản ứng xảy ra hoàn toàn, cô cạn dung dịch thu được chất rắn khan có khối lượng là A. 56,04 gam. B. 57,12 gam. C. 43,32 gam. D. 39,96 gam. Câu 46: Chia 20,8 gam hỗn hợp gồm hai anđehit đơn chức là đồng đẳng kế tiếp thành hai phần bằng nhau: - Phần một tác dụng hoàn toàn với lượng dư dung dịch AgNO3 trong NH3 đun nóng, thu được 108 gam Ag. - Phần hai tác dụng hoàn toàn với H2 dư (xúc tác Ni, to ), thu được hỗn hợp X gồm hai ancol Y và Z (MY < MZ). Đun nóng X với H2SO4 đặc ở 140oC, thu được 4,52 gam hỗn hợp ba ete. Biết hiệu suất phản ứng tạo ete của Y bằng 50%. Hiệu suất phản ứng tạo ete của Z bằng A. 60%. B. 30%. C. 40%. D. 50%. Câu 47: Hỗn hợp X gồm Na, Ba, Na2O và BaO. Hòa tan hoàn toàn 131,4 gam X vào nước, thu được 6,72 lít khí H 2 (đktc) và dung dịch Y, trong đó có 123,12 gam Ba(OH)2. Hấp thụ hoàn toàn 40,32 lít khí CO2 (đktc) vào Y, thu được m gam kết tủa. Giá trị của m là A. 141,84. B. 94,65. C. 131,52. D. 236,40. Câu 48: Hòa tan hết 51,2 gam hỗn hợp X gồm Fe và Fe3O4 bằng dung dịch chứa 0,5 mol H2SO4 và 2,5 mol HNO3, thu được dung dịch Y và hỗn hợp gồm 0,5 mol NO và a mol NO 2 (không còn sản phẩm khử nào khác). Chia dung dịch Y thành hai phần bằng nhau: - Phần một tác dụng với 500 ml dung dịch KOH 2M, thu được 26,75 gam một chất kết tủa. - Phần hai tác dụng với dung dịch Ba(OH)2 dư, thu được m gam kết tủa. Biết các phản ứng xảy ra hoàn toàn. Giá trị của m là A. 20,21. B. 159,3. C. 206,2. D. 101,05. Câu 49: Đốt cháy 16,64 gam hỗn hợp gồm Mg và Fe trong khí O2, thu được 23,68 gam hỗn hợp X chỉ gồm các oxit. Hòa tan hoàn toàn X trong dung dịch HCl vừa đủ, thu được dung dịch Y. Cho dung dịch NaOH dư vào Y, thu được kết Trang 4/5 – Mã đề thi 132 tủa Z. Nung Z trong không khí đến khối lượng không đổi, thu được 24 gam chất rắn. Mặt khác cho Y tác dụng với dung dịch AgNO3 dư, thu được m gam kết tủa. Giá trị của m là A. 126,28. B. 128,44. C. 130,6. D. 43,20. Câu 50: Một bình kín chỉ chứa các chất sau: axetilen (1 mol), vinylaxetilen (0,8 mol), hiđro (1,3 mol) và một ít bột niken. Nung nóng bình một thời gian, thu được hỗn hợp khí X có tỉ khối so với H2 bằng 19,5. Khí X phản ứng vừa đủ với 1,4 mol AgNO3 trong dung dịch NH3, thu được m gam kết tủa và 20,16 lít hỗn hợp khí Y (đktc). Khí Y phản ứng tối đa với 1,1 mol Br2 trong dung dịch. Giá trị của m là A. 184,0. B. 92,0. C. 151,8. D. 152,2. ----------------------------------------------- ----------- HẾT ---------- Trang 5/5 – Mã đề thi 132 SỞ GD & ĐT VĨNH PHÚC ĐÁP ÁN ĐỀ KHẢO SÁT CHẤT LƯỢNG LẦN 1 LỚP 12 TRƯỜNG THPT YÊN LẠC NĂM HỌC 2015-2016 Đáp án chính thức MÔN: HÓA HỌC 1 B 11 D 21 B 31 A 41 D 2 B 12 A 22 B 32 A 42 D 3 D 13 A 23 A 33 A 43 B 4 A 14 D 24 A 34 B 44 B 5 D 15 C 25 B 35 D 45 C 6 A 16 C 26 D 36 A 46 A 7 C 17 C 27 D 37 D 47 B 8 A 18 B 28 D 38 C 48 D 9 C 19 C 29 D 39 B 49 C 10 C 20 B 30 C 40 C 50 A Trang 6/5 – Mã đề thi 132

 

SỞ GD & ĐT VĨNH PHÚC ĐỀ KHẢO SÁT CHẤT LƯỢNG TRƯỜNG THPT TRẦN PHÚ MÔN: HÓA HỌC 12 – NĂM HỌC 2015-2016 Thời gian làm bài: 90 phút; Mã đề thi 061 Họ, tên thí sinh:.......................................................................... Số báo danh:............................................................................... Câu 1: Điều chế este CH3COOCH=CH2 cần trực tiếp nguyên liệu nào sau đây? A. Axit axetic và etilen B. Axit acrylic và ancol metylic C. Anđehit axetic và axetilen D. Axit axetic và axetilen Câu 2: Công thức của glixerol là A. C3H5(OH)3. B. C3H6(OH)2. C. C3H8O3. D. C2H4(OH)2. Câu 3: Đun nóng hỗn hợp gồm hai ancol đơn chức, mạch hở, kế tiếp nhau trong dãy đồng đẳng với H2SO4 đặc ở 140oC. Sau khi các phản ứng kết thúc, thu được 6 gam hỗn hợp gồm ba ete và 1,8 gam nước. Công thức phân tử của hai ancol trên là A. CH3OH và C2H5OH. B. C2H5OH và C3H7OH. C. C3H7OH và C4H9OH. D. C3H5OH và C4H7OH. Câu 4: Hợp chất A là chất rắn, có nhiều ứng dụng như: chế tạo thuốc nổ, pháo hoa, sản xuất diêm. Chất A là A. Kali clorua. B. Natri clorua. C. Kali clorat. D. Natri hipoclorit. Câu 5: Xà phòng hóa 8,8 gam etyl axetat bằng 200 ml dung dịch NaOH 0,2M. Sau khi phản ứng xảy ra hoàn toàn, cô cạn dung dịch thu được chất rắn khan có khối lượng là A. 8,56 gam. B. 8,2 gam. C. 10,4 gam. D. 3,28 gam. Câu 6: Để điều chế 25,245kg xenlulozơ trinitrat, người ta cho xenlulozơ tác dụng với dung dịch chứa m kg HNO3 (xúc tác là H2SO4 đặc) với hiệu suất đạt 85%. Giá trị của m là A. 22,235. B. 15,7. C. 18,9 . D. 20,79. Câu 7: Tên gọi nào sau đây không phải là tên của hợp chất hữu cơ este? A. Metyl etylat B. Metyl fomat C. Etyl axetat D. Etyl fomat Câu 8: Dung dịch X chứa các ion sau: Al3+, Cu2+, SO 2 và NO3 . Để kết tủa hết ion SO 2 có trong 250 ml 4  4 dung dịch X cần 50 ml dung dịch BaCl2 1M. Cho 500 ml dung dịch X tác dụng với dung dịch NH3 dư thì được 7,8 gam kết tủa. Làm bay hơi hết nước có trong 500 ml dung dịch X được 37,3 gam hỗn hợp muối khan. Nồng  độ mol của NO3 trong dung dịch X là A. 0,3M. B. 0,6M. C. 0,2M. D. 0,4M. Câu 9: Khi thủy phân đến cùng xenlulozơ và tinh bột, ta đều thu được các phân tử glucozơ. Thí nghiệm đó chứng tỏ điều gì? A. Xenlulozơ và tinh bột đều phản ứng được với Cu(OH)2. B. Xenlulozơ và tinh bột đều là các polime có nhánh C. Xenlulozơ và tinh bột đều bao gồm các gốc glucozơ liên kết với nhau D. Xenlulozơ và tinh bột đều tham gia phản ứng tráng gương Câu 10: Tổng số liên kết pi và vòng trong phân tử C7H6O3 là A. 4. B. 2. C. 3. D. 5. Câu 11: Dẫn mẫu khí thải của một nhà máy qua dung dịch Pb(NO3)2 dư thì thấy xuất hiện kết tủa màu đen. Hiện tượng đó chứng tỏ trong khí thải nhà máy có chứa khí nào sau đây? A. NH3. B. CO2. C. H2S. D. SO2. Câu 12: Phát biểu nào sau đây không chính xác? A. Các chất có cùng khối lượng phân tử là đồng phân của nhau. B. Các chất là đồng phân của nhau thì có cùng công thức phân tử. C. Sự xen phủ trục tạo thành liên kết , sự xen phủ bên tạo thành liên kết . D. Tính chất của các chất phụ thuộc vào thành phần phân tử và cấu tạo hóa học. Câu 13: Hoà tan hoàn toàn 4,8 gam kim loại R trong H2SO4 đặc nóng thu được 1,68 lít SO2 (đktc). Lượng SO2 thu được cho hấp thụ hoàn toàn vào dung dịch NaOH dư thu được m gam muối. Kim loại R và giá trị của m là Trang 1/5 - Mã đề thi 061 A. Ag; 10,8. B. Cu; 9,45. C. Fe; 11,2. D. Zn; 13. Câu 14: Cho các chất sau: xiclopropan, benzen, stiren, metyl acrylat, vinyl axetat, đimetyl ete. Số chất có khả năng làm mất màu dung dịch Br2 là A. 6. B. 5. C. 4. D. 3. Câu 15: Chất gây hiệu ứng nhà kính là A. N2. B. CO2. C. CO. D. H2. Câu 16: Cho phản ứng hóa học: 6nCO2 + 5nH2O  (C6H10O5)n + 6nO2. asmt Clorofin  Phản ứng trên thuộc quá trình nào sau đây? A. Quá trình oxi hoá. B. Quá trình khử. C. Quá trình quang hợp. D. Quá trình hô hấp. Câu 17: Hai este X và Y có cùng CTPT C8H8O2 và chứa vòng benzen trong phân tử. Cho 6,8 gam hỗn hợp gồm X và Y tác dụng với dung dịch NaOH dư, đun nóng, lượng NaOH phản ứng tối đa là 0,06 mol, thu được dung dịch Z chứa 4,7 gam ba muối. Khối lượng muối của axit cacboxylic có phân tử khối lớn hơn trong Z là A. 3,4 gam. B. 0,82 gam. C. 2,72 gam. D. 0,68 gam. Câu 18: Một hỗn hợp gồm etilen và axetilen có thể tích 6,72 lít (đktc). Cho hỗn hợp đó qua dung dịch brom dư để phản ứng xảy ra hoàn toàn, lượng brom phản ứng là 64 gam. Phần trăm về thể tích của etilen và axetilen lần lượt là A. 34,34% và 65,66%. B. 66,67% và 33,33%. C. 33,33% và 66,67%. D. 65,66% và 34,34%. Câu 19: Nhóm gluxit đều tham gia phản ứng thuỷ phân là A. Saccarozơ, fructozơ, xenlulozơ. B. Saccarozơ, glucozơ, tinh bột. C. Saccarozơ, mantozơ, glucozơ. D. Mantozơ, tinh bột, xenlulozơ. Câu 20: Cho 3 axit: ClCH2COOH, BrCH2COOH, ICH2COOH. Dãy sắp xếp theo thứ tự tăng dần tính axit là A. ClCH2COOH < ICH2COOH < BrCH2COOH. B. ClCH2COOH < BrCH2COOH < ICH2COOH. C. BrCH2COOH < ClCH2COOH < ICH2COOH. D. ICH2COOH < BrCH2COOH < ClCH2COOH. Câu 21: Axit axetic không tác dụng được với chất nào sau đây? A. NaOH. B. CO2. C. Cu(OH)2. D. Na. Câu 22: Cho sơ đồ phản ứng sau: CH4 → X → Y→ Z→ T → C6H5OH. (X, Y, Z là các chất hữu cơ khác nhau). Z có thể là A. C6H5NO2. B. C6H5ONa. C. C6H5NH2. D. C6H5Br. Câu 23: Thí nghiệm với dung dịch HNO3 thường sinh ra khí độc NO2. Để hạn chế khí NO2 thoát ra từ ống nghiệm, biện pháp nào sau đây là hiệu quả nhất? A. Nút ống nghiệm bằng bông có tẩm nước vôi trong. B. Nút ống nghiệm bằng bông có tẩm nước. C. Nút ống nghiệm bằng bông có tẩm giấm ăn. D. Nút ống nghiệm bằng bông khô. Câu 24: Axetanđehit là tên gọi của hợp chất nào sau đây? A. CH3COOH. B. CH3CHO. C. HCHO. D. C2H5CHO. Câu 25: Cho 200 gam một loại chất béo có chỉ số axit bằng 7 tác dụng vừa đủ với một lượng NaOH thu được 207,55 gam hỗn hợp muối khan. Khối lượng NaOH đã tham gia phản ứng là A. 31 gam. B. 31,45 gam. C. 30 gam. D. 32,36 gam. Câu 26: Hòa tan hoàn toàn 20,6 gam hỗn hợp gồm Na2CO3 và CaCO3 bằng dung dịch HCl dư, thu được V lít khí CO2 (đktc) và dung dịch chứa 22,8 gam hỗn hợp muối. Giá trị của V là A. 2,24. B. 4,48. C. 1,79. D. 5,6. Câu 27: Hỗn hợp X gồm Al, Fe3O4 và CuO, trong đó oxi chiếm 25% khối lượng hỗn hợp. Cho 1,344 lít khí CO (đktc) đi qua m gam X nung nóng, sau một thời gian thu được chất rắn Y và hỗn hợp khí Z có tỉ khối so với H2 bằng 18. Hòa tan hoàn toàn Y trong dung dịch HNO3 loãng (dư), thu được dung dịch chứa 3,08m gam muối và 0,896 lít khí NO (ở đktc, là sản phẩm khử duy nhất). Giá trị m gần giá trị nào nhất sau đây? Trang 2/5 - Mã đề thi 061 A. 9,0. B. 9,5. C. 8,0. D. 8,5. Câu 28: Cho 8 gam Ca tan hoàn toàn trong 200ml dung dịch hỗn hợp HCl 2M và H2SO4 0,75M thu được khí H2 và dung dịch X. Cô cạn dung dịch X thu được m gam muối khan. Đáp án nào sau đây là đúng về giá trị của m? A. 22,2 < m < 27,2. B. 25,95 < m < 27,2. C. 22,2 ≤ m ≤ 27,2. D. 22,2 ≤ m ≤ 25,95. Câu 29: Cân bằng hóa học nào sau đây không bị chuyển dịch khi thay đổi áp suất của hệ phản ứng?  A. H2(k) + I2(k)  2HI(k).    B. 2NO2(k)  N2O4(k).    C. 3H2 + N2(k)  2NH3(k).    D. CaCO3(r)  CaO(r) + CO2(k).  Câu 30: Trộn 100 ml dung dịch A gồm KHCO3 1M và K2CO3 1M vào 100 ml dung dịch B gồm NaHCO3 1M và Na2CO3 1M thu được dung dịch C. Nhỏ từ từ 100ml dung dịch D gồm H2SO4 1M và HCl 1M vào dung dịch C thu được V lít khí CO 2 (đktc) và dung dịch E. Cho dung dịch Ba(OH)2 tới dư vào dung dịch E thu được m gam kết tủa. Giá trị của m và V là A. 82,4 và 5,6. B. 59,1 và 2,24. C. 82,4 và 2,24. D. 59,1 và 5,6. Câu 31: Thủy phân este X trong môi trường kiềm, thu được natri axetat và ancol etylic. Công thức của X là A. C2 H3COOC2 H5 B. CH3COOCH3 C. CH3COOC2 H5 D. C2 H5COOCH3 Câu 32: Axit malic là hợp chất hữu cơ tạp chức, có mạch cacbon không phân nhánh, là nguyên nhân chính gây nên vị chua của quả táo. Biết rằng 1 mol axit malic phản ứng được với tối đa 2 mol NaHCO3. Công thức của axit malic là A. HOOC-CH(CH3)-CH2-COOH. B. CH3OOC-CH(OH)-COOH. C. HOOC-CH(OH)-CH2-COOH. D. HOOC-CH(OH)-CH(OH)-CHO. Câu 33: Dãy các ion có thể tồn tại trong cùng một dung dịch là A. Fe2+, Ag+, NO3-, Cl-. B. Mg2+, Al3+, NO3-, CO32-. C. Na+, NH4+, SO42-, Cl-. D. Ag+, Mg2+, NO3-, Br- . Câu 34: Hợp chất X có công thức phân tử C4H6O3. X phản ứng được với Na, NaOH và có phản ứng tráng bạc. Công thức cấu tạo của X có thể là A. CH3COOCH2CH2OH B. HCOOCH=CHCH2OH C. HCOOCH2-O-CH2CH3 D. HO-CH2COOCH=CH2 Câu 35: Cho hỗn hợp gồm 0,01 mol HCHO và 0,1 mol HCOOH tác dụng với lượng dư AgNO3 trong NH3 đun nóng. Sau khi các phản ứng xảy ra hoàn toàn, khối lượng Ag tạo thành là A. 64,8 gam. B. 10,8 gam. C. 21,6 gam. D. 43,2 gam. Câu 36: Cho khí X đi qua hơi nước thấy có hiện tượng bốc cháy. Khí X có thể là A. Br2 B. F2 C. I2 D. Cl2 Câu 37: Hợp chất nào dưới đây được sử dụng làm xà phòng? A. CH3(CH2)12CH2Cl B. CH3(CH2)12COONa C. CH3(CH2)12COOCH3 D. CH3(CH2)5O(CH2)5CH3 Câu 38: Cho phản ứng: FeSO4 + KMnO4 + H2SO4  Fe2(SO4)3 + K2SO4 + MnSO4 + H2O.  Sau khi cân bằng (với hệ số là các số nguyên, tối giản), tổng hệ số của các chất tham gia phản ứng là A. 28. B. 22. C. 20. D. 24. Câu 39: Có bốn lọ mất nhãn, riêng biệt chứa: glixerol, ancol etylic, glucozơ và axit axetic. Thuốc thử nào sau đây có thể dùng để phân biệt các dung dịch trong từng lọ trên? A. Nước brom. B. [Ag(NH3)2]OH. C. Na kim loại. D. Cu(OH)2 trong môi trường kiềm. Câu 40: Cho hỗn hợp X gồm hai hợp chất hữu cơ no, đơn chức tác dụng vừa đủ với 100ml dung dịch KOH 0,4M, thu được một muối và 336ml hơi một ancol (đktc). Nếu đốt cháy hoàn toàn lượng hỗn hợp X trên, sau đó hấp thụ hết sản phẩm cháy vào bình đựng dung dịch Ca(OH)2 dư thì khối lượng bình tăng 6,82 gam. Công thức của hai hợp chất hữu cơ trong X là A. C2H5COOH và C2H5COOCH3. B. HCOOH và HCOOC3H7. C. HCOOH và HCOOC2H5. D. CH3COOH và CH3COOC2H5. Trang 3/5 - Mã đề thi 061 Câu 41: Thí nghiệm nào sau đây không xảy ra phản ứng hóa học? A. Sục ozon vào dung dịch KI. B. Sục khí H2S vào dung dịch FeCl2. C. Sục SO2 vào dung dịch nước brom. D. Nhỏ nước oxi già vào dung dịch hỗn hợp thuốc tím và axit sunfuric. Câu 42: Chọn đáp án đúng. A. Tinh thể I2 thuộc loại mạng tinh thể phân tử. B. Kim cương và nước đá khô có cùng kiểu mạng tinh thể. C. Hóa trị của N trong HNO3 là 5. D. Hợp chất chỉ gồm các nguyên tố phi kim thì chỉ chứa liên kết cộng hóa trị. Câu 43: Khi xà phòng hóa tripanmitin, thu được sản phẩm là A. C15H31COONa và glixerol. B. C17H29COONa và glixerol. C. C17H33COONa và glixerol. D. C17H35COONa và glixerol. Câu 44: Thí nghiệm nào sau đây có phản ứng oxi hóa – khử xảy ra? A. Cho dung dịch HCl vào CaCO3. B. Cho Fe2O3 tác dụng với dung dịch HNO3. C. Cho Na kim loại vào nước. D. Đổ dung dịch HCl vào dung dịch NaHCO3. Câu 45: Nguyên tố hóa học nào sau đây thuộc khối nguyên tố p? A. Fe (Z = 26). B. Na (Z = 11). C. Ca (Z = 20). D. Cl (Z = 17). Câu 46: Một thí nghiệm với khí amoniac được bố trí như hình sau: Qua hiện tượng thí nghiệm cho thấy: A. khí NH3 là khí nhẹ hơn nước và có tính bazơ. B. khí NH3 tan tốt trong nước và có tính bazơ. C. khí NH3 là khí nặng hơn nước và có tính bazơ. D. khí NH3 tan ít trong nước và có tính bazơ. Câu 47: Từ 12kg gạo nếp (có 84% tinh bột) lên men thu được V lít cồn 90 0. Biết khối lượng riêng của C2H5OH là 0,8g/ml, hiệu suất của toàn bộ quá trình là 58,93 %. Giá trị của V là A. 6,548. B. 5,468. C. 4,568. D. 4,685. Câu 48: Hỗn hợp X gồm N2 và H2 có tỉ khối so với He bằng 1,8. Đun nóng X một thời gian trong bình kín (có bột Fe làm xúc tác) thu được hỗn hợp Y có tỉ khối so với He bằng 2. Hiệu suất của phản ứng tổng hợp NH3 là A. 25%. B. 50%. C. 36%. D. 40%. Câu 49: Phát biểu nào sau đây không đúng ? A. Trong dd , glucozơ tồn tại ở dạng mạch vòng ưu tiên hơn dạng mạch hở. B. Glucozơ và fructozơ là đồng phân cấu tạo của nhau. C. Metyl - glucozit không thể chuyển sang dạng mạch hở. D. Có thể phân biệt glucozơ và fructozơ bằng phản ứng tráng bạc. Câu 50: Ứng với công thức phân tử C4H8O2 có số đồng phân este là A. 4 B. 3 C. 5 D. 2 ----------------------------------------------- ----------- HẾT ---------- Trang 4/5 - Mã đề thi 061 Đáp án 1 D 26 B 2 A 27 B 3 A 28 D 4 C 29 A 5 D 30 C 6 C 31 C 7 A 32 C 8 B 33 C 9 C 34 B 10 D 35 A 11 C 36 B 12 A 37 B 13 B 38 C 14 C 39 D 15 B 40 D 16 C 41 B 17 B 42 A 18 B 43 A 19 D 44 C 20 D 45 D 21 B 46 B 22 D 47 D 23 A 48 A 24 B 49 D 25 A 50 A Trang 5/5 - Mã đề thi 061

 

SỞ GD&ĐT BẮC NINH ĐỀ THI THỬ THPT QUỐC GIA LẦN 1 TRƯỜNG THPT HÀN THUYÊN NĂM HỌC 2015 - 2016 --------------------------- MÔN :HÓA HỌC LỚP: 12 (Đề thi có 04 trang) Thời gian làm bài: 90 phút, không kể thời gian phát đề Họ, tên thí sinh:.................................................Số báo danh:............................ Mã đề 132 Cho biết khối lượng nguyên tử (theo đvC) của các nguyên tố: H = 1; Li = 7; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; P = 31; S = 32; Cl = 35,5; K = 39; Ca = 40; Mn = 55; Fe = 56; Cu = 64; Zn = 65; Br = 80; Ag = 108; Ba = 137. (Học sinh không được sử dụng bảng tuần hoàn các nguyên tố hoá học) Câu 1: Chất có nhiệt độ sôi cao nhất là A. CH3COOH. B. CH3CHO. C. C2H5OH. D. C2H6. Câu 2: Chất nào sau đây trong phân tử chỉ có liên kết đơn. A. C2H3Cl. B. C2H4 C. CH4 D. C2H2 Câu 3: Cho các chất có công thức cấu tạo sau đây: (1) CH3CH2COOCH3; (2) CH3OOCCH3; (3) HCOOC2H5; (4) CH3COC2H5; Chất không thuộc loại este là A. (2). B. (1). C. (4). D. (3).   Câu 4: Cho cân bằng hóa học: N2 (k) + 3H2 (k)  2NH3 (k); phản ứng thuận là phản ứng tỏa  nhiệt. Cân bằng hóa học không bị dịch chuyển khi A. thay đổi nồng độ N2. B. thay đổi áp suất của hệ. C. thêm chất xúc tác Fe. D. thay đổi nhiệt độ. Câu 5: Bệnh nhân phải tiếp đường (tiêm hoặc truyền dung dịch đường vào tĩnh mạch), đó là loại đường nào? A. Glucozơ B. Mantozơ C. Saccarozơ D. Fructozơ Câu 6: Metyl amin là tên gọi của chất nào dưới đây? A. CH3Cl. B. CH3NH2. C. CH3OH. D. CH3CH2NH2. Câu 7: Trong hạt nhân nguyên tử, hạt mang điện là A. electron và nơtron. B. proton và electron. C. proton và nơtron. D. proton. Câu 8: Chất nào sau đây là thành phần chính trong phân bón supephotphat kép ? A. Ca(H2PO4)2 B. Ca3(PO4)2. C. Ca(H2PO4)2 và CaSO4 D. CaHPO4 Câu 9: Phân tử hợp chất nào dưới đây là phân tử không phân cực? A. HCl B. CO2. C. NH3. D. H2O. Câu 10: Nước Gia-ven được điều chế bằng cách. A. Cho Clo tác dụng với dung dịch Ca(OH)2. B. Cho Clo tác dụng với nước. C. Cho Clo vào dung dịch KOH loãng rồi đun nóng 1000C. D. Cho Clo sục vào dung dịch NaOH loãng. Câu 11: Trong phân tử H2SO4 số oxihóa của lưu huỳnh (S) là A. -2. B. +6. C. +4. D. 0. Câu 12: Chất nào sau đây thuộc loại đisaccarit? A. Glucozơ B. Saccarozơ C. Tinh bột D. Fructozơ Câu 13: Số tripeptit chứa các amino axit khác nhau được tạo nên từ hỗn hợp gồm alanin, glyxin và valin là A. 27. B. 8. C. 6. D. 18. Câu 14: Những chai, lọ bằng thủy tinh không được đựng dung dịch axit nào sau đây? A. HI B. HF C. HCl D. HBr Trang 1/4 - Mã đề thi 132 Câu 15: Hợp chất nào dưới đây không thể là hợp chất phenol? A. C6H5OH. B. C6H5CH2OH. C. C6H4(CH3)OH. D. HO-C6H4-OH. Câu 16: Cân bằng nào sau đây chuyển dịch theo chiều thuận khi tăng áp suất? A. H2(khí) + I2(rắn) 2HI (khí) B. CaCO3 CaO + CO2(khí) C. S(rắn) + H2(khí) H2S(khí) D. N2(khí) + 3H2(khí) 2NH3(khí) Câu 17: Chất nào sau đây không có tính lưỡng tính? A. H2N-CH2-COOH B. CH3COONH4 C. NaHCO3 D. H2N-CH2-NH2 Câu 18: Cho các dung dịch của các hợp chất sau: NH2-CH2-COOH (1) ; NH2-[CH2]2CH(NH2)- COOH (2) ; HOOC-C3H5(NH2)-COOH (3); NH2-CH(CH3)-COOH (4); NH2-CH2-COONa (5) Dung dịch làm quỳ tím hoá đỏ là A. (3). B. (3), (4). C. (1), (5). D. (2). Câu 19: Cho phản ứng: Mg + H2SO4 → MgSO4 + H2S + H2O. Khi hệ số cân bằng phản ứng là nguyên và tối giản thì số phân tử H2O tạo thành là A. 3. B. 10. C. 5. D. 4. Câu 20: Hồi đầu thế kỷ 19 người ta sản xuất natri sunfat bằng cách cho axit sunfuric đặc tác dụng với muối ăn. Khi đó, xung quanh các nhà máy sản xuất bằng cách này, dụng cụ của thợ thủ công rất nhanh hỏng và cây cối bị chết rất nhiều. Người ta đã cố gắng cho khí thải thoát ra bằng những ống khói cao tới 300m nhưng tác hại của khí thải vẫn tiếp diễn, đặc biệt là khí hậu ẩm. Hãy cho biết khí thải đó có chứa thành phần chủ yếu là chất nào trong các chất sau? A. HCl B. SO2 C. H2SO4 D. Cl2 Câu 21: Có bao nhiêu đồng phân cấu tạo C5H10O có khả năng tham gia phản ứng tráng gương? A. 4. B. 3. C. 2. D. 5. Câu 22: Buta -1,3- đien tác dụng với Br2 theo tỉ lệ mol 1 : 1 thu được bao nhiêu sản phẩm hữu cơ? A. 1. B. 2. C. 3. D. 4. Câu 23: Cho dung dịch Ba(HCO3)2 lần lượt vào các dung dịch: NaOH, Na2CO3, KHSO4, H2SO4, HCl. Số trường hợp tạo ra kết tủa là A. 5. B. 4. C. 2. D. 3. Câu 24: Hòa tan m gam Fe bằng dung dịch HCl vừa đủ thu được dung dịch Y. Cô cạn dung dịch Y thu được 25,4 gam muối khan. Vậy giá trị của m là A. 16,8 gam. B. 11,2 gam. C. 6,5 gam. D. 5,6 gam. Câu 25: Hình vẽ dưới đây mô tả thí nghiệm chứng minh: A. Khả năng bay hơi của P đỏ dễ hơn P trắng. B. Khả năng bốc cháy của P đỏ dễ hơn P trắng. C. Khả năng bay hơi của P trắng dễ hơn P đỏ. D. Khả năng bốc cháy của P trắng dễ hơn P đỏ. Câu 26: Giữa Saccarozơ và glucozơ có đặc điểm giống nhau là: A. Ðều hòa tan Cu(OH)2 ở nhiệt độ thường cho dung dịch màu xanh lam. B. Ðều được lấy từ củ cải đường. C. Ðều có trong biệt dược “huyết thanh ngọt” D. Ðều bị oxi hóa bởi dung dịch AgNO3/NH3. Câu 27: Để phân biệt C2H5OH, C6H5OH và dung dịch CH3CH=O chỉ cần dùng một thuốc thử là A. Cu(OH)2. B. Dung dịch AgNO3/NH3. C. Dung dịch NaOH. D. Dung dịch Brôm. Câu 28: Khi nhỏ dung dịch HNO3 đặc vào lòng trắng trứng có hiện tượng: A. Có màu xanh lam. B. Có màu tím đặc trưng. Trang 2/4 - Mã đề thi 132 C. Dung dịch màu vàng D. Kết tủa màu vàng. Câu 29: Đốt cháy hoàn toàn một lượng este no, đơn chức mạch hở thì thể tích khí CO 2 sinh ra luôn bằng thể tích khí O2 cần cho phản ứng ở cùng điều kiện nhiệt độ và áp suất. Tên gọi của este đem đốt là A. metyl fomat B. metyl axetat C. etyl axetat D. propyl fomat Câu 30: Oxihóa 3,2 gam ancol metylic bằng CuO nung nóng với hiệu suất phản ứng đạt 75%. Cho toàn bộ anđêhit thu được vào dung dịch AgNO3/ NH3 dư, thì thấy xuất hiện m gam kết tủa. Giá trị của m là A. 43,2 gam B. 21,6 gam C. 10,8 gam D. 32,4 gam Câu 31: Hỗn hợp X gồm N2 và H2 có tỉ khối so với H2 bằng 3,6. Sau khi tiến hành phản ứng tổng hợp amoniac trong bình kín (có xúc tác bột Fe) thu được hỗn hợp khí Y có tỉ khối so với H2 bằng 4. Hiệu suất phản ứng tổng hợp amoniac là A. 25,00%. B. 18,75%. C. 20,00%. D. 10,00%. Câu 32: X là một anđehit mạch hở có số nguyên tử cacbon trong phân tử nhỏ hơn 4. Cho 1 mol X tác dụng với lượng dư dung dịch AgNO3 trong NH3 thu được 2 mol Ag. Mặt khác, 1 mol X phản ứng tối đa với 2 mol H2 (Ni, toC). Phân tử khối của X là A. 56. B. 44. C. 72. D. 54. Câu 33: Có 50 ml dung dịch chứa hỗn hợp KOH 0,05M và Ba(OH)2 0,025M người ta thêm V ml dung dịch HCl 0,16M vào 50 ml dung dịch trên thu được dung dịch mới có pH = 2. Vậy giá trị của V là A. 40,45 ml. B. 45,67 ml. C. 30,33 ml. D. 36,67 ml. 0 Câu 34: Thủy phân hoàn toàn 14,6 gam Gly-Ala bằng dung dịch NaOH, t sau khi kết thúc phản ứng thu được m gam hỗn hợp muối. Giá trị của m là? A. 22,6 gam. B. 37,6 gam. C. 20,8 gam. D. 16,8 gam. Câu 35: Cho 0,01 mol amino axit X tác dụng với HCl thì dùng hết 80 ml dung dịch HCl 0,125M và thu được 1,835 gam muối khan. Còn khi cho 0,01 mol X tác dụng với dung dịch NaOH thì cần dùng 25 gam dung dịch NaOH 3,2%. Công thức của X là A. (NH2)2C3H5COOH. B. H2N-C2H4-COOH. C. H2N-C3H6-COOH. D. H2NC3H5(COOH)2. Câu 36: Cho 6 gam một axit cacboxylic đơn chức vào dung dịch KHCO3 dư, đến phản ứng hoàn toàn, thu được 2,24 lít khí CO2 ở đktc. Phần trăm khối lượng của cacbon trong axit trên có giá trị là A. 50%. B. 60% C. 40% D. 25% Câu 37: Trộn 2 dung dịch: Ba(HCO3)2 ; NaHSO4 có cùng nồng độ mol/l với nhau theo tỷ lệ thể tích 1: 1 thu được kết tủa X và dung dịch Y. Hãy cho biết các ion có mặt trong dung dịch Y. ( Bỏ qua sự thủy phân của các ion và sự điện ly của nước). A. Na+, HCO3- và SO42-. B. Na+, HCO3- . C. Ba2+, HCO3- và Na+. D. Na+ và SO42-. Câu 38: X là nguyên tố thuộc chu kì 3 trong bảng tuần hoàn và X tạo hợp chất khí với hidro có công thức là H2X. Phát biểu nào dưới đây không đúng. A. Khí H2X có mùi đặc trưng. B. Ở trạng thái cơ bản, nguyên tử X có 10 electron ở phân lớp p. C. X là nguyên tố lưu huỳnh (S). D. X có thể là nguyên tố kim loại. Câu 39: Cho hỗn hợp A gồm 10,8 gam ancol benzylic và 21,6 gam p-crezol tác dụng với dung dịch Br2 dư. Khối lượng kết tủa thu được sau phản ứng là: A. 88,7 gam B. 53,2 gam C. 34,5 gam D. 103,5 gam Câu 40: Cho các phát biểu sau: (1) Phản ứng nhiệt phân hoàn toàn các muối Nitrat sản phẩm thu được luôn có chất rắn. (2) Có thể tồn tại dung dịch có các chất: Fe(NO3)2, H2SO4, NaCl. (3) Sục khí CO2 dư vào dung dịch NaAlO2 thấy kết tủa xuất hiện. (4) Có thể dùng axit H2SO4 đặc để làm khô khí amoniac. (5) Có thể thu khí Cl2 bằng phương pháp đẩy nước. Số phát biểu sai là A. 3 B. 5 C. 4 D. 2 Trang 3/4 - Mã đề thi 132 Câu 41: Hoà tan hoàn toàn m gam bột nhôm trong dung dịch chứa HCl và HNO3 thu được 3,36 lít hỗn hợp Y gồm hai khí không màu, dung dịch còn lại chỉ chứa muối của cation Al3+. Đem toàn bộ lượng hỗn hợp khí Y trộn với 1 lít oxi thu được 3,688 lít hỗn hợp gồm 3 khí. Biết thể tích các khí đều đo ở đktc và khối lượng của hỗn hợp khí Y nhỏ hơn 2 gam. Tìm m. A. 9,72 gam. B. 3,24 gam. C. 8,10 gam. D. 4,05 gam. Câu 42: Hòa tan hết 10,24 gam Cu bằng 200 ml dung dịch HNO3 3M được dung dịch X. Thêm 400 ml dung dịch NaOH 1M vào dung dịch X. Lọc bỏ kết tủa, cô cạn dung dịch rồi nung chất rắn đến khối lượng không đổi thu được 26,44 gam chất rắn. Số mol HNO3 đã phản ứng với Cu là: A. 0,56 mol B. 0,4 mol C. 0,58 mol D. 0,48 mol Câu 43: Cho Zn tới dư vào dung dịch gồm HCl; 0,05 mol NaNO3; 0,1 mol KNO3. Sau khi kết thúc phản ứng thu được dung dịch X chứa m gam muối; 0,125 mol hỗn hợp khí Y gồm hai khí không màu, trong đó có một khí hóa nâu ngoài không khí. Tỉ khối hơi của Y so với H2 là 12,2. Giá trị của m là: A. 64,05 B. 49,775 C. 57,975 D. 61,375 Câu 44: Cho hỗn hợp gồm 0,14 mol Mg và 0,01 mol MgO phản ứng vừa đủ với dung dịch HNO 3 thu được 0,448 lít (đktc) khí nitơ và dung dịch X. Khối lượng muối trong X là: A. 24,5 gam. B. 22,2 gam. C. 23 gam. D. 20,8 gam. Câu 45: Đốt cháy hoàn toàn 9,44 gam hỗn hợp E gồm một axit cacboxylic X không no đơn chức có 1 liên kết đôi (C=C) và một ancol đơn chức Y đã thu được 8,96 lít CO2 (đktc) và 7,2 gam H2O. Mặt khác, tiến hành este hóa 9,44 gam hỗn hợp E trong điều kiện thích hợp với hiệu suất bằng 60% thì thu được m gam este F. Giá trị của m là A. 6,0 gam. B. 13,33 gam. C. 4,8 gam. D. 8,0 gam. Câu 46: Hỗn hợp X gồm 3 este đơn chức, tạo thành từ cùng một ancol Y với 3 axit cacboxylic (phân tử chỉ có nhóm -COOH); trong đó, có hai axit no là đồng đẳng kế tiếp nhau và một axit không no (có đồng phân hình học, chứa một liên kết đôi C=C trong phân tử). Thủy phân hoàn toàn 5,88 gam X bằng dung dịch NaOH, thu được hỗn hợp muối và m gam ancol Y. Cho m gam Y vào bình đựng Na dư, sau phản ứng thu được 896 ml khí (đktc) và khối lượng bình tăng 2,48 gam. Mặt khác, nếu đốt cháy hoàn toàn 5,88 gam X thì thu được CO2 và 3,96 gam H2O. Phần trăm khối lượng của este không no trong X là A. 29,25% B. 40,82% C. 34,01% D. 38,76% Câu 47: Thủy phân hoàn toàn m gam hỗn hợp M gồm tetrapeptit X và pentapeptit Y (đều mạch hở) bằng dung dịch KOH vừa đủ, rồi cô cạn cẩn thận thì thu được (m + 11,42) gam hỗn hợp muối khan của Val và Ala. Đốt cháy hoàn toàn muối sinh ra bằng một lượng oxi vừa đủ thu được K2CO3; 2,464 lít N2 (đktc) và 50,96 gam hỗn hợp gồm CO2 và H2O. Phần trăm khối lượng của Y trong hỗn hợp M có thể là A. 64,59%. B. 45,98%. C. 54,54%. D. 55,24%. Câu 48: Hỗn hợp X gồm hai chất hữu cơ đơn chức mạch hở là đồng phân của nhau. Cho 0,3 mol hỗn hợp X vào 300 ml dung dịch NaOH 1M và KOH 2M. Cô cạn dung dịch sau phản ứng thu được chất rắn Y có khối lượng m gam và phần hơi chứa ancol Z. Oxi hóa hết lượng Z bằng CuO dư, đun nóng rồi cho sản phẩm tác dụng với lượng dư AgNO3 trong NH3, thu được 77,76 gam Ag. Thêm CaO vào Y rồi nung ở nhiệt độ cao, đến phản ứng hoàn toàn thu được hỗn hợp M gồm hai hiđrocacbon kế tiếp nhau trong dãy đồng đẳng. Tỷ khối của hỗn hợp M đối với H2 là 10,8. Giá trị của m là A. 59,88. B. 61,24. C. 57,28. D. 56,46. Câu 49: Cho 0,15 mol H2NC3H5(COOH)2 (axit glutamic) vào 175 ml dung dịch HCl 2M, thu được dung dịch X. Cho 350 ml dung dịch NaOH 2M vào dung dịch X. Sau khi các phản ứng xảy ra hoàn toàn, cô cạn dung dịch thu được m gam chất rắn khan. Giá trị gần nhất của m là A. 62 gam. B. 57 gam. C. 51 gam. D. 49 gam. Câu 50: Hỗn hợp X gồm 2 chất có công thức phân tử là C2H10N2O3 và C5H15N3O4. Cho X phản ứng vừa đủ với dung dịch NaOH (đun nóng), thu được dung dịch Y chứa m gam các muối của Natri và 8,96 lít (ở đktc) hỗn hợp Z gồm 2 chất khí (đều làm xanh giấy quỳ tím ẩm). Biết tỉ khối của Z so với hidro là 10,25. Giá trị của m là A. 29,7 gam. B. 19,1 gam. C. 26,9 gam. D. 22,2 gam. ----------- HẾT ---------- Thí sinh không được sử dụng tài liệu. Cán bộ coi thi không giải thích gì thêm. Trang 4/4 - Mã đề thi 132 SỞ GD&ĐT BẮC NINH ĐÁP ÁN ĐỀ THI THỬ THPT QUỐC GIA LẦN 1 TRƯỜNG THPT HÀN THUYÊN Năm học 2015-2016 Môn: Hóa học, lớp 12 Mã đề Mã đề Câu Câu 132 209 357 485 570 628 743 896 132 209 357 485 570 628 743 896 1 A A A B C A C D 26 A C D C D B D B 2 C C A D D A A A 27 D D C C A B B A 3 C D D B D A D C 28 D A B A B A A A 4 C D A B A B A B 29 A B D D C A C C 5 A B B C B B B A 30 D D C C D B A A 6 B C B A A B D C 31 A A A B A D A B 7 D B A A C C C C 32 A A B C C D B C 8 A A C A C C B B 33 D C C C D D C D 9 B A A C D D C D 34 C C C B A B A C 10 D B C C A C D C 35 D C D A B D C D 11 B D B D B D B D 36 C B A B D B D B 12 B B D B A A D B 37 B B B D D C D D 13 C B B C B D B A 38 D B C D B D A D 14 B B B C C A A B 39 B D D C C C D D 15 B B D C D B A A 40 C C A C B A C A 16 D D B D D D D A 41 B C C A A C A A 17 D A B B D A B B 42 A D D D D A B C 18 A D D D C C D B 43 A D A A B B C D 19 D C D B D C A C 44 C D C D B B C B 20 A D D D C D B D 45 C C B B B C A C 21 A D C A B B A D 46 C B A B C C C C 22 C A A D A D A B 47 B C B A D B C D 23 B D B A A A C D 48 A C C B C C D A 24 B A D A A C D C 49 C A B C B A B B 25 D A C D C D B A 50 A A A A A C B D

 

SỞ GD VÀ ĐT VĨNH PHÚC ĐỀ KSCL ÔN THI THPT QUỐC GIA LẦN I TRƯỜNG THPT ĐỒNG ĐẬU Môn: HÓA HỌC (Đề thi có 4 trang) Thời gian làm bài: 90 phút, không kể thời gian phát đề Mã đề thi 134 Họ, tên thí sinh:.......................................................................... Số báo danh:............................................................................... Cho nguyên tử khối của các nguyên tố: H = 1; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; P = 31; S = 32; Cl = 35,5; K = 39; Ca = 40; Fe = 56; Cu = 64; Br = 80; Ag = 108; Cd=112; Ba = 137. Câu 1: Este X có công thức cấu tạo thu gọn là CH 3COOCH3. Tên gọi của X là A. metyl fomiat. B. etyl fomiat. C. metyl axetat. D. etyl axetat. Câu 2: Nguyên tử nguyên tố X có tổng số electron trong các phân lớp p là 8. Vị trí của X trong bảng hệ thống tuần hoàn là A. X có số thứ tự 13, chu kì 3, nhóm IIIA. B. X có số thứ tự 14, chu kì 3, nhóm IVA. C. X có số thứ tự 12, chu kì 3, nhóm IIA. D. X có số thứ tự 15, chu kì 3, nhóm VA. Câu 3: Đun 3,0 gam CH3COOH với 4,6 gam C2H5OH dư (xúc tác H2SO4 đặc), thu được m gam CH3COOC2H5. Biết hiệu suất của phản ứng este hoá đạt 50 %. Giá trị của m là A. 1,1. B. 2,2. C. 4,4. D. 8.8. Câu 4: Đốt cháy hoàn toàn 0,1 mol hỗn hợp X gồm 2 axit cacboxylic đồng đẳng kế tiếp thu được 6,16 gam CO2 và 2,52 gam H2O. Công thức của 2 axit là: A. CH3COOH và C2H5COOH. B. C2H3COOH và C3H5COOH. C. HCOOH và CH3COOH. D. C2H5COOH và C3H7COOH. Câu 5: Khẳng định nào sau đây không đúng? A. Khí NH3 dễ hoá lỏng, dễ hoá rắn, tan nhiều trong nước. B. Trong điều kiện thường, NH3 là khí không màu, mùi khai và xốc. C. Liên kết giữa N và 3 nguyên tử H là liên kết cộng hoá trị có cực. D. Khí NH3 nặng hơn không khí . Câu 6: Phát biểu nào sau đây không đúng ? A. Có thể phân biệt glucozơ và fructozơ bằng phản ứng tráng bạc. B. Glucozơ và fructozơ là đồng phân cấu tạo của nhau. C. Khi thủy phân hoàn toàn tinh bột thì không thu được fructozơ. D. Phân tử xenlulozơ được cấu tạo từ các gốc glucozơ. Câu 7: Khử hoàn toàn m gam Fe2O3 cần vừa đủ 3,36 lít khí CO (ở đktc). Khối lượng sắt thu được sau phản ứng là A. 8,4. B. 5,6. C. 2,8. D. 16,8. Câu 8: Lưu huỳnh trong chất nào sau đây vừa có tính oxi hóa, vừa có tính khử? A. H2SO4. B. SO2. C. H2S. D. Na2SO4. Câu 9: Cho 0,2 mol một anđehit đơn chức, mạch hở X phản ứng vừa đủ với 300 ml dung dịch chứa AgNO3 2M trong NH3. Sau khi phản ứng xảy ra hoàn toàn thu được 87,2 g kết tủa. Công thức phân tử của anđehit là: A. C3H3CHO B. C4H5CHO C. C3H5CHO. D. C4H3CHO Câu 10: Dung dịch X chứa 0,6 mol NaHCO3 và 0,3 mol Na2CO3. Thêm rất từ từ dung dịch chứa 0,8 mol HCl vào dung dịch X được dung dịch Y và V lít khí CO 2 đktc. Thêm vào dung dịch Y nước vôi trong dư thấy tạo thành m gam kết tủa. Tính thể tích V và khối lượng m.. A. 11,2 lít CO2 ; 40 gam CaCO3 . B. 11,2 lít CO2 ; 90 gam CaCO3 C. 16,8 lít CO2 ; 60 gam CaCO3 D. 11,2 lít CO2 ; 60 gam CaCO3. Câu 11: Đốt cháy hoàn toàn 0,88 gam 2 este đồng phân thu được 1,76 gam CO 2 và 0,72 gam H2O. Công thức phân tử của 2 este là: A. C5H10O2. B. C4H6O2. C. C3H6O2. D. C4H8O2. Trang 1/6 - Mã đề thi 134 Câu 12: Một loại phân kali có chứa 87% K2SO4 còn lại là các tạp chất không chứa kali, độ dinh dưỡng của loại phân bón này là: A. 44,8%. B. 54,0%. C. 39,0%. D. 47,0%. Câu 13: Trong phòng thí nghiệm, người ta thường điều chế Clo bằng cách A. Cho dung dịch HCl đặc tác dụng với MnO2, đun nóng. B. Cho F2 đẩy Cl2 ra khỏi dung dịch NaCl. C. Điện phân nóng chảy NaCl. D. Điện phân dung dịch NaCl có màng ngăn Câu 14: Hỗn hợp X gồm metyl metacrylat, axit axetic, axit benzoic. Đốt cháy hoàn toàn a gam X sinh ra 0,38 mol CO2 và 0,29 mol H2O. Khi lấy a gam X phản ứng vừa đủ với dung dịch NaOH thu được 0,01 mol ancol và m gam muối. Giá trị của m là: A. 12,02. B. 25,00. C. 12,16. D. 11,75 Câu 15: Hình vẽ bên mô tả thí nghiệm nào A. Chứng minh khả năng tan tốt trong nước của khí NH3. B. Chứng minh khả năng tan tốt trong nước của khí CO2. C. Chứng minh khả năng tan tốt trong nước của khí HCl. D. Chứng minh khả năng tan tốt trong nước của phenolphtalein Câu 16: Số lượng đồng phân ứng với công thức phân tử C3H5Br3 là: A. 3. B. 4. C. 5. D. 6. Câu 17: Đốt cháy hoàn toàn 6,2 gam photpho bằng oxi dư rồi cho sản phẩm tạo thành tác dụng vừa đủ với m gam dung dịch NaOH 32% thu được muối Na2HPO4. Giá trị của m là: A. 75. B. 50. C. 100. D. 25. Câu 18: Cho công thức cấu tạo sau: CH3-CH(OH)-CH=C(Cl)-CHO. Số oxi hóa của các nguyên tử cacbon tính từ phải sang trái có giá trị lần lượt là A. +1; -1; 0; -1; +3. B. +1; +1; -1; 0; -3. C. +1; -1; -1; 0; -3. D. +1; +1; 0; -1; +3. Câu 19: Hòa tan hoàn toàn 1,6 gam Cu bằng dung dịch HNO3, thu được x mol NO2 (là sản phẩm khử duy nhất của N+5). Giá trị của x là A. 0,05. B. 0,15. C. 0,25. D. 0,10. Câu 20: Hỗn hợp X chứa Na2O, NH4Cl, NaHCO3 và BaCl2 có số mol mỗi chất đều bằng nhau. Cho hỗn hợp X vào nước (dư), đun nóng, dung dịch thu được chứa: A. NaCl, NaOH, BaCl2. B. NaCl, NaOH. C. NaCl, NaHCO3, NH4Cl, BaCl2. D. NaCl. Câu 21: Đun nóng 18 gam glucozơ với dung dịch AgNO3/NH3 dư thì thu được m gam Ag. Giá trị của m là A. 7,20. B. 2,16. C. 10,8. D. 21,6. Câu 22: Có 4 axit: HCl; HBr; HF; HI. Tính khử tăng dần theo thứ tự: A. HBr; HF; HI;HCl B. HCl; HI; HBr; HF C. HI; HBr; HCl; HF D. HF; HCl; HBr; HI Câu 23: Loại đường nào sau đây có nhiều trong cây mía: A. fructozơ. B. glucozơ. C. mantozơ. D. saccarozơ. 2- 6 Câu 24: Cấu hình electron phân lớp ngoài cùng của X là 3p . Vậy X thuộc: A. Chu kì 2, nhóm VIA. B. Chu kì 3, nhóm VIIIA. C. Chu kì 3, nhóm VIA. D. Chu kì 2, nhóm VIIIA. Câu 25: Số đồng phân là hợp chất thơm có công thức phân tử C8H10O tác dụng được với NaOH là: A. 7. B. 8. C. 6. D. 9. Câu 26: Đốt cháy hoàn toàn m gam Fe trong khí Cl2 dư, thu được 6,5 gam FeCl3. Giá trị của m là A. 2,80. B. 2,24. C. 1,12. D. 0,56. Câu 27: Hợp chất CH3-C(CH3)=CH-C(CH3)2-CH=CH-Br có danh pháp IUPAC là A. 3,3,5-trimetyl hexa-1,4-đien-1-brom. B. 1-brom-3,3,5-trimetyl hexa-1,4-đien. C. 1-brom-3,5-trimetyl hexa-1,4-đien. D. 3,3,5-trimetyl hexa-1,4-đien-1-brom. Trang 2/6 - Mã đề thi 134 Câu 28: Khi đun nóng hỗn hợp gồm glixerol và 2 axit béo RCOOH và R’COOH có thể thu được tối đa bao nhiêu loại chất béo (tri glixerit)? A. 6 B. 4 C. 5 D. 3 Câu 29: Dung dịch nào sau đây làm phenolphtalein chuyển sang màu hồng A. NH4NO3. B. NaOH. C. NaCl. D. HCl. Câu 30: Cân bằng nào sau đây chuyển dịch theo chiều thuận khi tăng áp suất? A. CaCO3(rắn) CaO(rắn) + CO2(khí) B. H2(khí) + I2(khí) 2HI (khí) C. N2(khí) + 3H2(khí) 2NH3(khí) D. S(rắn) + H2(khí) H2S(khí) Câu 31: Hấp thụ hoàn toàn 4,48 lit khí SO2 (ở đktc) vào 500ml dung dịch hỗn hợp gồm NaOH 0,1M và Ba(OH)2 0,2 M, sinh ra m gam kết tủa. Giá trị của m là: A. 11,6 B. 17,7 C. 21,7 D. 10,85 Câu 32: Methadone là một loại thuốc dùng trong cai nghiện ma túy, nó thực chất cũng là một loại chất gây nghiện nhưng “nhẹ” hơn các loại ma túy thông thường và dễ kiểm soát hơn. Công thức cấu tạo của nó như hình bên. Hãy cho biết CTPT của nó? A. C17H22NO. B. C21H29NO. C. C21H27NO. D. C17H27NO. Câu 33: Thuỷ phân 62,5 gam dung dịch saccarozơ 17,1% trong môi trường axit (vừa đủ) được dung dịch X. Cho dung dịch AgNO3/NH3 vào X và đun nhẹ được m gam Ag, biết các phản ứng xảy ra hoàn toàn giá trị của m là: A. 13,5. B. 7,5. C. 6,75. D. 10,8. Câu 34: Hỗn hợp X gồm M2CO3, MHCO3 và MCl (M là kim loại kiềm). Cho 32,65 gam X tác dụng vừa đủ với dung dịch HCl thu được dung dịch Y và có 17,6 gam CO2 thoát ra. Dung dịch Y tác dụng với dung dịch AgNO3 dư được 100,45 gam kết tủa. Kim loại M là: A. Li. B. Na. C. K. D. Rb. Câu 35: Cho các phản ứng sau: (1) Fe(OH)2 + H2SO4 đặc   to (2) Fe + H2SO4 loãng   (3) Fe(OH)3 + H2SO4 đặc   o (4) Fe3O4 + H2SO4 loãng   t (5) Cu + H2SO4 loãng + dung dịch NaNO3   (6) FeCO3 + H2SO4 đặc   o t Số phản ứng hóa học trong đó H2SO4 đóng vai trò là chất oxi hóa là A. 2. B. 4 C. 3. D. 5. Câu 36: Hỗn hợp X gồm 2 este đơn chức A và B hơn kém nhau một nhóm -CH2- Cho 6,6g hỗn hợp X tác dụng vừa đủ với 100ml dung dịch NaOH 1M thu được 7,4g hỗn hợp 2 muối. Công thức cấu tạo chính xác của A và B là A. CH3-COOC2H5 và H-COOC2H5 B. CH3-COO-CH=CH2 và H-COO-CH=CH2 C. CH3-COOC2H5 và CH3-COOCH3 D. H-COOCH3 và CH3-COOCH3 Câu 37: Đốt cháy hoàn toàn một hợp chất hữu cơ X (C, H, N) bằng lượng không khí vừa đủ (gồm 1/5 thể tích O2, còn lại là N2) được khí CO2 , H2O và N2. Cho toàn bộ sản phẩm cháy qua bình đựng dung dịch Ba(OH)2 dư thấy có 39,4 gam kết tủa, khối lượng dung dịch giảm đi 24,3 gam. Khí thoát ra khỏi bình có thể tích 34,72 lít (đktc). Biết d X O 2 < 2. CTPT của X là A. C2H7N. B. C3H9N. C. C3H6N2. D. C2H4N2. Câu 38: Hoà tan hoàn toàn 11,2g kim loại Fe trong 300ml dung dịch HNO 3 2M, sau khi các phản ứng xảy ra hoàn toàn thấy có khí NO (duy nhất) thoát ra. Cô cạn dung dịch sau phản ứng ta thu được chất rắn khan có khối lượng là A. 36,3gam. B. 48,4gam. C. 39,1gam D. 36gam Câu 39: Trong các chất có đồng phân cấu tạo CH3-CH=CH2, CH3-CH=CHCl, CH3-CH=C(CH3)2, C6H5CH=CH-CH3. Số chất có đồng phân hình học là: A. 1. B. 4. C. 2. D. 3. Trang 3/6 - Mã đề thi 134 Câu 40: Lên men m gam glucozơ với hiệu suất 80% thu được 44,8 lít khí CO2 (ở đktc) và V lít ancol etylic 23o (biết khối lượng riêng của C2H5OH là 0,8 gam/ml). Giá trị m và V lần lượt là: A. 225 và 0,5. B. 225 và 0,32. C. 450 và 0,5. D. 144 và 0,32. Câu 41: Chất nào sau đây là một phi kim A. S. B. Ne. C. Al. D. Fe. Câu 42: Dẫn 0,5 mol hỗn hợp khí gồm H2 và CO có tỉ khối so với H2 là 4,5 qua ống đựng 0,4 mol Fe2O3 và 0,2 mol CuO đốt nóng. Sau phản ứng hoàn toàn cho chất rắn trong ống vào dung dịch HNO 3 loãng, dư thu được V lít khí NO (sản phẩm khử duy nhất, ở đktc). Giá trị của V là: A. 20,907. B. 3,730 C. 34,720. D. 7,467. Câu 43: Oxi hóa 9,2 gam ancol etylic bằng CuO đun nóng, thu được 13,2 gam hỗn hợp gồm anđehit, axit, ancol chưa phản ứng và nước Hỗn hơp này tác dụng với Na dư sinh ra 3,36 lít H2 ở đktc Phần trăm khối lượng ancol đã chuyển hóa thành axít là: A. 90%. B. 75%. C. 50%. D. 25%. Câu 44: Khi xà phòng hóa triolein bằng dung dịch NaOH ta thu được sản phẩm là A. C17H33COONa và glixerol. B. C15H31COONa và glixerol. C. C17H33COONa và etanol. D. C17H33COOH và glixerol. Câu 45: Giữa saccarozơ và glucozơ có đặc điểm giống nhau là A. đều được chiết xuất từ củ cải đường. B. đều có phản ứng thủy phân trong môi trường axit. C. đều bị oxi hóa bởi AgNO3 trong NH3 D. đều hòa tan được Cu(OH)2 ở nhiệt độ thường cho dung dịch màu xanh lam Câu 46: Khi nhiệt độ tăng thêm 100C tốc độ phản ứng tăng lên 3 lần. Để tốc độ phản ứng đó (đang tiến hành ở 300C ) tăng lên 81 lần, cần phải thức hiện ở nhiệt độ nào sau đây? A. 300C B. 700C C. 100C D. 2700C Câu 47: Hỗn hợp M gồm vinyl axetilen và hiđrocacbon X mạch hở. Khi đốt cháy hoàn toàn một lượng M thu được số mol nước gấp đôi số mol của M. Mặt khác dẫn 8,96 lít M (ở đktc) lội từ từ qua nước brom dư, đến phản ứng hoàn toàn thấy có 2,24 lít khí thoát ra (ở đktc). Phần trăm khối lượng của X trong M là: A. 27,1%. B. 9,3%. C. 40,0%. D. 25,0%. Câu 48: Hỗn hợp X gồm C2H2 và H2 có cùng số mol. Lấy một lượng hỗn hợp X cho qua chất xúc tác nung nóng, thu được hỗn hợp Y gồm C2H4, C2H6, C2H2 và H2. Sục Y vào dung dịch brom (dư) thì khối lượng bình brom tăng 10,8 gam và thoát ra 4,48 lít hỗn hợp khí (đktc) có tỉ khối so với H 2 là 8. Thể tích O2 (đktc) cần để đốt cháy hoàn toàn hỗn hợp Y là A. 22,4 lít. B. 44,8 lít. C. 33,6 lít. D. 26,88 lít. Câu 49: Trong các chất sau đây, chất nào có nhiệt độ sôi cao nhất? A. CH3CH3. B. CH3COOH. C. CH3CH2OH. D. CH3CHO. Câu 50: Số lượng đồng phân este ứng với công thức phân tử C4H8O2 là: A. 2. B. 3. C. 4. D. 5. ----------------------------------------------- ----------- HẾT ---------- Trang 4/6 - Mã đề thi 134 SỞ GD VÀ ĐT VĨNH PHÚC ĐÁP ÁN KSCL ÔN THI THPT QG LẦN I TRƯỜNG THPT ĐỒNG ĐẬU Môn: HÓA HỌC Mã đề Câu 134 209 357 485 570 641 1 C A A A D B 2 B D D B B D 3 B C B C D D 4 C D D B B C 5 D A D A B A 6 A D D D B C 7 B C B C B C 8 B D A C B C 9 D A B B C A 10 A C D A C B 11 D B A C D B 12 D B C B D D 13 A B B A C D 14 D A A C D C 15 A A A D C C 16 C D B D D A 17 B D C B A B 18 B A B A D A 19 A D A A C C 20 D C D A A A 21 D D C B A B 22 D C B A A D 23 D C C D D D 24 C B C D C B 25 D C D C D B 26 B B B D D B 27 B C D C B C 28 A C D C C D 29 B B C D D A 30 C C A A C C 31 D B A C A A 32 C A C B A D 33 A D B C B D 34 A B D B B C 35 C D C B C B 36 D C B B A D 37 A A B D D A 38 C C D D C D 39 C D C D A A 40 A B D A B B 41 A C A D C B 42 D A A C A A 43 C A C C C D 44 A B C B D C 45 D B C A A C 46 B B A A D C 47 B A B B B B Trang 5/6 - Mã đề thi 134 48 C B B B B A 49 B D A B A B 50 C A B D A A Trang 6/6 Mã đề thi 134

 

THPT LÊ QUÝ ĐÔN KỲ THI THỬ THPT QUỐC GIA - LẦN 3 NĂM HỌC 2015 - 2016 ĐỀ THI THỬ Môn thi: HÓA HỌC (Đề thi có 06 trang) Thời gian làm bài: 90 phút, không kể thời gian phát đề Mã đề thi 691 Họ, tên thí sinh:................................................................ Số báo danh:..................................................................... Cho biết nguyên tử khối của các nguyên tố: H = 1; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; P = 31; S = 32; Cl = 35,5; Ca = 40; Cr = 52; Fe = 56; Cu = 64; Zn = 65; Br = 80; Ag = 108; Ba = 137. Câu 1: Cho các khí sau: Cl2, CO2, H2S, SO2, N2, C2H4, O2. Số chất khí làm mất màu nước Br2 là A. 2. B. 5. C. 3. D. 4. Câu 2: Peptit X có công thức Pro-Pro-Gly-Arg-Phe-Ser-Phe -Pro. Khi thuỷ phân không hoàn toàn X thu được tối đa bao nhiêu loại peptit có amino axit đầu N là phenylalanin (Phe)? A. 3. B. 5. C. 6. D. 4. Câu 3: Thủy phân m gam xenlulozơ trong môi trường axit rồi trung hòa hết lượng axit bằng kiềm. Đun nóng dung dịch thu được với lượng dư AgNO3 trong NH3, tạo ra m gam kết tủa. Hiệu suất của phản ứng thủy phân là A. 50%. B. 80%. C. 60%. D. 75%. Câu 4: Hình vẽ sau mô tả thí nghiệm điều chế dung dịch HCl trong phòng thí nghiệm: NaCl + H2SO4 H2O Phát biểu nào sau đây sai? A. Trong thí nghiệm trên có thể thay NaCl bằng CaF2 để điều chế HF. B. Trong thí nghiệm trên, dung dịch H2SO4 có nồng độ loãng. C. Trong thí nghiệm trên không thể thay NaCl bằng NaBr để điều chế HBr. D. Sau phản ứng giữa NaCl và H2SO4, HCl sinh ra ở thể khí. Câu 5: Có thể dùng CaO mới nung để làm khô các chất khí A. NH3, SO2, CO, Cl2. B. N2, NO2, CO2, CH4, H2. C. NH3, O2, N2, H2, C2H4. D. N2, Cl2, O2 , H2. Câu 6: Hỗn hợp X gồm hai anken là chất khí ở điều kiện thường. Hiđrat hóa X thu được hỗn hợp Y gồm bốn ancol (không có ancol bậc III). Anken trong X là A. propilen và isobutilen. B. propen và but-1-en. C. etilen và propilen. D. propen và but-2-en. Câu 7: Polime X là chất rắn trong suốt, cho ánh sáng truyền qua tốt nên được dùng chế tạo thủy tinh hữu cơ plexiglas. Monome tạo thành X là A. H2N-[CH2]5-COOH. B. CH2=C(CH3)COOCH3. Trang 1/6 – Mã đề thi 691 C. CH2=CH-CN. D. CH2=CH-Cl. Câu 8: Dãy nào sau đây gồm các chất tan vô hạn trong nước? A. CH3COOH, C3H7OH, C2H4(OH)2. B. CH3CHO, CH3COOH, C2H5OH. C. HCOOH, CH3COOH, C3H7COOH. D. C2H5COOH, C3H7COOH, HCHO. Câu 9: Thủy phân triglixerit X thu được các axit béo gồm axit oleic, axit panmitic và axit stearic. Số mol O2 cần dùng để đốt cháy hoàn toàn 8,6 gam X là A. 0,90. B. 0,78. C. 0,72. D. 0,84. Câu 10: Cho phản ứng: Na2S2O3 (l) + H2SO4 (l)  Na2SO4 (l) + SO2 (k) + S (r) + H2O (l). Khi thay đổi một trong các yếu tố: (1) tăng nhiệt độ; (2) tăng nồng độ Na2S2O3; (3) giảm nồng độ H2SO4; giảm nồng độ Na2SO4; (5) giảm áp suất của SO2; (6) dùng chất xúc tác; có bao nhiêu yếu tố làm tăng tốc độ của phản ứng đã cho? A. 4. B. 3. C. 2. D. 5. Câu 11: Hỗn hợp X gồm HCHO, HCOOCH3 và CH3CH(OH)COOH. Đốt cháy hoàn toàn m gam X cần V lít O2 (đktc), hấp thụ hết sản phẩm cháy vào nước vôi trong dư thu được 50 gam kết tủa. Giá trị của V là A. 10,08. B. 11,20. C. 8,96. D. 13,44. Câu 12: Đốt cháy hoàn toàn hỗn hợp X gồm C 2H4O, C3H8O, C4H8O2, thu được 10,304 lít CO2 (đktc) và 8,64 gam H2O. Phần trăm khối lượng của C3H8O trong X là A. 30%. B. 24%. C. 12%. D. 18%. Câu 13: Chất hữu cơ X có công thức phân tử C3H6O2, phản ứng được với Na và dung dịch AgNO3 trong NH3 nhưng không phản ứng với dung dịch NaOH. Hiđro hóa hoàn toàn X được chất Y có thể hòa tan Cu(OH)2 tạo dung dịch màu xanh lam. Công thức của X là A. HO-[CH2]2-CHO. B. C2H5COOH. C. HCOOC2H5. D. CH3-CH(OH)-CHO. Câu 14: Kem đánh răng chứa một lượng muối của flo (như CaF2, SnF2) có tác dụng bảo vệ lớp men răng vì nó thay thế một phần hợp chất có trong men răng là Ca 5(PO4)3OH thành Ca5(PO4)3F. Điều này có ý nghĩa quan trọng trong bảo vệ răng vì lớp Ca5(PO4)3F A. có thể phản ứng với H+ còn lại trong khoang miệng sau khi ăn. B. không bị môi trường axit trong miệng sau khi ăn bào mòn. C. là hợp chất trơ, bám chặt và bao phủ hết bề mặt của răng. D. có màu trắng sáng, tạo vẻ đẹp cho răng. Câu 15: Nung nóng bình kín chứa 0,5 mol H2 và 0,3 mol ankin X (có bột Ni xúc tác), sau một thời gian thu được hỗn hợp Y. Tỉ khối của Y so với H 2 bằng 16,25. Hỗn hợp Y phản ứng tối đa với 32 gam Br2 trong dung dịch. Công thức phân tử của X là A. C3H4. B. C2H2. C. C5H8. D. C4H6. Câu 16: Cho dãy các chất: metan, canxi cacbua, nhôm cacbua, bạc axetilua. Số chất trong dãy trực tiếp tạo ra axetilen bằng một phản ứng là A. 4. B. 2. C. 3. D. 1. Câu 17: Thủy phân hoàn toàn 65 gam peptit X thu được 22,25 gam alanin và 56,25 gam glyxin. X thuộc loại A. tetrapeptit. B. tripeptit. C. đipeptit. D. pentapeptit. Câu 18: Cho các phản ứng: 2CH3COOH + Ca(OH)2  (CH3COO)2Ca + 2H2O (1) 2CH3COOH + Ca  (CH3COO)2Ca + H2 (2) Trang 2/6 – Mã đề thi 691 (CH3COO)2Ca + H2SO4  2CH3COOH + CaSO4 (3) (CH3COO)2Ca + Na2CO3  2CH3COONa + CaCO3 (4) Người ta dùng phản ứng nào để tách lấy axit axetic từ hỗn hợp gồm axit axetic và ancol etylic? A. (1) và (3). B. (2) và (3). C. (1) và (4). D. (2) và (4). Câu 19: Khi ủ than tổ ong một khí rất độc, không màu, không mùi được tạo ra. Khí đó là A. NO2. B. CO. C. CO2. D. SO2. Câu 20: Hình vẽ bên minh họa sự phân bố electron của ion X2+. electron Vị trí của X trong bảng tuần hoàn các nguyên tố hóa học là A. Ô số 10, chu kì 3, nhóm VIIIA. B. Ô số 12, chu kì 2, nhóm IIA. hạt nhân C. Ô số 10, chu kì 2, nhóm VIIIA. D. Ô số 12, chu kì 3, nhóm IIA. Câu 21: Cho các đồng phân mạch hở có cùng công thức phân tử C2H4O2 lần lượt tác dụng với NaOH, Na, AgNO3/NH3 thì số phản ứng hóa học xảy ra là A. 5. B. 6. C. 3. D. 4. Câu 22: Hấp thụ hoàn toàn 4,48 lít CO2 (đktc) vào 200 ml dung dịch chứa Na2CO3 0,5M và NaOH 0,75M thu được dung dịch X. Cho BaCl2 dư vào X, khối lượng kết tủa thu được là A. 9,85 gam. B. 7,88 gam. C. 19,70 gam. D. 15,76 gam. Câu 23: Chất khí X được dùng làm chất tẩy trắng, khử trùng, bảo quản trái cây. Trong khí quyển có một lượng nhỏ khí X làm cho không khí trong lành. Chất X là A. O3. B. CO2. C. Cl2. D. NO2. Câu 24: Hỗn hợp X gồm hai chất hữu cơ đồng phân. Nếu lấy 0,05 mol X đem thực hiện phản ứng tráng bạc thì thu được tối đa 10,8 gam Ag. Khi đốt cháy hoàn toàn 0,1 mol X chỉ thu được 4,48 lít CO2 (đktc) và m gam H2O. Nhận xét nào sau đây sai? A. X làm quỳ tím hóa đỏ. B. X tác dụng được với Na. C. X tác dụng được với dung dịch NaOH. D. Giá trị của m là 3,6. Câu 25: Hỗn hợp X gồm một anđehit đơn chức, mạch hở và một ankin (phân tử hơn kém nhau một nguyên tử cacbon). Đốt cháy hoàn toàn a mol X thu được 2,4a mol CO 2 và a mol nước. Nếu cho 1 mol X tác dụng với dung dịch AgNO3/NH3 thì số mol AgNO3 phản ứng tối đa là A. 2,0. B. 1,8. C. 1,4. D. 2,4. Câu 26: Cho 0,015 mol este X (tạo thành bởi axit cacboxylic và ancol) phản ứng vừa đủ với 100 ml dung dịch NaOH 0,3M, sản phẩm tạo thành chỉ gồm một ancol Y và một muối Z với số mol bằng nhau. Xà phòng hoá hoàn toàn 3,44 gam X bằng 100 ml dung dịch KOH 0,4 M (vừa đủ), sau phản ứng cô cạn dung dịch được 4,44 gam muối khan. Công thức của X là A. C4H8(COO)2C2H4. B. C2H4(COO)2C4H8. C. C2H4(COOC4H9)2. D. C4H8(COOC2H5)2. Câu 27: Cho các phát biểu sau về chất béo: (a) Chất béo rắn thường không tan trong nước và nặng hơn nước. (b) Dầu thực vật là một loại chất béo trong đó có chứa chủ yếu các gốc axit béo không no. (c) Dầu thực vật và dầu bôi trơn đều không tan trong nước nhưng tan trong dung dịch axit. (d) Các chất béo đều tan trong dung dịch kiềm đun nóng. Số phát biểu đúng là A. 1. B. 2. C. 4. D. 3. Trang 3/6 – Mã đề thi 691 Câu 28: Tiến hành các thí nghiệm sau: (a) Sục khí Cl2 vào dung dịch NaOH ở nhiệt độ thường. (b) Sục khí Cl2 dư vào dung dịch FeSO4. (c) Cho hỗn hợp KHSO4 và KHCO3 (tỉ lệ mol 1 : 1) vào nước. (d) Cho hỗn hợp Cu và Fe2O3 (tỉ lệ mol 1 : 1) vào dung dịch HCl dư. (e) Cho hỗn hợp Fe(NO3)2 và AgNO3 (tỉ lệ mol 1 : 1) vào nước. Sau khi các phản ứng kết thúc, số thí nghiệm thu được hai muối là A. 5. B. 3. C. 2. D. 4. Câu 29: Nung nóng bình kín chứa a mol NH3 và b mol O2 (có xúc tác Pt) để chuyển toàn bộ NH3 thành NO. Làm nguội và thêm nước vào bình, lắc đều chỉ thu được dung dịch HNO 3 (không còn khí dư). Biết các phản ứng xảy ra hoàn toàn. Tỉ lệ a : b là A. 1 : 2. B. 1 : 1. C. 3 : 1. D. 2 : 3. Câu 30: Hỗn hợp M gồm hai axit cacboxylic X và Y (hơn kém nhau một nguyên tử cacbon trong phân tử). Đốt cháy hoàn toàn 0,2 mol M cần vừa đủ V lít O2 (đktc), thu được 0,45 mol CO2 và 0,2 mol H2O. Giá trị của V là A. 6,72. B. 8,96. C. 3,36. D. 4,48. Câu 31: Chất hữu cơ X (gồm C, H, O) có mạch cacbon thẳng, phân tử chỉ chứa một nhóm -CHO. Cho 0,52 gam X tác dụng hết với dung dịch AgNO3 trong NH3, thu được 1,08 gam Ag. Cho 3,12 gam X tác dụng với Na dư thu được 672 ml H2 (đktc). Số công thức cấu tạo phù hợp với X là A. 6. B. 1. C. 4. D. 3. Câu 32: Hòa tan hết 5,36 gam hỗn hợp X gồm FeO, Fe2O3, Fe3O4 trong dung dịch chứa 0,03 mol HNO3 và 0,12 mol H2SO4, thu được dung dịch Y và 224 ml NO (đktc). Cho 2,56 gam Cu vào Y, thu được dung dịch Z. Biết các phản ứng xảy ra hoàn toàn, NO là sản phẩm khử duy nhất của N +5. Khối lượng muối trong Z là A. 19,424. B. 16,924. C. 18,465. D. 23,176. Câu 33: Thủy phân hết m gam pentapeptit X (mạch hở) thu được hỗn hợp gồm 32,88 gam Ala-Gly- Ala-Gly; 10,85 gam Ala-Gly-Ala; 16,24 gam Ala-Gly-Gly; 26,28 gam Ala-Gly; 8,9 gam Ala và a gam hỗn hợp gồm Gly-Gly và Gly, trong đó tỉ lệ mol Gly-Gly và Gly là 10 : 1. Giá trị của a là A. 29,07. B. 27,09. C. 29,70. D. 27,90. Câu 34: Hỗn hợp X gồm etan, propen, benzen và axit propanoic. Đốt cháy hoàn toàn m gam X cần 4,592 lít O2 (đktc). Cho toàn bộ sản phẩm cháy vào 100 ml dung dịch Ca(OH)2 1M thu được 5 gam kết tủa và khối lượng dung dịch tăng 4,3 gam. Đun nóng dung dịch thấy xuất hiện thêm kết tủa. Phần trăm khối lượng của axit propanoic trong X là A. 36,21%. B. 45,99%. C. 63,79%. D. 54,01%. Câu 35: Trieste E mạch hở, tạo bởi glixerol và 3 axit cacboxylic đơn chức X, Y, Z. Đốt cháy hoàn toàn x mol E thu được y mol CO2 và z mol H2O. Biết y = z + 5x và x mol E phản ứng vừa đủ với 72 gam Br2 trong nước, thu được 110,1 gam sản phẩm hữu cơ. Cho x mol E phản ứng với dung dịch KOH dư thu được m gam muối. Giá trị của m là A. 49,50. B. 24,75. C. 8,25. D. 9,90. Câu 36: Cho phương trình hóa học: FeS + HNO3  Fe(NO3)3 + H2SO4 + NO + NO2 + H2O. Biết tỉ lệ số mol NO và NO2 là 3 : 4. Sau khi cân bằng phương trình hóa học trên với hệ số các chất là những số nguyên tối giản thì hệ số của HNO3 là A. 76. B. 63. C. 102. D. 39. Trang 4/6 – Mã đề thi 691 Câu 37: Chất hữu cơ mạch hở X (gồm C, H, O) có số nguyên tử oxi trong phân tử nhỏ hơn 8. Cho cùng số mol X lần lượt tác dụng với NaHCO3 và Na thì thu được số mol CO2 bằng 3/2 số mol H2. Biết X có mạch chính đối xứng và không bị oxi hoá bởi CuO khi đun nóng. Phân tử khối của X là A. 194. B. 192. C. 180. D. 190. Câu 38: Nung m gam hỗn hợp X gồm KMnO4 và KClO3 thu được chất rắn Y (gồm KCl, K2MnO4, MnO2, KMnO4) và O2. Trong Y có 1,49 gam KCl chiếm 19,893% về khối lượng. Trộn lượng O 2 trên với không khí (gồm 80% thể tích N2, còn lại là O2) theo tỉ lệ mol 1 : 4 thu được hỗn hợp khí Z. Đốt cháy hết 0,528 gam cacbon bằng Z, thu được hỗn hợp T gồm O 2, N2 và CO2, trong đó CO2 chiếm 22% về thể tích. Giá trị của m gần giá trị nào nhất sau đây? A. 10,5. B. 10,0. C. 9,5. D. 9,0. Câu 39: Đun nóng m gam chất hữu cơ X (chứa C, H, O và có mạch cacbon không phân nhánh) với 100 ml dung dịch NaOH 2M đến phản ứng hoàn toàn. Để trung hòa lượng NaOH dư cần 40 ml dung dịch HCl 1M. Cô cạn dung dịch sau khi trung hòa thu được 7,36 gam hỗn hợp hai ancol đơn chức Y, Z và 15,14 gam hỗn hợp hai muối khan, trong đó có một muối của axit cacboxylic T. Phát biểu nào sau đây đúng? A. Phân tử X chứa 14 nguyên tử hiđro. B. Số nguyên tử cacbon trong T bằng một nửa số nguyên tử cacbon trong X. C. Phân tử T chứa 3 liên kết đôi C=C. D. Y và Z là hai chất đồng đẳng kế tiếp nhau. Câu 40: Đốt cháy hoàn toàn m gam hỗn hợp X gồm glixerol, metan, ancol etylic và axit cacboxylic no, đơn chức mạch hở Y (trong đó số mol glixerol bằng 1/2 số mol metan) cần 0,41 mol O2, thu được 0,54 mol CO2. Cho m gam X tác dụng với dung dịch KOH dư thì lượng muối thu được là A. 39,2 gam. B. 27,2 gam. C. 33,6 gam. D. 42,0 gam. Câu 41: Đun nóng 8,68 gam hỗn hợp X gồm các ancol no, đơn chức, mạch hở với H 2SO4 đặc, thu được hỗn hợp Y gồm: ete (0,04 mol), anken và ancol dư. Đốt cháy hoàn toàn lượng anken và ete trong Y, thu được 0,34 mol CO2. Nếu đốt cháy hết lượng ancol trong Y thì thu được 0,1 mol CO 2 và 0,13 mol H2O. Phần trăm số mol ancol tham gia phản ứng tạo ete là A. 21,43%. B. 26,67%. C. 31,25%. D. 35,29%. Câu 42: Cho 240 ml dung dịch Ba(OH)2 1M vào 200 ml dung dịch gồm AlCl3 a mol/lít và Al2(SO4)3 2a mol/lít; sau khi các phản ứng kết thúc thu được 51,3 gam kết tủa. Giá trị của a là A. 0,16. B. 0,18. C. 0,12. D. 0,15. Câu 43: Axit cacboxylic X, ancol Y, anđehit Z đều đơn chức, mạch hở, tham gia được phản ứng cộng với Br2 và đều có không quá ba nguyên tử cacbon trong phân tử. Đốt cháy hoàn toàn 0,1 mol hỗn hợp gồm X, Y, Z (trong đó X chiếm 20% về số mol) cần vừa đủ 0,34 mol O 2. Mặt khác 14,8 gam hỗn hợp trên phản ứng tối đa với a mol H2 (xúc tác Ni). Giá trị của a là A. 0,45. B. 0,40. C. 0,50. D. 0,55. Câu 44: Hòa tan hết m gam Cu vào dung dịch gồm Fe(NO3)3 và HCl, thu được dung dịch X và khí NO. Thêm tiếp 19,2 gam Cu vào X, sau phản ứng thu được dung dịch Y chỉ chứa muối trung hòa và còn lại 6,4 gam chất rắn. Cho toàn bộ Y vào dung dịch AgNO 3 dư, thu được 183 gam kết tủa. Biết các phản ứng xảy ra hoàn toàn. Giá trị của m là A. 28,8. B. 21,6. C. 19,2. D. 32,0. Câu 45: Cho E là triglixerit được tạo bởi hai axit béo X, Y (phân tử có cùng số nguyên tử cacbon và không quá ba liên kết π, MX < MY, số mol Y nhỏ hơn số mol X) và glixerol. Xà phòng hóa hoàn Trang 5/6 – Mã đề thi 691 toàn 7,98 gam E bằng KOH vừa đủ thu được 8,74 gam hỗn hợp hai muối. Đốt cháy hoàn toàn 7,98 gam E thu được 0,51 mol CO2 và 0,45 mol H2O. Phân tử khối của X là A. 254. B. 256. C. 252. D. 250. Câu 46: Hỗn hợp X gồm propin (0,15 mol), axetilen (0,1 mol), etan (0,2 mol) và hiđro (0,6 mol). Nung nóng X với xúc tác Ni một thời gian, thu được hỗn hợp khí Y. Sục Y vào dung dịch AgNO3 trong NH3 dư, thu được a mol kết tủa và 15,68 lít (đktc) hỗn hợp khí Z. Khí Z phản ứng tối đa với 8 gam Br2 trong dung dịch. Giá trị của a là A. 0,16. B. 0,18. C. 0,10. D. 0,12. Câu 47: Cho m gam hỗn hợp X gồm Fe, Fe3O4 và Fe(NO3)2 tan hết trong 320 ml dung dịch KHSO4 1M. Sau phản ứng thu được dung dịch Y chỉ chứa 59,04 gam muối trung hòa và 0,896 lít NO (đktc, sản phẩm khử duy nhất). Cho dung dịch NaOH dư vào Y thì có 0,44 mol NaOH phản ứng. Biết các phản ứng xảy ra hoàn toàn. Phần trăm khối lượng của Fe trong X gần giá trị nào nhất sau đây? A. 3,5%. B. 2,0%. C. 3,0%. D. 2,5%. Câu 48: Hòa tan hoàn toàn 216,55 gam hỗn hợp KHSO4 và Fe(NO3)3 vào nước được dung dịch X. Cho m gam hỗn hợp Y gồm Mg, Al, MgO và Al2O3 (trong đó oxi chiếm 64/205 về khối lượng) tan hết vào X, sau khi các phản ứng kết thúc thu được dung dịch Z chỉ chứa muối trung hòa và 2,016 lít hỗn hợp khí T có tổng khối lượng 1,84 gam gồm 5 khí (đktc), trong đó về thể tích H2, N2O, NO2 lần lượt chiếm 4/9, 1/9 và 1/9. Cho BaCl2 dư vào Z thu được 356,49 gam kết tủa. Giá trị của m gần giá trị nào nhất sau đây? A. 21. B. 22. C. 19. D. 20. Câu 49: Hỗn hợp X gồm C3H6, C4H10, C2H2 và H2. Nung bình kín chứa m gam X và một ít bột Ni đến khi phản ứng xảy ra hoàn toàn, thu được hỗn hợp Y. Đốt cháy hoàn toàn Y, thu được V lít CO 2 (đktc) và 0,675 mol H2O. Biết hỗn hợp Y làm mất màu tối đa 150 ml dung dịch Br 2 1M. Cho 11,2 lít X (đktc) đi qua bình đựng dung dịch brom dư thì có 64 gam Br 2 phản ứng. Giá trị của V là A. 17,92. B. 15,68. C. 13,44. D. 16,80. Câu 50: Hỗn hợp X gồm các peptit mạch hở, đều được tạo thành từ các amino axit có dạng H2NCmHnCOOH. Đun nóng 4,63 gam X với dung dịch KOH dư, thu được dung dịch chứa 8,19 gam muối. Nếu đốt cháy hoàn toàn 4,63 gam X cần 4,2 lít O2 (đktc). Dẫn toàn bộ sản phẩm cháy (CO2, H2O, N2) vào dung dịch Ba(OH)2 dư, sau phản ứng thu được m gam kết tủa và khối lượng dung dịch giảm 21,87 gam. Giá trị của m gần giá trị nào nhất sau đây? A. 35,0. B. 30,0. C. 32,5. D. 27,5. ---------- HẾT ---------- Trang 6/6 – Mã đề thi 691 ĐÁP ÁN ĐỀ LẦN 3 MÃ ĐỀ CÂU HỎI ĐÁP ÁN 691 1 D 691 2 D 691 3 D 691 4 B 691 5 C 691 6 D 691 7 B 691 8 A 691 9 B 691 10 B 691 11 B 691 12 C 691 13 D 691 14 B 691 15 A 691 16 C 691 17 A 691 18 A 691 19 B 691 20 D 691 21 B 691 22 A 691 23 A 691 24 A 691 25 D 691 26 A 691 27 B 691 28 D 691 29 A 691 30 D 691 31 C 691 32 C 691 33 D 691 34 D 691 35 A 691 36 C 691 37 B 691 38 D 691 39 B 691 40 C 691 41 A 691 42 D 691 43 A 691 44 C 691 45 C 691 46 C 691 47 C 691 48 B 691 49 C 691 50 C Trang 7/6 – Mã đề thi 691

 

THPT CHUYÊN LÊ QUÝ ĐÔN ĐỀ THI THỬ QUỐC GIA - KSCL LẦN 1 NĂM HỌC 2015 - 2016 TỔ: LÍ - HÓA Môn: HÓA HỌC (Đề thi gồm 50 câu, 06 trang) Thời gian làm bài: 90 phút, không kể thời gian phát đề Mã đề thi 357 Họ và tên: ....................................................................... Số báo danh......................... Cho khối lượng nguyên tử của các nguyên tố: H = 1; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; P = 31; S = 32; Cl = 35,5; Ca = 40; Cr = 52; Fe = 56; Cu = 64; Zn = 65; Br = 80; Ag = 108; Ba = 137. Câu 1: Có bao nhiêu hiđrocacbon mạch hở là chất khí ở điều kiện thường, phản ứng đươ ̣c với dung dịch AgNO3 trong NH3? A. 4. B. 5. C. 3. D. 6. Câu 2: Hỗn hợp E gồm axit cacboxylic X, ancol Y (đều no, đơn chức, mạch hở) và este Z được tạo bởi X, Y. Đốt cháy hoàn toàn m gam E cần 40,32 lít O2 (đktc), thu được 31,36 lít CO2 (đktc). Đun nóng m gam E với 100 ml dung dịch NaOH 1M, sau khi phản ứng kết thúc, cô cạn dung dịch thu được 5,68 gam chất rắn khan. Công thức của X là A. C3H7COOH. B. HCOOH. C. C2H5COOH. D. CH3COOH. Câu 3: Các dung dịch riêng biệt: Na2CO3, BaCl2, MgCl2, H2SO4, NaOH được đánh số ngẫu nhiên (1), (2), (3), (4), (5). Tiến hành các thí nghiệm, kết quả được ghi lại trong bảng sau: Dung dịch (1) (2) (4) (5) (1) khí thoát ra có kết tủa (2) khí thoát ra có kết tủa có kết tủa (4) có kết tủa có kết tủa (5) có kết tủa Các dung dịch (1), (3), (5) lần lượt là A. H2SO4, MgCl2, BaCl2. B. H2SO4, NaOH, MgCl2. C. Na2CO3, BaCl2, BaCl2. D. Na2CO3, NaOH, BaCl2. Câu 4: Hỗn hợp X gồm Al, Ca, Al4C3 và CaC2. Cho 15,15 gam X vào nước dư, chỉ thu được dung dịch Y và hỗn hợp khí Z (C2H2, CH4, H2). Đốt cháy hết Z, thu được 4,48 lít CO2 (đktc) và 9,45 gam H2O. Nhỏ từ từ 200 ml dung dịch HCl 2M vào Y, được m gam kết tủa. Giá trị của m là A. 16,9. B. 15,6. C. 19,5. D. 27,3. Câu 5: Cho một hỗn hợp chứa benzen, toluen, stiren với nhiệt độ sôi tương ứng là 800C, 1100C, 1460C. Để tách riêng các chất trên người ta dùng phương pháp A. sắc ký. B. chiết. C. chưng cất. D. kết tinh. Câu 6: Hòa tan hết m gam FeS bằng một lượng tối thiểu dung dịch HNO3 (dung dịch X), thu được dung dịch Y và khí NO. Dung dịch Y hòa tan tối đa 3,84 gam Cu. Biết trong các quá trình trên, sản phẩm khử duy nhất của N+5 đều là NO. Số mol HNO3 trong X là A. 0,48. B. 0,12. C. 0,36. D. 0,24. Câu 7: Cho các phát biểu sau: (a) Glucozơ được dùng để tráng gương, tráng ruột phích. (b) Ở người, nồng độ glucozơ trong máu được giữ ổn định ở mức 0,1%. (c) Trong công nghiệp dược phẩm, saccarozơ được dùng để pha chế thuốc. Trang 1/6 Mã đề thi 357 (d) Xenlulozơ trinitrat là nguyên liệu để chế tạo thuốc súng không khói. Số phát biểu đúng là A. 3. B. 7. C. 9. D. 5. Câu 8: Cho hình vẽ mô tả thí nghiệm: dung dịch H2SO4 đặc Na2SO3 tt dung dịch Br2 Phản ứng xảy ra trong bình đựng dung dịch Br 2 là A. SO2 + Br2 + 2H2O → 2HBr + H2SO4. B. Na2SO3 + H2SO4 → Na2SO4 + SO2 + H2O. C. 2SO2 + O2 → 2SO3. D. Na2SO3 + Br2 + H2O → Na2SO4 + 2HBr. Câu 9: Cho phản ứng sau: CnH2n + KMnO4 + H2O → CnH2n(OH)2 + KOH + MnO2. Tổng hệ số (nguyên, tối giản) của các chất trong phương trình phản ứng trên là A. 16. B. 18. C. 14. D. 12. Câu 10: Hòa tan hoàn toàn m gam hỗn hợp X gồm FeO, Fe3O4, Fe(OH)2, FeCO3 (trong đó Fe3O4 chiếm 25% số mol hỗn hợp) bằng dung dịch HNO 3 dư, khi phản ứng hoàn toàn thu được dung dịch Y chứa (m + 284,4) gam muối và 15,68 lít (đktc) hỗn hợp khí Z gồm NO và CO2. Tỉ khối của Z so với H2 bằng 18. Biết NO là sản phẩm khử duy nhất của N+5. Giá trị của m là A. 151,2. B. 102,8. C. 78,6. D. 199,6. Câu 11: Cho các phản ứng hóa học sau: (a) 2 - metylpropa  Cl 2 1:1, ánh sáng1 - clo - 2 - metylpropa X1   2 - clo - 2 - metylpropa X 2  n  n n (b) buta - 1,3 - đien  Br2 1:1, C  1,2 - đibrombut - 3 - en X3   1,4 - đibrombut - 2 - en X 4   40 0 (c) propen  H 2O  propan - 1 - ol X5   propan - 2 - ol X6  H2SO4 Sản phẩm chính trong các phản ứng trên là A. X1, X3, X5. B. X2, X3, X6. C. X2, X4, X6. D. X1, X4, X5. Câu 12: Cho 0,1 mol anđehit đơn chức, mạch hở X phản ứng vừa đủ với 0,3 mol AgNO3 trong dung dịch NH3, thu được 43,6 gam kết tủa. Mặt khác, hiđro hóa hoàn toàn 4 gam X cần a mol H2. Giá trị của a là A. 0,15. B. 0,05. C. 0,20. D. 0,10. Câu 13: Cho sơ đồ phản ứng sau: (a) X1  H 2 O đpcmn  X 2  X3   H 2  (đpcmn: điện phân có màng ngăn)   (b) X 2  X 4   BaCO3   Na 2 CO3  H 2O (c) X 2  X 3   X1  X 5  H 2 O (d) X 4  X 6   BaSO 4   K 2SO 4  CO2   H 2O Các chất X2, X5, X6 theo thứ tự là A. KOH, KClO3, H2SO4. B. NaOH, NaClO, KHSO4. C. NaHCO3, NaClO, KHSO4. D. NaOH, NaClO, H2SO4. Trang 2/6 – Mã đề thi 357 Câu 14: Cho vào ống nghiệm một vài tinh thể K2 Cr2O7, sau đó thêm tiếp khoảng 1 ml nước và lắc đều, thu được dung dịch X. Thêm vài giọt dung dịch KOH vào X, thu được dung dịch Y. Hai dung dịch X và Y lần lượt có màu A. da cam và vàng. B. vàng và da cam. C. đỏ nâu và vàng. D. vàng và đỏ nâu. Câu 15: Cho ba chất hữu cơ X, Y, Z (có mạch cacbon hở, không phân nhánh, chứa C, H, O) đều có phân tử khối bằng 82, trong đó X và Y là đồng phân của nhau. Biết 1 mol X hoặc Z phản ứng vừa đủ với 3 mol AgNO3 trong dung dịch NH3 ; 1 mol Y phản ứng vừa đủ với 4 mol AgNO3 trong dung dịch NH3. Phát biểu nào sau đây đúng? A. Phân tử Y phản ứng với H2 (xúc tác Ni) theo tỉ lệ mol tương ứng 1 : 3. B. X và Z có cùng số nguyên tử cacbon trong phân tử. C. X là hợp chất tạp chức. D. Y và Z thuộc cùng dãy đồng đẳng. Câu 16: Hỗn hợp X gồm phenol (C6H5OH) và một axit cacboxylic đơn chức, mạch hở. Cho 26 gam X tác dụng vừa đủ với nước brom, thu được dung dịch Y và 66,2 gam kết tủa 2,4,6-tribromphenol. Dung dịch Y phản ứng tối đa với V lít dung dịch NaOH 1M (đun nóng). Mặt khác, cho 26 gam X phản ứng hết với Na dư, thu được 32,6 gam muối. Giá trị của V là A. 0,8. B. 0,9. C. 0,6. D. 0,7. Câu 17: Este HCOOCH3 có tên gọi là A. etyl fomat. B. metyl axetat. C. etyl axetat. D. metyl fomat. Câu 18: X là hỗn hợp gồm HOOC-COOH, OHC-COOH, OHC-C≡C-CHO, OHC-C≡C-COOH; Y là axit cacboxylic no, đơn chức, mạch hở. Đun nóng m gam X với lượng dư dung dịch AgNO3 trong NH3, thu được 23,76 gam Ag. Nếu cho m gam X tác dụng với NaHCO3 dư thì thu được 0,07 mol CO2. Đốt cháy hoàn toàn hỗn hợp gồm m gam X và m gam Y cần 0,805 mol O2, thu được 0,785 mol CO2. Giá trị của m là A. 8,8. B. 4,6. C. 6,0. D. 7,4. Câu 19: Phản ứng nào sau đây thuộc loại phản ứng axit - bazơ? A. NaOH + NH4Cl → NaCl + NH3 + H2O. B. Ba(OH)2 + K2CO3 → BaCO3 + 2KOH. C. CaC2 + H2O → Ca(OH)2 + C2H2. D. AgNO3 + HCl → AgCl + HNO3. Câu 20: Cho dãy các chất sau: stiren, phenol, ancol benzylic, phenyl acrylat. Số chất làm mất màu nước brom là A. 2. B. 3. C. 1. D. 4. Câu 21: Hỗn hợp M gồm hai ancol đơn chức là X và Y (MX < MY), đồng đẳng kế tiếp của nhau. Đun nóng 0,5 mol M với H2SO4 đặc ở 140o C , thu được 9,63 gam hỗn hợp ba ete. Biết hiệu suất phản ứng tạo ete của X và Y lần lượt bằng 50% và 40%. Phần trăm khối lượng của X trong M là A. 31,51%. B. 69,70%. C. 43,40%. D. 53,49%. Câu 22: Axit nào sau đây là axit béo? A. Axit benzoic. B. Axit oleic. C. Axit glutamic. D. Axit lactic. Câu 23: Cho hóa chất vào ba ống nghiệm 1, 2, 3. Thời gian từ lúc bắt đầu trộn dung dịch đến khi xuất hiện kết tủa ở mỗi ống nghiệm tương ứng là t 1, t2, t3 giây. Kết quả được ghi lại trong bảng: Ống nghiệm Na2S2O3 H2O H2SO4 Thời gian kết tủa 1 4 giọt 8 giọt 1 giọt t1 giây 2 12 giọt 0 giọt 1 giọt t2 giây 3 8 giọt 4 giọt 1 giọt t3 giây So sánh nào sau đây đúng? A. t2 > t1 > t3. B. t1 < t3 < t2. C. t2 < t3 < t1. D. t3 > t1 > t2. Trang 3/6 – Mã đề thi 357 Câu 24: Cho m gam Na tan hoàn toàn trong dung dịch HNO3, thu được dung dịch X và 336 ml khí (ở đktc, phản ứng chỉ tạo một sản phẩm khử duy nhất của N +5). Thêm từ từ đến dư dung dịch KOH vào X (đun nóng), thu được 224 ml khí (đktc). Giá trị của m là A. 1,84. B. 3,91. C. 2,53. D. 3,68. Câu 25: Hỗn hợp X gồm metan, propen, isopren. Đốt cháy hoàn toàn 10 gam X cần vừa đủ 24,64 lít O2 (đktc). Mặt khác, a mol X phản ứng tối đa với 200 ml dung dịch Br2 1M. Giá trị của a là A. 0,6. B. 0,5. C. 0,3. D. 0,4. Câu 26: Trộn lẫn V ml dung dịch KOH 0,2M với V ml dung dịch H2SO4 0,2M thu được 2V ml dung dịch X. Dung dịch X có pH bằng A. 13. B. 12. C. 2. D. 1. Câu 27: Cho 6,72 gam Fe tan hết trong dung dịch H2SO4 đặc nóng (dư), thu được dung dịch chứa m gam muối. Giá trị của m là A. 9,12. B. 12,00. C. 18,24. D. 24,00. Câu 28: Chất hữu cơ mạch hở X có công thức phân tử trùng với công thức đơn giản nhất. Đốt cháy hoàn toàn m gam X cần vừa đủ 6,72 lít O2 (đktc), thu được 0,55 mol hỗn hợp gồm CO2 và H2O. Hấp thụ hết sản phẩm cháy vào 200 ml dung dịch Ba(OH) 2 1M, sau phản ứng khối lượng phần dung dịch giảm bớt 2 gam. Cho m gam X tác dụng vừa đủ với 0,1 mol NaOH, thu được H2O và một chất hữu cơ Y. Phát biểu nào sau đây sai? A. Tách nước Y thu được chất hữu cơ không có đồng phân hình học. B. X phản ứng được với NH3 trong dung dịch AgNO3. C. Có 4 công thức cấu tạo phù hợp với X. D. Đốt cháy hoàn toàn Y thu được CO2 và H2O theo tỉ lệ mol 1 : 1. Câu 29: Hỗn hợp X gồm H2 và một anken (là chất khí ở điều kiện thường) có số mol bằng nhau. Dẫn X qua Ni nung nóng, thu được hỗn hợp Y có tỉ khối so với He bằng 11,6. Hiệu suất của phản ứng hiđro hóa là A. 25,0%. B. 62,5%. C. 37,5%. D. 75,0%. Câu 30: Cho 0,15 mol hỗn hợp gồm hai ancol đơn chức X, Y (có tổng khối lượng bằng 7,6 gam) tác dụng hết với CuO (dư, đun nóng), thu được hỗn hợp chất hữu cơ M. Toàn bộ M cho phản ứng tráng bạc hoàn toàn thu được 43,2 gam Ag. Số cặp ancol X và Y thỏa mãn tính chất trên là A. 2. B. 5. C. 4. D. 1. Câu 31: Nhiệt phân 40,3 gam hỗn hợp X gồm KMnO4 và KClO3, sau một thời gian thu được khí O2 và 29,9 gam chất rắn Y gồm KMnO4, K2MnO4, MnO2 và KCl. Để hòa tan hoàn toàn Y cần vừa đủ dung dịch chứa 0,7 mol HCl. Phần trăm khối lượng KMnO4 bị nhiệt phân là A. 50%. B. 80%. C. 75%. D. 60%. Câu 32: Thủy phân hoàn toàn 34,2 gam saccarozơ trong 200 ml dung dịch HCl 0,1M thu được dung dịch X. Trung hòa dung dịch X, thu được dung dịch Y, sau đó cho toàn bộ Y tác dụng với lượng dư dung dịch AgNO3 trong NH3, thu được m gam kết tủa. Giá trị của m là A. 46,07. B. 43,20. C. 24,47. D. 21,60. Câu 33: Nung hỗn hợp gồm 5,6 gam Fe và 3,2 gam Cu với 5,76 gam S đến khi phản ứng hoàn toàn, thu được chất rắn X. Cho toàn bộ X tác dụng hết với dung dịch HCl dư, thu được khí Y. Thể tích dung dịch Pb(NO3)2 1M tối thiểu cần dùng để hấp thụ hết khí Y là A. 120 ml. B. 180 ml. C. 150 ml. D. 100 ml. Câu 34: Cấu hình electron lớp ngoài cùng của nguyên tử nhóm IIA là A. ns1. B. ns2np1. C. ns2. D. ns2np2. Câu 35: Cho các sơ đồ chuyển hóa sau: Trang 4/6 Mã đề thi 357  H ,t  KMnO T X 1500 C  Y   Z  O2  T ;  H 2O Y 2 P 4  Q o E  o     0 HgSO4 , H 2SO4 Pd/PbCO3 H 2SO4 , t Biết phân tử E chỉ chứa một loại nhóm chức. Phân tử khối của E là A. 132. B. 118. C. 104. D. 146. Câu 36: Nung m gam hỗn hợp gồm Mg và Cu(NO3)2 trong điều kiện không có không khí, sau một thời gian thu được chất rắn X và 10,08 lít (đktc) hỗn hợp khí gồm NO2 và O2. Hòa tan hoàn toàn X bằng 650 ml dung dịch HCl 2M, thu được dung dịch Y chỉ chứa 71,87 gam muối clorua và 0,05 mol hỗn hợp khí Z gồm N2 và H2. Tỉ khối của Z so với He bằng 5,7. Giá trị của m gần giá trị nào nhất sau đây? A. 50. B. 55. C. 45. D. 60. Câu 37: Cho các phản ứng sau: (a) Đimetylaxetilen + dung dịch AgNO3/NH3 → (b) Fructozơ + dung dịch AgNO3/NH3 (đun nóng) → (c) Toluen + dung dịch KMnO4 (đun nóng) → (d) Phenol + dung dịch Br2 → Số phản ứng tạo ra kết tủa là A. 2. B. 1. C. 4. D. 3. Câu 38: Hòa tan hoàn toàn 30 gam hỗn hợp X gồm Mg, MgO, Mg(NO3)2 trong dung dịch H2SO4. Sau phản ứng thu được dung dịch Y chỉ chứa một muối sunfat và 4,48 lít NO (đktc, sản phẩm khử duy nhất). Số mol H2SO4 đã phản ứng là A. 0,3 mol. B. 0,6 mol. C. 0,5 mol. D. 0,4 mol.   Câu 39: Dung dịch X chứa 0,2 mol Ca 2 ; 0,08 mol Cl  ; z mol HCO3 và t mol NO3 . Cô cạn X rồi nung đến khối lượng không đổi, thu được 16,44 gam chất rắn Y. Nếu thêm t mol HNO3 vào X rồi đun dung dịch đến cạn thì thu được muối khan có khối lượng là A. 20,60 gam. B. 30,52 gam. C. 25,56 gam. D. 19,48 gam. Câu 40: Dung dịch X chứa a mol Na2CO3 và 2a mol KHCO3; dung dịch Y chứa b mol HCl. Nhỏ từ từ đến hết Y vào X, sau các phản ứng thu được V lít CO2 (đktc). Nếu nhỏ từ từ đến hết X vào Y, sau các phản ứng thu được 3V lít CO2 (đktc). Tỉ lệ a : b là A. 3 : 4. B. 1 : 2. C. 1 : 4. D. 2 : 3. Câu 41: Cho X1, X2, X3 là ba chất hữu cơ có phân tử khối tăng dần. Khi cho cùng số mol mỗi chất tác dụng với dung dịch AgNO3 trong NH3 dư thì đều thu được Ag và muối Y, Z. Biết rằng: (a) Lượng Ag sinh ra từ X1 gấp hai lần lượng Ag sinh ra từ X2 hoặc X3. (b) Y tác dụng với dung dịch NaOH hoặc HCl đều tạo khí vô cơ. Các chất X1, X2, X3 lần lượt là A. HCHO, CH3CHO, C2H5CHO. B. HCHO, HCOOH, HCOONH4. C. HCHO, CH3CHO, HCOOCH3. D. HCHO, HCOOH, HCOOCH3. Câu 42: Cho các cặp chất sau: SO2 và H2S, F2 và H2O, Li và N2, Hg và S , Si và F2, SiO2 và HF. Số cặp chất phản ứng được với nhau ở điều kiện thường là A. 4. B. 6. C. 5. D. 3. Câu 43: Đốt cháy hoàn toàn m gam este hai chức, mạch hở X (được tạo bởi axit cacboxylic no, đa chức và hai ancol đơn chức, phân tử X có không quá 5 liên kết π) cần 0,3 mol O2, thu được 0,5 mol hỗn hợp CO2 và H2O. Khi cho m gam X tác dụng hoàn toàn với 200 ml dung dịch KOH 1M, cô cạn dung dịch thì thu được khối lượng chất rắn là A. 14,6 gam. B. 9,0 gam. C. 13,9 gam. D. 8,3 gam. Trang 5/6 Mã đề thi 357 Câu 44: Hòa tan hoàn toàn 3,84 gam Cu trong dung dịch HNO3 dư, thu được khí NO (sản phẩm khử duy nhất). Trộn lượng NO trên với O2 dư, thu được hỗn hợp khí Y. Sục Y vào nước dư, thu được dung dịch Z và còn lại khí O2 duy nhất. Tổng thể tích O2 (đktc) đã phản ứng là A. 0,896 lít. B. 0,672 lít. C. 0,504 lít. D. 0,784 lít. Câu 45: Chất hữu cơ X có công thức phân tử C7H8O2, chứa vòng benzen, phản ứng với NaOH theo tỉ lệ mol 1 : 1. Biết a mol X tác dụng hết với Na, sinh ra a mol H2. Công thức của X là A. CH3-O-C6H4-OH. B. C6H3(OH)2CH3. C. HO-CH2-O-C6H5. D. HO-C6H4-CH2OH. Câu 46: Hòa tan hết m gam hỗn hợp X gồm Mg, MgO, Mg(HCO3)2, MgSO3 bằng một lượng vừa đủ dung dịch H2SO4 30%, thu được 11,2 lít (đktc) hỗn hợp khí Y và dung dịch Z có nồng độ 36%. Tỉ khối của Y so với He bằng 8. Cô cạn Z được 72 gam muối khan. Giá trị của m là A. 20. B. 10. C. 15. D. 25. Câu 47: Chất khí nào sau đây là nguyên nhân chính gây hiện tượng hiệu ứng nhà kính? A. NO2. B. Cl2. C. CO2. D. SO2. Câu 48: Thuốc nổ TNT được điều chế trực tiếp từ A. cumen. B. stiren. C. benzen. D. toluen. Câu 49: Hỗn hợp T gồm hai axit cacboxylic đa chức X và Y (có số mol bằng nhau), axit cacboxylic đơn chức Z (phân tử các chất có số nguyên tử cacbon không lớn hơn 4 và đều mạch hở, không phân nhánh). Trung hòa m gam T cần 510 ml dung dịch NaOH 1M; còn nếu cho m gam T vào dung dịch AgNO3 trong NH3 dư thì thu được 52,38 gam kết tủa. Đốt cháy hoàn toàn lượng T trên, thu được CO2 và 0,39 mol H2O. Dẫn toàn bộ sản phẩm cháy vào 400 ml dung dịch Ba(OH)2 1M, sau phản ứng không thu được kết tủa. Phần trăm khối lượng của Z trong T là A. 54,28%. B. 62,76%. C. 60,69%. D. 57,84%. Câu 50: Để khắc chữ lên thủy tinh, người ta dựa vào phản ứng A. SiO2 + 2NaOH → Na2SiO3 + H2O. B. SiO2 + Na2CO3 → Na2SiO3 + CO2. C. SiO2 + 2Mg → Si + 2MgO. D. SiO2 + 4HF → SiF4 + 2H2O. ---------- HẾT ---------- Trang 6/6 – Mã đề thi 357 ĐÁP ÁN ĐỀ LẦN 1 MÃ ĐỀ CÂU HỎI ĐÁP ÁN 357 1 B 357 2 C 357 3 B 357 4 A 357 5 C 357 6 A 357 7 B 357 8 A 357 9 A 357 10 A 357 11 C 357 12 C 357 13 B 357 14 A 357 15 C 357 16 B 357 17 D 357 18 A 357 19 A 357 20 B 357 21 D 357 22 B 357 23 C 357 24 B 357 25 C 357 26 D 357 27 D 357 28 C 357 29 D 357 30 B 357 31 A 357 32 A 357 33 D 357 34 C 357 35 D 357 36 B 357 37 D 357 38 B 357 39 C 357 40 A 357 41 D 357 42 B 357 43 C 357 44 B 357 45 D 357 46 A 357 47 C 357 48 D 357 49 C 357 50 D Trang 7/6 Mã đề thi 357

 

TRƯỜNG THPT CHUYÊN HẠ LONG KÌ THI TRUNG HỌC PHỔ THÔNG QUỐC GIA NĂM 2016 ĐỀ THI THỬ Môn: HÓA HỌC (Đề thi gồm 4 trang) Thời gian làm bài: 90 phút, không kể thời gian phát đề Mã đề thi 132 Họ, tên thí sinh:.......................................................................... Lớp :........................................................................................... Cho KLNT: C = 12; N = 14; P = 31; O = 16; S = 32; H = 1; Li = 7; Na = 23; K = 39, Rb = 85,5; Be = 9; Mg = 24; Ca = 40; Sr = 87,5; Ba = 137; Al = 27; Zn = 65; Cu = 64; Pb = 207; Ag = 108; Fe = 56; Cu = 64; Mn = 55; Cl = 35,5; Br = 80. Câu 1: Phản ứng nào dưới đây thuộc loại phản ứng oxi hóa - khử? A. 2NaOH + SO2 → Na2SO3 + H2O. B. AgNO3 + HCl → AgCl + HNO3. C. 2NO2 + 2NaOH → NaNO3 + NaNO2 + H2O. D. Ca(OH)2 + 2CO2 → Ca(HCO3)2. Câu 2: Phenol không phản ứng với chất nào sau đây? A. NaOH. B. Br2. C. NaHCO3. D. Na. Câu 3: Hiđrocacbon X ở điều kiện thường là chất khí. Khi oxi hoá hoàn toàn X thì thu được thể tích khí CO 2 và hơi H2O là 2 : 1 ở cùng điều kiện. X phản ứng với dung dịch AgNO3 trong NH3 tạo kết tủa. Số cấu tạo của X thoả mãn tính chất trên là A. 2. B. 3.` C. 4. D. 1. Câu 4: Có 4 dung dịch riêng biệt: CuSO4, ZnCl2, FeCl3, AgNO3. Nhúng vào mỗi dung dịch một thanh Ni. Số trường hợp xuất hiện ăn mòn điện hoá là A. 3. B. 2. C. 4. D. 1. Câu 5: Phát biểu nào sau đây không đúng ? A. Trong dãy kim loại kiềm, đi từ Li đến Cs nhiệt độ nóng chảy giảm dần. B. Có thể dùng dung dịch Na2CO3 để làm mềm tất cả các loại nước cứng. C. Các kim loại Na, K, Ca, Ba đều có cấu trúc mạng tinh thể lập phương tâm khối. D. Một trong những tác dụng của criolit trong quá trình sản xuất nhôm là làm tăng tính dẫn điện của chất điện phân. Câu 6: Khi chúng ta ăn các thực phẩm có chứa chất béo, tinh bột hoặc protein thì phản ứng hoá học xảy ra đầu tiên của các loại thực phẩm trên trong cơ thể là phản ứng A. thuỷ phân. B. oxi hoá. C. khử. D. polime hoá. Câu 7: Đốt cháy hoàn toàn hợp chất hữu cơ nào sau đây thì sản phẩm thu được khác với các chất còn lại? A. Protein. B. Cao su thiên nhiên. C. Chất béo. D. Tinh bột. Câu 8: Cho các phát biểu sau: (a) Ở nhiệt độ thường, Cu(OH)2 có thể tan trong dung dịch glucozơ. (b) Anilin là một bazơ, dung dịch của nó làm giấy quì tím chuyển thành màu xanh. (c) Ở nhiệt độ thường, axit acrylic phản ứng được với dung dịch brom. (d) Ở điều kiện thích hợp, glyxin phản ứng được với ancol etylic. (e) Ở điều kiện thường, etilen phản ứng với dung dịch AgNO3/NH3 cho kết tủa màu vàng. Số phát biểu đúng là A. 3. B. 4. C. 5. D. 2. Câu 9: Nhúng một đinh sắt sạch vào dung dịch Cu(NO3)2. Sau một thời gian lấy đinh sắt ra, làm khô, thấy khối lượng đinh sắt tăng 1 gam. Khối lượng sắt đã phản ứng là A. 3,5 gam. B. 7,0 gam. C. 5,6 gam. D. 2,8 gam. Câu 10: Thành phần hoá học chính của quặng boxit là A. FeCO3. B. Al2O3.2H2O. C. Fe3O4.nH2O. D. AlF3.3NaF. Câu 11: Ancol và amin nào sau đây cùng bậc? A. (CH3)2CHOH và (CH3)2CHNH2. B. (C2H5)2NH và C2H5CH(OH)CH3. C. (C2H5)2NH và C2H5CH2OH. D. (CH3)3COH và (CH3)3CNH2. Câu 12: Kim loại sắt không tan trong dung dịch nào sau đây? A. FeCl3. B. H2SO4 loãng, nguội. C. AgNO3. D. HNO3 đặc, nguội. Câu 13: Ở điều kiện thường, kim loại nào sau đây không phản ứng với nước? A. Li. B. K. C. Sr. D. Be. Câu 14: Cho 8,24 gam α-amino axit X (phân tử có một nhóm –COOH và một nhóm –NH2) phản ứng với dung dịch HCl dư thì thu được 11,16 gam muối. X là A. H2NCH(C2H5)COOH. B. H2NCH2CH(CH3)COOH. C. H2N[CH2]2COOH. D. H2NCH(CH3)COOH. Câu 15: Ion X2+ có cấu hình electron ở trạng thái cơ bản là 1s22s22p6. Số hạt mang điện trong ion X2+ là A. 16. B. 18. C. 20. D. 22. Câu 16: Cho anđehit acrylic (CH2=CH-CHO) phản ứng hoàn toàn với H2 (dư, xúc tác Ni, to) thu được A. CH3CH2CH2OH. B. CH3CH2CHO. C. CH3CH2COOH. D. CH2=CH-COOH. Câu 17: Đốt 3,36 gam kim loại M trong khí quyển clo thì thu được 9,75 gam muối clorua. Kim loại M là A. Cu. B. Zn. C. Fe. D. Al. Câu 18: Cho các nguyên tố M (Z = 11), X (Z = 17), Y (Z = 9) và R (Z = 19). Bán kính nguyên tử của các nguyên tố tăng dần theo thứ tự A. M < X < R < Y. B. Y < X < M < R. C. Y < M < X < R. D. M < X < Y < R. Câu 19: Khi thực hiện các thí nghiệm cho chất khử (kim loại, phi kim,…) phản ứng với axit nitric đặc thường tạo ra khí NO2 độc hại, gây ô nhiễm môi trường. Để hạn chế lượng khí NO2 thoát ra môi trường, người ta nút ống nghiệm bằng bông tẩm dung dịch nào sau đây ? A. Muối ăn. B. Xút. C. Cồn. D. Giấm ăn. Câu 20: Hoà tan m gam Fe trong dung dịch HNO3 đặc, nóng dư thì thu được 8,064 lít khí NO2 (sản phẩm khử duy nhất, ở đktc). Giá trị của m là A. 8,96. B. 6,16. C. 6,72. D. 10,08. Câu 21: Trong công nghiệp, để điều chế kim loại Ag, Cu gần như tinh khiết (99,99%) người ta sử dụng phương pháp nào sau đây? A. thuỷ luyện. B. nhiệt luyện. C. điện phân nóng chảy. D. điện phân dung dịch. Câu 22: Thủy phân hoàn toàn 0,1 mol một este no (trong phân tử có số nguyên tử cacbon bằng số nguyên tử oxi) cần dùng vừa đủ 200 ml dung dịch NaOH 1M. Công thức phân tử của este là: A. C2H4O2. B. C3H4O3. C. C4H6O4. D. C6H8O6. Câu 23: Thực hiện các thí ngiệm sau ở điều kiện thường: (1) Cho kim loại liti vào bình khí nitơ. (2) Sục khí hiđrosunfua vào dung dịch Zn(NO3)2. (3) Sục khí clo vào dung dịch FeBr3. (4) Cho dung dịch NaOH vào dung dịch phenol (C6H5OH). Số thí nghiệm xảy ra phản ứng là A. 4. B. 1. C. 2. D. 3. Câu 24: Đun nóng 7,2 gam CH3COOH với 6,9 gam C2H5OH (xúc tác H2SO4) thì thu được 7,04 gam este. Hiệu suất của phản ứng este hoá là: A. 66,67%. B. 50,0%. C. 53,33%. D. 60,0%. Câu 25: Cho 0,78 gam kim loại M hoá trị II phản ứng hết với dung dịch H2SO4 loãng, dư thì thu được 268,8 cm3 khí không màu (đktc). Kim loại M là A. Ca. B. Mg. C. Pb. D. Zn. Câu 26: Cho các chất HCl (X); C2H5OH (Y); CH3COOH (Z); C6H5OH (phenol) (T). Dãy gồm các chất được sắp xếp theo chiều tính axit tăng dần là: A. (Y), (Z), (T), (X). B. (X), (Z), (T), (Y). C. (Y), (T), (Z), (X). D. (T), (Y), (Z), (X). Câu 27: Dẫn lượng khí CO dư đi qua ống sứ đựng m gam oxit sắt từ nung nóng. Sau khi phản ứng xảy ra hoàn toàn thì thu được 5,88 gam sắt. Giá trị của m là A. 12,18. B. 8,40. C. 7,31. D. 8,12. Câu 28: Công thức phân tử của triolein là A. C54H104O6. B. C57H104O6. C. C57H110O6. D. C54H110O6. Câu 29: Trong chất nào sau đây nitơ vừa có tính oxi hoá, vừa có tính khử ? A. NH4Cl. B. HNO3. C. NH3. D. NO2. Câu 30: Chất tham gia phản ứng tráng gương là A. xenlulozơ. B. saccarozơ. C. fructozơ. D. tinh bột. Câu 31: Hỗn hợp X gồm propan, etylen glicol và một số ancol no đơn chức mạch hở (trong đó propan và etylen glicol có số mol bằng nhau). Đốt cháy hoàn toàn 5,444 gam X rồi hấp thụ toàn bộ sản phẩm cháy vào bình đựng dung dịch Ba(OH)2 dư thấy khối lượng bình tăng lên 16,58 gam và xuất hiện m gam kết tủa trong bình. Giá trị của m gần với giá trị nào sau đây nhất? A. 45,70. B. 42,15. C. 43,90. D. 47,47. Câu 32: Cho 0,35 mol bột Cu và 0,06 mol Fe(NO3)3 vào dung dịch chứa 0,24 mol H2SO4 (loãng). Sau khi các phản ứng xảy ra hoàn toàn, thu được lít khí NO (sản phẩm khử duy nhất, ở đktc). Cô cạn dung dịch thu được khối lượng muối khan là: A. 52,52 gam. B. 36,48 gam. C. 40,20 gam. D. 43,56 gam. Câu 33: Lên men m kg glucozơ chứa trong nước quả nho được 100 lít rượu vang 100. Biết hiệu suất phản ứng lên men đạt 95%, ancol etylic nguyên chất có khối lượng riêng là 0,8 g/ml. Giả thiết rằng trong nước quả nho chỉ có đường glucozơ. Giá trị của m gần nhất với giá trị nào sau đây ? A. 17,0. B. 17,5. C. 16,5. D. 15,0. Câu 34: Nung 13,44 lít (đktc) hỗn hợp X gồm axetilen, propilen và hiđro (tỉ lệ mol 2: 1: 3) trong bình đựng 12 bột Ni một thời gian thì thu được hỗn hợp khí Y có tỉ khối hơi so với X là . Dẫn toàn bộ Y qua bình đựng 7 dung dịch AgNO3 trong NH3 thì thu được 12 gam kết tủa và hỗn hợp khí Z. Hấp thụ hết Z vào bình đựng dung dịch brom dư thì thấy có m gam brom phản ứng. Giá trị của m là A. 24,0. B. 16,0. C. 19,2. D. 25,6. Câu 35: Cho H3PO4 tác dụng hết với dung dịch chứa m gam NaOH, sau phản ứng thu được dung dịch X có chứa 2,51m gam chất tan. Các chất tan trong dung dịch X là A. Na2HPO4, Na3PO4. B. NaH2PO4, Na2HPO4. C. Na3PO4, NaOH. D. NaH2PO4, Na3PO4. Câu 36: Cho các phản ứng sau: (a) X + O2  Y xt  (b) Z + H2O  G xt   (c) Z + Y  T xt  (d) T + H2O  Y + G. H  Biết X, Y, Z, T, G đều có phản ứng với dung dịch AgNO3 trong NH3 tạo kết tủa; G có 2 nguyên tử cacbon. Phần trăm khối lượng của oxi trong T là A. 53,33%. B. 43,24%. C. 37,21%. D. 44,44%. Câu 37: Cho 47 gam hỗn hợp X gồm 2 ancol đi qua Al2O3, đun nóng thu được hỗn hợp Y gồm ba ete; 0,27 mol olefin; 0,33 mol hai ancol dư và 0,42 mol H2O. Biết rằng hiệu suất tách nước tạo mỗi olefin đối với mỗi ancol đều như nhau và số mol ete là bằng nhau. Khối lượng của hai ancol dư có trong hỗn hợp Y (gam) gần giá trị nào nhất ? A. 14,5. B. 17,5. C. 18,5. D. 15,5. Câu 38: Cho các chất: Na2O, CO2, NO2, Cl2, CuO, CrO3, CO, NaCl. Số chất tác dụng với dung dịch NaOH loãng, dư ở điều kiện thường là A. 4. B. 3. C. 5. D. 6. Câu 39: Cho các phát biểu sau: (1) Phân lân cung cấp cho cây trồng nguyên tố photpho dưới dạng P2O5. (2) Độ dinh dưỡng của phân kali được đánh giá theo phần trăm khối lượng của K2O. (3) Phân amophot có thành phần hoá học chính là (NH4)2HPO4 và KNO3. (4) Nitrophotka là một loại phân phức hợp. (5) Phân ure là loại phân đạm tốt nhất, được điều chế từ amoniac và CO2 ở điều kiện thích hợp. (6) Thành phần hoá học chính của phân supephotphat kép là Ca(H2PO4)2 và CaSO4. Số phát biểu đúng là A. 2. B. 3. C. 4. D. 5. Câu 40: Hòa tan hoàn toàn 24 gam hỗn hợp X gồm MO, M(OH)2 và MCO3 (M là kim loại có hóa trị không đổi) trong 100 gam dung dịch H2SO4 39,2% thu được 1,12 lít khí (đktc) và dung dịch Y chỉ chứa một chất tan duy nhất có nồng độ 39,41%. Kim loại M là A. Cu. B. Zn. C. Mg. D. Ca. Câu 41: Cho các phản ứng sau (ở điều kiện thích hợp): 1. FeS2 + HCl → 2. SiO2 + Mg  1:4  3. Si + NaOH(đặc)   4. SiO2 + NaOH(đặc)   o o t t 5. CuO + NH3   6. Ca3(PO4)2 + C + SiO2   o o t t 7. Ag2S + O2   8. H2O(h) + C   o o t t Sau khi các phản ứng xảy ra hoàn toàn, số phản ứng tạo thành đơn chất là A. 5. B. 6. C. 3. D. 4. Câu 42: Cho từ từ dung dịch chứa a mol Ba(OH)2 vào dung dịch chứa b mol ZnSO4. Đồ thị biểu diễn số mol kết tủa theo giá trị của a như sau: n 2b x b 0 0,0625 b 0,175 2b a Giá trị của b là: A. 0,10. B. 0,12. C. 0,08. D. 0,11. Câu 43: Hòa tan hoàn toàn 25,3 gam hỗn hợp X gồm Mg, Al, Zn bằng dung dịch HNO3. Sau khi phản ứng kết thúc thu được dung dịch Y và 4,48 lít (đktc) khí Z (gồm hai hợp chất khí không màu) có khối lượng 7,4 gam. Cô cạn dung dịch Y thu được 122,3 gam hỗn hợp muối. Số mol HNO3 đã tham gia phản ứng gần với giá trị nào sau đây nhất? A. 1,91 mol. B. 1,85 mol. C. 1,81 mol. D. 1,95 mol. Câu 44: Trong phòng thí nghiệm, khí C được điều chế bằng bộ dụng cụ như hình vẽ: Khí C có thể là dãy các khí nào sau đây? A. NO, CO2, C2H6, Cl2. B. N2O, CO, H2, H2S. C. NO2, Cl2, CO2, SO2. D. N2, CO2, SO2, NH3. Câu 45: Tripeptit X và tetrapeptit Y đều mạch hở. Khi thủy phân hoàn toàn hỗn hợp gồm X và Y chỉ tạo ra một amino axit duy nhất có công thức H2NCnH2nCOOH. Đốt cháy 0,05 mol Y trong oxi dư, thu được N2 và 36,3 gam hỗn hợp gồm CO2, H2O. Đốt cháy 0,01 mol X trong oxi dư, cho sản phẩm cháy vào dung dịch Ba(OH)2 dư, thu được m gam kết tủa. Biết các phản ứng đều xảy ra hoàn toàn. Giá trị của m là A. 29,55. B. 23,64. C. 17,73. D. 11,82. Câu 46: Hỗn hợp X chứa 3,6 gam Mg và 5,6 gam Fe cho vào 1 lít dung dịch chứa AgNO 3 a M và Cu(NO3)2 a M thu được dung dịch A và m gam hỗn hợp chất rắn B. Cho A tác dụng với NaOH dư thu được kết tủa D. Nung D ngoài không khí đến khối lượng không đổi thu được chất rắn E có khối lượng 18 gam. Biết các phản ứng đều xảy ra hoàn toàn. Giá trị m là A. 31,2. B. 38,8. C. 22,6. D. 34,4. Câu 47: Đốt cháy hoàn toàn m gam hỗn hợp X gồm CH3OH, CH3CHO và C2H5CHO cần dùng vừa đủ 0,6 mol O2, sinh ra 0,45 mol CO2. Nếu cho m gam X trên phản ứng với lượng dư dung dịch AgNO3 trong NH3 thì khi kết thúc các phản ứng, khối lượng Ag thu được là A. 43,2 gam. B. 16,2 gam. C. 27,0 gam. D. 32,4 gam. Câu 48: Cho các dung dịch: axit glutamic, valin, lysin, alanin, etylamin, anilin. Số dung dịch làm quỳ tím chuyển sang màu hồng, chuyển sang màu xanh, không đồi màu lần lượt là: A. 2, 1, 3. B. 1, 1, 4. C. 3, 1, 2. D. 1, 2, 3. Câu 49: Hỗn hợp X gồm Mg, MgO, Ca và CaO. Hòa tan 10,72 gam X vào dung dịch HCl vừa đủ thu được 3,248 lít khí (đktc) và dung dịch Y. Trong Y có 12,35 gam MgCl2 và m gam CaCl2. Giá trị m là A. 33,3. B. 15,54. C. 13,32. D. 19,98. Câu 50: Cao su buna–S và cao su buna – N là sản phẩm đồng trùng hợp của buta-1,3-đien với A. stiren và amoniac. B. stiren và acrilonitrin. C. lưu huỳnh và vinyl clorua. D. lưu huỳnh và vinyl xianua. ----------------------------------------------- ----------- HẾT ---------- TRƯỜNG THPT CHUYÊN HẠ LONG KÌ THI TRUNG HỌC PHỔ THÔNG QUỐC GIA NĂM 2016 ĐÁP ÁN THI THỬ Môn: HÓA HỌC Thời gian làm bài: 90 phút, không kể thời gian phát đề Mã đề thi: 132 1C 2C 3A 4B 5C 6A 7A 8A 9B 10B 11B 12D 13D 14A 15D 16A 17C 18B 19B 20C 21C 22C 23D 24A 25D 26C 27D 28B 29D 20C 31A 32D 33C 34A 35B 36D 37B 38C 39A 40C 41B 42A 43A 44C 45C 46A 47D 48D 49B 50B Trang 5/4 Mã đề thi 132

 

SỞ GIÁO DỤC VÀ ĐÀO TẠO KÌ THI THỬ TRUNG HỌC PHỔ THÔNG QUỐC GIA LẦN I TP. HỒ CHÍ MINH Đề môn thi: HÓA HỌC Thời gian làm bài 90 phút không kể thời gian phát đề Mã đề thi 485 Họ và tên thí sinh: __________________________ Số báo danh: ______________________________ Cho nguyên tử khối của các nguyên tố là: H=1; C=12; O=16; Li=7; Na=23; Mg=24; Al=27; S=32; Cl=35,5; K=39; Ca=40; Fe=56; Cu=64; Zn=65; Ag=108; Ba=137. ------------------------------------------------------------------------------------------------------------------------ Câu 1: Cho m gam bột Cu vào 400 ml dung dịch AgNO3 0,2M, sau một thời gian phản ứng thu được 7 gam hỗn hợp chất rắn (X) và dung dịch (Y). Lọc tách (X), rồi thêm 3,9 gam bột Zn vào dung dịch (Y), sau khi phản ứng xảy ra hoàn toàn thu được 6,14 gam chất rắn. Giá trị của m là A. 6,40. B. 5,76. C. 3,20. D. 3,84. Câu 2: Cho phương trình: NaX (tinh thể) + H2SO4 đặc  NaHSO4 + HX  o t Phương trình trên có thể được điều chế được các axit nào? A. HCl, HF, HBr. B. HCl, HBr, HNO3. C. HCl, HF, HNO3. D. HCl, HI, HNO3. Câu 3: Trường hợp nào sau đây thu được kết tủa khi cho phản ứng xảy ra hoàn toàn? A. Cho dung dịch NH4Cl vào dung dịch KAlO2. B. Cho KOH dư vào dung dịch CrCl3. C. Cho khí CO2 dư vào dung dịch Ba(OH)2 D. Cho dung dịch HCl dư vào dung dịch KAlO2. Câu 4: Một oxit của sắt khi tan vào dung dịch H2SO4 loãng dư thu được dung dịch A làm mất màu thuốc tím và có khả năng hòa tan Cu. Công thức oxit là A. Fe2O3. B. Fe3O4. C. FeO2. D. FeO. Câu 5: Một hỗn hợp (X) gồm anđehit acrylic và một anđehit đơn chức no mạch hở. Đốt cháy hoàn toàn 1,44 gam hỗn hợp trên cần vừa hết 1,624 lít khí oxi (đktc) thu được 2,86 gam CO2. Cho hỗn hợp X tác dụng với dung dịch AgNO3 dư trong NH3 thu được m gam Ag. Giá trị của m là A. 11,88 gam. B. 10,80. C. 8,64 gam. D. 7,56 gam. Câu 6: Hỗn hợp X gồm Fe3O4 và Cu (tỉ lệ mol 1:2). Cho m gam X tác dụng vừa đủ với dung dịch chứa 0,08 mol HCl, kết thúc phản ứng thu được dung dịch Y và còn lại m1 gam chất rắn Z. Cho dung dịch Y tác dụng với dung dịch AgNO3 dư trong NH3 thu được m2 gam kết tủa. Giá trị của m1, m2 là A. 0,64 gam và 11,48 gam. B. 0,64 gam và 2,34 gam. C. 0,64 gam và 14,72 gam. D. 0,32 gam và 14,72 gam. [1] Câu 7: Chất nào sau đây có khả năng tạo kết tủa với dung dịch Br2 ? A. phenol. B. etylen. C. benzen. D. axetilen. Câu 8: Cho các phản ứng sau: H2S + O2 dư  khí X + H2O NH3 + O2  khí Y + H2O  o Pt,850 C NH4HCO3 + HClloãng  khí Z + ... Các khí X, Y, Z lần lượt là A. SO2, NO, CO2. B. SO2, N2, CO2. C. SO2, N2, NH3. D. SO2, NO, NH3. Câu 9: Cho 3,36 lít khí CO2 (đktc) vào dung dịch chứa 500 ml KOH 0,1M và Ba(OH)2 0,12M kết thúc phản ứng thu được m gam kết tủa. Giá trị của m là A. 4,925. B. 3,94. C. 1,97. D. 2,55. Câu 10: Chất nào sau đây có khả năng làm quỳ tím ẩm hóa xanh? A. Alanin. B. Anilin. C. Metylamin. D. Glyxin. Câu 11: Cho m gam Mg vào dung dịch HNO3 dư, sau khi phản ứng kết thúc thu được 0,1792 lít khí N2 (đktc) và dung dịch X chứa 6,67m gam muối. Giá trị của m gần nhất với giá trị nào sau đây? A. 3,6. B. 1,2. C. 2,4. D. 2,55. Câu 12: Cho thí nghiệm được mô tả như hình vẽ Phát biểu nào sai ? A. Khí Y là O2. B. X là hỗn hợp KClO3 và MnO2. C. X là KMnO4. D. X là CaCO3. Câu 13: Hiện nay, nguồn nguyên liệu chính để sản xuất anđehit axetic trong công nghiệp là A. etanol. B. etan. C. axetilen. D. etilen. Câu 14: Cho 3 hiđrocacbon X, Y, Z lần lượt tác dụng với dung dịch kali pemanganat thì được kết quả X chỉ làm mất màu dung dịch khi đun nóng, Y làm mất màu ngay ở nhiệt độ thường, Z không phản ứng. Dãy các chất X, Y, Z phù hợp là [2] A. stiren, toluen, benzen. B. etilen, axetilen, metan. C. toluen, stiren, benzen. D. axetilen, etilen, metan. Câu 15: Cho phản ứng Al + NaOH + H2O  NaAlO2 + 3/2 H2. Chất oxi hóa trong phản ứng trên là A. NaOH. B. H2. C. Al. D. H2O. Câu 16: Cho một lượng bột CaCO3 tác dụng hoàn toàn với dung dịch HCl 25,55%. Sau phản ứng thu được dung dịch X trong đó nồng độ HCl còn lại là 17,28%. Thêm vào dung dịch X một lượng bột MgCO3 khuấy đều cho phản ứng xảy ra hoàn toàn thu được dung dịch Y trong đó nồng độ HCl còn lại là 13,56%. Nồng độ % của MgCl2 trong dung dịch Y gần nhất với A. 5,2%. B. 4,2%. C. 5%. D. 4,5%. Câu 17: Cho các nhận xét sau (a) Phân đạm amoni không nên bón cho loại đất chua. (b) Độ dinh dưỡng của phân kali được tính bằng % khối lượng của kali. (c) Amophot là hỗn hợp gồm (NH4)HPO4 và (NH4)3PO4. (d) Phân ure có hàm lượng N là khoảng 46%. (e) Thành phần chính của phân lân nung chảy là hỗn hợp photphat và silicsat của magie và canxi. (f) Nitrophotka là hỗn hợp của (NH4)2SO4 và KNO3. Số nhận xét sai là A. 5. B. 3. C. 4. D. 2. Câu 18: Dãy gồm các chất trong phân tử chỉ có liên kết cộng hóa trị phân cực là A. HCl, O2. B. HF, Cl2. C. H2O, HF. D. H2O, N2. Câu 19: Chất nào sau đây có khả năng trùng hợp? A. axit benzoic. B. axit acrylic. C. axit lactic. D. axit fomic. Câu 20: Khí gây ra mưa axit là A. O2. B. CO2. C. N2. D. SO2. Câu 21: Chất hữu cơ đơn chức X có phân tử khối bằng 88. Cho 17,6 gam X tác dụng với 300 ml dung dịch NaOH 1M đun nóng. Sau đó đem cô cạn dung dịch sau phản ứng thu được 23,2 gam bã rắn khan X là A. HCOOC3H7. B. C2H5COOCH3. C. C3H7COOH. D. CH3COOC2H5. Câu 22: Cho triolein lần lượt tác dụng với Na, H2 (Ni, to), dung dịch NaOH (to), Cu(OH)2. Số trường hợp có phản ứng xảy ra là A. 3. B. 1. C. 4. D. 2. Câu 23: Nguyên tố nào sau đây thuộc nhóm VIA? [3] A. Flo. B. Magie. C. Oxi. D. Nitơ. Câu 24: Tripeptit A và tetrapeptit B được tạo ra từ một aminoaxit X (dạng H2N-R-COOH). Phần trăm khối lượng nitơ trong X bằng 18,67%. Thủy phân không hoàn toàn m gam hỗn hợp A và B (số mol bằng nhau) thu được hỗn hợp gồm 0,945 gam A, 4,62 gam một đipeptit và 3,75 gam X. Giá trị của m là A. 25,170. B. 8,389. C. 4,1945. D. 12,580. Câu 25: Phân ure có công thức là A. (NH3)2CO. B. (NH4)2CO3. C. (NH2)2CO.* D. (NH4)2CO. Câu 26: Bằng 1 phương trình hóa học, từ chất hữu cơ X có thể điều chế chất hữu cơ Y có phân tử khối bằng 60. Chất X không thể là A.HCOOCH3. B. CH3OH. C. C2H5OH. D. CH3CHO. Câu 27: Khi lên men m kg ngô chứa 65% tinh bột với hiệu suất toàn quá trình là 80% thì thu được 5 lít rượu etylic 20o và V m3 khí CO2 ở đktc. Cho khối lượng riêng của C2H5OH nguyên chất bằng 0,8 gam/ml. Giá trị của m và V lần lượt là A. 2,8 và 0,39. B. 28 và 0,39. C. 2,7 và 0,41. D. 2,7 và 0,39. Câu 28: Đốt cháy hoàn toàn 0,1 mol một peptit X (X được tạo thành từ các amino axit chỉ chứa 1 nhóm -NH2 và 1 nhóm -COOH) cần 58,8 lít O2 (đktc) thu được 2,2 mol CO2 và 1,85 mol H2O. Nếu cho 0,1 mol X thủy phân hoàn toàn trong 500 ml dung dịch NaOH 2M thu được dung dịch (Y), cô cạn (Y) thu được m gam chất rắn. Công thức chung của peptit và giá trị của m lần lượt là A. CxHyO9N8 và 92,9 gam. B. CxHyO10N9 và 96,9 gam. C. CxHyO8N7 và 96,9 gam. D. CxHyO10N9 và 92,9 gam. Câu 29: Cho các chất sau: axit fomic, metyl fomat, axit axetic, glucozơ, tinh bột, xenlulozơ, anđehit axetic. Số chất có phản ứng với dung dịch AgNO3/NH3 cho ra Ag là A. 4. B. 2. C. 3. D. 5. Câu 30: Hỗn hợp R chứa các hợp chất hữu cơ đơn chức gồm axit (X), ancol (Y) và este (Z) (được tạo thành từ X và Y). Đốt cháy 2,15 gam este (Z) rồi hấp thụ sản phẩm cháy vào dung dịch Ba(OH)2 dư được 19,7 gam kết tủa và khối lượng dung dịch giảm 13,95 gam. Mặt khác, 2,15 gam Z tác dụng vừa đủ với NaOH được 1,7 gam muối. Axit X và ancol Y tương ứng là A. HCOOH và C3H5OH. B. HCOOH và C3H7OH. C. CH3COOH và C3H5OH. D. C2H3COOH và CH3OH. Câu 31: Điện phân dung dịch X chứa a mol CuSO4 và 0,15 mol KCl (điện cực trơ, màng ngăn xốp, cường độ dòng điện không đổi) trong thời gian t giây, thu được 2,24 lít khí ở anol (đktc). Nếu thời gian là 2t thì tổng thể tích khí thu được ở 2 điện cực là 4,76 lít (đktc). Biết hiệu suất điện phân là 100%, các khí sinh ra không tan trong dung dịch. Giá trị của a là A. 0,2. B. 0,15. C. 0,25. D. 0,3. Câu 32: Cho Cu phản ứng với dung dịch HNO3 đặc, cho khí NO2. Tổng hệ số cân bằng nguyên các chất trong phản ứng là [4] A. 10. B. 9. C. 12. D. 11. Câu 33: Dung dịch A chứa Al2(SO4)3 aM và H2SO4 0,5M. Cho Y dung dịch NaOH 1M vào 200 ml dung dịch A thì thu được 7,8 gam kết tủa. Mặt khác cho 1,16V lít dung dịch NaOH 1M vào 200 ml dung dịch A cũng thu được 7,8 gam kết tủa. Giá trị a là A. 0,3M. B. 0,5M. C. 0,1M. D. 0,6M. Câu 34: Dãy kim loại nào sau đây tan hết trong nước ở điều kiện thường ? A. Cs, Mg, K. B. Na, K, Ba. C. Ca, Mg, K. D. Na, K, Be. Câu 35: Cho các chất sau: Fe, Al2O3, Be, Mg, K2SO4, FeCl2. Số chất tác dụng được với dung dịch NaOH là A. 5. B. 3. C. 2. D. 4. Câu 36: Cho các nguyên tử crom (Z=24), số electron độc thân của crom là A. 7. B. 5. C. 4. D. 6. Câu 37: Este C2H5COOCH3 có tên là A. metyl propionat. B. metyletyl este. C. etylmetyl este. D. etyl propionat. Câu 38: Có bao nhiêu hiđrocacbon mạch hở khi tác dụng với H2 (dư, Ni, to) thu được sản phẩm isopentan? A. 5. B. 6. C. 8. D. 7. Câu 39: Phát biểu nào sau đây là đúng ? A. Tính chất lý học do electron gây ra gồm: tính dẻo, ánh kim, độ dẫn điện, tính cứng. B. Trong nhóm IA tính kim loại tăng dần từ Cs đến Li. C. Ở điều kiện thường tất cả kim loại đều là chất rắn. D. Crom là kim loại cứng nhất, Hg là kim loại có nhiệt độ nóng chảy thấp nhất. Câu 40: Đốt cháy hoàn toàn hỗn hợp X gồm 0,06 mol một ancol đa chức và 0,04 mol một ancol không no, có một liên kết đôi, mạch hở, thu được 0,24 mol khí CO2 và m gam H2O. Giá trị của m là A. 5,40. B. 8,40. C. 2,34. D. 2,70. Câu 41: Ba dung dịch A, B, C thỏa mãn: - A tác dụng với B thì có kết tủa xuất hiện. - B tác dụng với C thì có kết tủa xuất hiện. - A tác dụng với C thì có khí bay ra. Các dung dịch A, B, C lần lượt chứa : A. AlCl3, AgNO3¸KHSO4. B. KHCO3, Ba(OH)2¸ K2SO4. C. NaHCO3, Ba(OH)2, KHSO4. D. NaHCO3, Ca(OH)2, Mg(HCO3)2. [5] Câu 42: Trong số các chất : etyl clorua, anđehit, axetic, axit axetic, phenol, ancol etylic. Có bao nhiêu chất tác dụng được với dung dịch NaOH ở nhiệt độ thường? A. 2. B. 4. C. 5. D. 3. Câu 43: Cho 0,1 mol axit axetic vào cốc chứa 30 ml dung dịch MOH 20% (D = 1,2 g/ml, M là kim loại kiềm). Cô cạn dung dịch sau phản ứng, thu được m gam chất rắn khan. Đốt cháy hoàn toàn chất rắn thu được 9,54 gam M2CO3 và hỗn hợp khí, dẫn hỗn hợp qua dung dịch nước vôi trong dư thì khối lượng dung dịch tăng hay giảm bao nhiêu gam? A. Giảm 2,74 gam. B. Tăng 5,70 gam. C. Giảm 5,70 gam. D. Tăng 2,74 gam. Câu 44: Axit cacboxylic X mạch hở (phân tử có 2 liên kết ). X tác dụng với NaHCO3 (dư) thấy thoát ra số mol CO2 bằng số mol X phản ứng. X thuộc dãy đồng đẳng của axit A. không no, hai chức. B. không no, đơn chức. C. no, hai chức. D. no, đơn chức. Câu 45: Phương trình nào sau đây là phản ứng nhiệt nhôm? A. H2 + CuO  Cu + H2O.  B. 3CO + Fe2O3  2Fe + 3CO2.  o o t t C. 2Al + Cr2O3  Al2O3 + 2Cr.  o t D. Al2O3 + 2KOH  2KAlO2 + H2O.  Câu 46: Hòa tan hết 8,4 gam Fe trong dung dịch chứa 0,4 mol H2SO4 đặc, nóng thu được dung dịch A và V lít khí SO2 (đktc). Cô cạn dung dịch A thu được m gam muối khan. Giá trị V và m lần lượt là A. 5,04 và 30,0. B. 4,48 và 27,6. C. 5,60 và 27,6. D. 4,48 và 22,8. Câu 47: Đốt cháy hoàn toàn hỗn hợp X gồm: axit axetic, etyl axetat, metyl axetat rồi cho toàn bộ sản phẩm cháy vào bình (1) đựng dung dịch H2SO4 đặc, dư,bình (2) đựng dung dịch Ba(OH)2 dư. Kết thúc thí nghiệm thấy khối lượng bình (1) tăng thêm m gam, bình (2) thu được 10,835 gam kết tủa. Giá trị của m là A. 1,08. B. 0,99. C. 0,81. D. 0,9. Câu 48: Saccarozơ thuộc loại A. polisaccarit. B. đissaccarit. C. đa chức. D. monosaccarit. Câu 49: Thủy phân hoàn toàn H2N-CH2CO-NH-CH(CH3)-CO-NH-CH(CH3)-CO-NH-CH2CO-NH-CH2- COOH thu được bao nhiêu amino axit khác nhau? A. 5. B. 3. C. 2. D. 4. Câu 50: Số oxi hóa đặc trưng của crom là A. +2, +3, +6. B. +2, +3, +4. C. +2, +3, +5. D. +2, +4, +6. ------ Hết ------ [6] ĐÁP ÁN ĐỀ THI THỬ TRUNG HỌC PHỔ THÔNG QUỐC GIA NĂM 2015 Câu Câu Câu Mã đề hỏi Đáp án Mã đề hỏi Đáp án Mã đề hỏi Đáp án Mã đề Câu hỏi Đáp án 132 1 D 209 1 D 357 1 D 485 1 C 132 2 C 209 2 A 357 2 A 485 2 C 132 3 C 209 3 B 357 3 C 485 3 A 132 4 B 209 4 A 357 4 C 485 4 B 132 5 A 209 5 D 357 5 D 485 5 A 132 6 B 209 6 D 357 6 A 485 6 C 132 7 C 209 7 B 357 7 B 485 7 A 132 8 C 209 8 A 357 8 D 485 8 A 132 9 B 209 9 B 357 9 C 485 9 B 132 10 B 209 10 C 357 10 A 485 10 C 132 11 C 209 11 B 357 11 C 485 11 C 132 12 C 209 12 D 357 12 A 485 12 D 132 13 A 209 13 C 357 13 C 485 13 D 132 14 A 209 14 A 357 14 D 485 14 C 132 15 C 209 15 D 357 15 C 485 15 D 132 16 D 209 16 C 357 16 C 485 16 D 132 17 D 209 17 D 357 17 D 485 17 B 132 18 C 209 18 C 357 18 B 485 18 C 132 19 B 209 19 B 357 19 C 485 19 B 132 20 D 209 20 B 357 20 D 485 20 D 132 21 A 209 21 B 357 21 C 485 21 B 132 22 D 209 22 D 357 22 B 485 22 D 132 23 A 209 23 A 357 23 C 485 23 C 132 24 A 209 24 C 357 24 C 485 24 B [7] 132 25 D 209 25 C 357 25 B 485 25 C 132 26 C 209 26 D 357 26 A 485 26 A 132 27 B 209 27 C 357 27 D 485 27 D 132 28 A 209 28 D 357 28 C 485 28 B 132 29 C 209 29 B 357 29 C 485 29 A 132 30 C 209 30 B 357 30 B 485 30 A 132 31 A 209 31 B 357 31 A 485 31 A 132 32 D 209 32 A 357 32 A 485 32 A 132 33 B 209 33 B 357 33 A 485 33 A 132 34 D 209 34 C 357 34 D 485 34 B 132 35 B 209 35 D 357 35 B 485 35 B 132 36 D 209 36 B 357 36 B 485 36 D 132 37 A 209 37 A 357 37 D 485 37 A 132 38 A 209 38 C 357 38 A 485 38 D 132 39 C 209 39 A 357 39 C 485 39 D 132 40 A 209 40 B 357 40 A 485 40 A 132 41 B 209 41 A 357 41 A 485 41 C 132 42 B 209 42 A 357 42 D 485 42 D 132 43 D 209 43 D 357 43 D 485 43 A 132 44 D 209 44 A 357 44 A 485 44 B 132 45 B 209 45 B 357 45 B 485 45 C 132 46 B 209 46 C 357 46 C 485 46 B 132 47 B 209 47 C 357 47 B 485 47 B 132 48 C 209 48 A 357 48 B 485 48 B 132 49 A 209 49 B 357 49 D 485 49 C 132 50 D 209 50 D 357 50 B 485 50 A [8]

 

LUYỆN THI ĐẠI HỌC KỲ THI THỬ TRUNG HỌC PHỔNG THÔNG QUỐC GIA NĂM 2016 ĐỀ THI THỬ SỐ 01 Môn: HÓA HỌC (Đề thi có 05 trang) Thời gian làm bài: 90 phút, không kể thời gian phát đề Mã đề thi 016 Họ, tên thí sinh:……………………………………………… Số báo danh:…………………………………………………. Cho biết nguyên tử khối của các nguyên tố: H = 1; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; S = 32; Cl = 35,5; K= 39; Fe = 56; Cu = 64; Zn = 65; Ag =108; Ba = 137. Câu 1: Có các phát biểu sau: (a) Thủy phân chất béo trong môi trường kiềm luôn thu được glixerol. (b) Triolein làm mất màu nước brom. (c) Chất béo không tan trong nước và nhẹ hơn nước. (d) Benzyl axetat là este có mùi chuối chín. (e) Đốt cháy etyl axetat thu được số mol nước bằng số mol cacbonic. Số phát biểu đúng là A. 2. B. 3. C. 4. D. 5. Câu 2: Đốt cháy 11 gam este no đơn chức, mạch hở X thu được 11,2 lít khí CO2 (đktc). Mặt khác 11 gam este X tác dụng với 200ml NaOH 1M, cô cạn dung dịch thu được 11,5 gam chất rắn. X là A. Propyl fomat. B. Etyl axetat. C. Metyl propionat. D. Metyl axetat. Câu 3: Phát biểu không đúng là A. Có 2 liên kết peptit trong phân tử đipeptit mạch hở. B. Riêu cua nổi lên khi đun nóng, là hiện tượng đông tụ protein. C. Glyxin tác dụng cả dung dịch NaOH và dung dịch HCl và không làm đổi màu quỳ tím. D. Dung dịch lòng trắng trứng hòa tan được Cu(OH)2 cho phức chất màu tím. Câu 4: Nhỏ từ từ 0,3 mol HCl vào dung dịch chứa 0,2 mol Na2CO3 và 0,1 mol NaHCO3 thu được dung dịch X. Nhỏ nước vôi trong tới dư vào dung dịch X được m gam kết tủa. Giá trị m là A. 10. B. 20. C. 15. D. 30. Câu 5: Hỗn hợp X có chứa 0,2 mol C2H2 và 0,5 mol H2. Nung nóng X sau một thời gian (xúc tác Ni) thu được hỗn hợp Y có tỉ khối so với H2 là 6,2. Hỗn hợp Y tác dụng tối đa với a mol Br2 trong dung dịch. Giá trị a là A. 0,2. B. 0,3. C. 0,1. D. 0,4. 2 2 6 2 1 Câu 6: X có cấu hình electron là 1s 2s 2p 3s 3p . Vị trí của X trong bảng tuần hoàn là A. Chu kì 3, nhóm IIA. B. Chu kì 2, nhóm IIIA. C. Chu kì 2, nhóm IIA. D. Chu kì 3, nhóm IIIA. Câu 7: Cho m gam X gồm Na, Al, Fe vào dung dịch KOH dư thì thu được 0,35 mol H2. Nếu cho m gam X vào nước dư thì thu được 0,2 mol H2 và chất rắn Y, hòa tan hết Y trong HCl dư thu được 0,25 mol H2. Giá trị m là A. 13,3. B. 21,7. C. 20,2. D. 18,9. Câu 8: Khí X có mùi hắc, được sử dụng để chữa sâu răng trong y khoa, được sử dụng khử trùng nước uống, trong các thiết bị sử dụng điện cao áp như máy photocopy, khi hoạt động cũng thường sinh ra khí X. X là A. CO2. B. SO2. C. O3. D. Cl2. Câu 9: Cho phương trình hóa học : Fe + H2SO4 → Fe2(SO4)3 + SO2 + H2O. Nếu hệ số phân tử của H2SO4 là 6 thì hệ số của phân tử SO2 là A. 4. B. 5. C. 6. D. 3. Câu 10: Chất có đồng phân hình học là A. CH2=CH-CH2-CH3. B. CHCl=CHCl. C. CH3C(CH3)=CH-CH3. D. CH2=CH-CH=CH2. Câu 11: X và Y là hai nguyên tố ở cùng một chu kì, hai nhóm chính liên tiếp nhau, biết (ZX < ZY), tổng số proton của X và Y là 33. Phát biểu đúng là A. Ở điều kiện thường X là chất khí. B. X có 6 elecron ở phân lớp ngoài cùng. C. Ở điều kiện thường Y là chất rắn. D. Y có 5 electron ở phân lớp ngoài cùng. Câu 12: Phương trình ion thu gọn: H+ + OH- → H2O là của phương trình hóa học nào dưới đây ? A. 2KOH + FeCl2 → Fe(OH)2 + 2KCl. B. NaOH + NaHCO3 → Na2CO3 + H2O. C. NaOH + NH4Cl → NaCl + NH3 + H2O. D. KOH + HNO3 → KNO3 + H2O. Câu 13: Có các phát biểu sau: (a) Phenol tạo kết tủa trắng với nước brom. (b) Sục khí CO2 vào dung dịch natri phenolat, xuất hiện vẩn đục. (c) Dung dịch phenol không làm đổi màu quỳ tím. (d) Phenol tan ít trong nước lạnh, tan nhiều trong etanol. Số phát biểu đúng là A. 3. B. 4. C. 2. D. 1. Câu 14: Cho 1 mol anđehit no, mạch hở đơn chức X tác dụng với lượng dư dung dịch AgNO3 trong NH3 thu được 4 mol Ag. X là A. Anđehit fomic. B. Anđehit axetic. C. Anđehit acrylic. D. Anđehit oxalic. Câu 15: Phát biểu đúng là A. Tất cả các axit đều không tham gia phản ứng tráng bạc. B. Lên men ancol etylic là phương pháp dùng để sản xuất giấm ăn. C. Axit fomic có tính axit yếu hơn axit axetic. D. Axit axetic không hòa tan được Cu(OH)2 ở nhiệt độ thường. Câu 16: Cacbohiđrat nào dưới đây không phản ứng với H2 (xúc tác Ni, đun nóng) ? A. Glucozơ. B. Saccarozơ. C. Mantozơ. D. Fructozơ. Câu 17: Polime được điều chế từ phản ứng trùng ngưng là A. PVC. B. PE. C. Poliacrylonitrin. D. Tơ nilon-6,6. Câu 18: Dung dịch nào dưới đây làm xanh quỳ ẩm A. C6H5NH3Cl. B. H2NCH2COOH. C. H2NC3H5(COOH)2. D. (H2N)2C5H9COOH. Câu 19: Hòa tan 6,2 gam Na, K vào nước dư thu được dung dịch X và 0,1 mol H2. Để trung hòa X cần vừa đủ 100ml dung dịch HCl aM. Giá trị a là A. 1M. B. 2M. C. 3M. D. 4M. Câu 20: Nung nóng hỗn hợp X gồm Al và Cr2O3 đến khi phản ứng hoàn toàn trong điều kiện không có không khí thì thu được chất rắn Y. Y tác dụng vừa đủ với 0,3 mol NaOH loãng thu được 0,15 mol H2. Y tác dụng với dung dịch HCl dư thì thu được a mol H2. Giá trị a là A. 0,45. B. 0,35. C. 0,25. D. 0,30. Câu 21: Cho hình vẽ mô tả thí nghiệm điều chế khí Z từ dung dịch X và chất rắn Y: Hình vẽ bên minh họa cho phản ứng nào sau đây ? A. NaOH + NH4Cl (rắn)  NH3 + NaCl + H2O.  0 t H SO đ, t o B. C2H5OH  C2H4↑ + H2O. 2 4  C. Zn + H2SO4 (loãng)  ZnSO4 + H2.  0 t D. NaCl (rắn) + H2SO4 (đặc)  NaHSO4 + HCl.  0 t Câu 22: Kim loại nào dưới đây thuộc nhóm kim loại kiềm A. Na. B. Ca. C. Mg. D. Al. Câu 23: Phát biểu không đúng là A. Hợp chất hữu cơ nhất thiết phải chứa cacbon. B. Metan và etan cùng thuộc một dãy đồng đẳng. C. Liên kết chủ yếu trong hợp chất hữu cơ là liên kết cộng hóa trị. D. Trong phân tử propen (CH2=CH-CH3) có chứa 7 liên kết . Câu 24: Cho 0,1 mol H3PO4 tác dụng với 0,15 mol NaOH thu được dung dịch chứa chất tan là A. H3PO4, NaH2PO4. B. NaH2PO4, Na2HPO4. C. Na2HPO4, Na3PO4. D. Na3PO4, NaOH. Câu 25: Số amin bậc một có cùng công thức phân tử C3H9N là A. 2. B. 3. C. 4. D. 8. Câu 26: Kim loại được điều chế bằng phương pháp điện phân nóng chảy là A. Cu. B. Ni. C. Mg. D. Ag. Câu 27: Thí nghiệm nào dưới đây không sinh ra đơn chất A. Sục khí H2S vào dung dịch SO2. B. Sục khí F2 vào H2O. C. Cho Si vào dung dịch NaOH. D. Sục khí SO2 vào nước Br2. Câu 28: Cách làm nào dưới đây không nên làm A. Ướp cá biển bằng phân đạm để cá tươi lâu. B. Dùng than củi để giảm bớt mùi khê cho cơm khi cơm bị khê. C. Giảm mùi tanh của cá (có metylamin, etylamin..) bằng giấm ăn. D. Giảm vết sưng hoặc ngứa do ong đốt bằng cách bôi vôi. Câu 29: Phát biểu không đúng là A. Có thể làm mềm nước cứng tạm thời bằng cách đun nóng. B. Thạch cao khan (CaSO4) được sử dụng để bó bột trong y học. C. Xesi được sử dụng làm tế bào quang điện. D. Phèn chua có công thức K2SO4.Al2(SO4)3.24H2O được dùng để làm trong nước. Câu 30: Geraniol có trong tinh dầu hoa hồng là một đơn hương quý dùng trong công nghiệp hương liệu và thực phẩm. Khi phân tích định lượng geraniol người ta thu được 77,92%C, 11,7% H về khối lượng và còn lại là oxi. Biết khối lượng phân tử của nó bằng 154đvC. Công thức của geraniol là: A. C20H30O. B. C18H30O. C. C10H18O. D. C10H20O. Câu 31: Cho 5,76 gam Cu vào 500 ml dung dịch NaNO3 0,3 M, sau đó thêm 500 ml dung dịch HCl 0,6 M thu được khí NO và dung dịch A. Thể tích khí NO (đktc) là A. 1,680 lít. B. 0,896 lít. C. 1,344 lít. D. 2,016 lít. Câu 32: Hoà tan hoàn toàn 1,02 gam Al2O3 trong dung dịch H2SO4 loãng dư, thu được khối lượng muối là A. 3,42 gam. B. 5,13gam. C. 6,84 gam. D. 5,81 gam. Câu 33: Phát biểu không đúng là A. Lưu huỳnh tự bốc cháy khi tiếp xúc Crom (VI) oxit. B. Nhỏ dung dịch Bari clorua (BaCl2)vào dung dịch natri cromat (Na2CrO4 ) có kết tủa vàng. C. Quặng chứa nhiều sắt nhất trong tự nhiên là quặng manhetit. D. Đồng là kim loại dẫn điện tốt nhất trong các kim loại. Câu 34: Có các thí nghiệm sau: (a) Đốt H2S trong khí O2 dư. (e) Cho bột Sn vào dung dịch HCl . (b) Cho Cu vào dung dịch chứa HCl và KNO3. (g) Nung NH4NO3. (c) Sục khí Flo vào nước. (h) Đốt NH3 trong O2. (d) Nung KMnO4. (i) Sục khí Clo vào dung dịch NaBr dư. Số thí nghiệm sinh ra khí sau phản ứng là A. 4. B. 5. C. 8. D. 7. Câu 35: Cho các chất: Stiren, toluen, anilin, axetilen, butan, axit acrylic. Số chất làm mất màu nước brom ở nhiệt độ thường là A. 2. B. 3. C. 4. D. 5. Câu 36: Cho 10,8 gam Al vào dung dịch chứa Fe(NO3)3 2M và Zn(NO3)2 4M, sau phản ứng hoàn toàn thu được dung dịch X và m gam Y gồm hai kim loại. Cho từ từ dung dịch Ba(OH)2 4M vào X, đến khi không có phản ứng xảy ra nữa thì thấy cần dùng vừa đúng 250ml. Giá trị của m là A. 28,6. B. 30,7. C. 40,2. D. 32,5. Câu 37: Cho các chất: metyl fomat, anđehit axetic, saccarozơ, axit fomic, glucozơ, axetilen, etilen. Số chất cho phản ứng tráng Ag là A. 4. B. 3. C. 5. D. 2. Câu 38: Hỗn hợp X gồm Na, Ba, Na2O và BaO. Hòa tan hoàn toàn 26,4 gam X vào nước, thu được 1,68 lít khí H2 (đktc) và dung dịch Y, trong đó có 25,65 gam Ba(OH)2. Hấp thụ hoàn toàn V lít khí CO2 (đktc) vào Y, thu được kết tủa và dung dịch Z chỉ chứa 9,5 gam muối. Giá trị của V là A. 5,60. B. 4,48. C. 8,96. D. 6,72. Câu 39: Cho a gam chất hữu cơ X chứa C, H, O (trong a gam X có : mH + mO = 2,7 gam) tác dụng với 10 gam dung dịch KOH vừa đủ, sau đó chưng khô thì phần bay hơi chỉ có 3,4 gam nước, phần chất rắn khan còn lại chứa hai muối của kali có khối lượng 13,5 gam. Nung hai muối này trong oxi dư, sau khi phản ứng hoàn toàn, ta thu được 10,35 gam K2CO3; x mol khí CO2 (đktc) và 2,25 gam nước. Giá trị của x gần nhất với A. 0,28. B. 0,34. C. 0,31. D. 0,26. Câu 40: Cho sơ đồ các phản ứng sau: A + B → C + D A + O2 → Fe2O3 + F F + D → X + H2O D + O2 → F + H2O F + G + H2O → B + H2SO4. Biết rằng G là đơn chất, điều kiện thường ở trạng thái lỏng, X là đơn chất, điều kiện thường ở trạng thái rắn, màu vàng. Trong các chất A, B, C, D, F và X, số chất phản ứng được với dung dịch H2SO4 đặc, nóng là A. 5. B. 2 C. 3 D. 4 Câu 41: Hỗn hợp E gồm X là một axit cacboxylic có mạch cacbon không phân nhánh và Y là một ancol hai chức mạch hở (trong đó số mol X nhỏ hơn số mol Y). Đốt cháy hoàn toàn 3,36 gam hỗn hợp E thu được 5,5 gam CO2 và 2,34 gam H2O. mặt khác, khi cho cùng một lượng E trên phản ứng với Na dư thì thu được 784ml khí H2 (đktc). Z được tạo thành khi este hóa hỗn hợp E, biết Z có cấu tạo mạch hở. Số đồng phân cấu tạo của Z là A. 6. B. 8. C. 7. D. 9. Câu 42: Hỗn hợp X gồm hai chất hữu cơ đơn chức mạch hở là đồng phân của nhau. Cho 0,3 mol hỗn hợp X vào 300 ml dung dịch NaOH 1M và KOH 2M. Cô cạn dung dịch sau phản ứng thu được chất rắn Y có khối lượng m gam và phần hơi chứa ancol Z. Oxi hóa hết lượng Z bằng CuO dư, đun nóng rồi cho sản phẩm tác dụng với lượng dư AgNO3 trong NH3, thu được 77,76 gam Ag. Thêm CaO vào Y rồi nung ở nhiệt độ cao, đến phản ứng hoàn toàn thu được hỗn hợp M gồm hai hiđrocacbon có tỷ khối đối với H2 là 16,8. Giá trị của m là A. 63,48. B. 64,08. C. 58,26. D. 56,46. Câu 43: Hòa tan hoàn toàn m gam Fe bằng dung dịch HNO3 thu được dung dịch X và 0,672 lít NO (đktc). Thêm dung dịch chứa 0,05 mol HCl vào dung dịch X thì thấy khí NO tiếp tục thoát ra và thu được dung dịch Y. Để phản ứng hết với các chất trong dung dịch Y cần vừa đủ 100ml mol NaOH 1,3M. Dung dịch Y hòa tan tối đa bao nhiêu gam Cu (biết NO là sản phẩm khử duy nhất của N+5) ? A. 1,52. B. 2,88. C. 1,60. D. 2,24. Câu 44: Có 4 dung dịch riêng biệt: H2SO4 1M; KNO3 2M; HNO3 4M , HCl 0,5M được đánh số ngẫu nhiên là (1), (2), (3) (4). Lấy cùng thể tích 2 dung dịch ngẫu nhiên là 5ml rồi tác dụng với Cu dư. Thu được kết quả thí nghiêm khí NO như sau (NO sản phẩm khử duy nhất, thể tích khí đo cùng điều kiện nhiệt độ, áp suất) (1) + (2) (1) + (3) (1) + (4) (4) + (2) (4) + (3) V NO (lít) 4V V 8V V1 V2 Tỉ lệ V1 : V2 là A. 3: 4. B. 4 : 3. C. 5 : 4. D. 4 : 5. Câu 45: Hỗn hợp T gồm ba peptit mạch hở X, Y, Z có tỉ lệ mol tương ứng là 2 : 3 : 4. Thủy phân hoàn toàn 35,97 gam T thu được hỗn hợp sản phẩm gồm 0,29 mol A gam và 0,18 mol B. Biết tổng số liên kết peptit trong ba phân tử X, Y, Z bằng 16, A và B đều là aminoaxit no, có 1 nhóm –NH2 và 1 nhóm –COOH trong phân tử. Nếu đốt cháy 4x mol X hoặc 3x mol Y đều thu được số mol CO2 bằng nhau. Đốt cháy hoàn toàn m gam hỗn hợp X thu được N2, 0,74 mol CO2 và a mol H2O. Giá trị a gần nhất là A. 0,65. B. 0,67. C. 0,69. D. 0,72. Câu 46: Điện phân dung dịch chứa 0,2 mol NaCl và x mol Cu(NO3)2 (điện cực trơ, màng ngăn xốp) sau một thời gian thu được dung dịch X, khối lượng dung dịch giảm 21,5 gam. Cho thanh sắt vào X đến khi các phản ứng xảy ra hoàn toàn, khối lượng thành sắt giảm 2,6 gam và thoát ra khí NO (sản phẩm khử duy nhất của N+5). Giá trị của x là A. 0,2. B. 0,3. C. 0,5. D. 0,4. Câu 47: Hòa tan hoàn toàn 11,6 gam hỗn hợp A gồm Fe và Cu vào 87,5 gam HNO3 50,4%, sau khi kim loại tan hết thu được dung dịch X . Cho 500ml dung dịch KOH 1M vào dung dịch X thu được kết tủa Y và dung dịch Z. Lọc lấy Y rồi nung trong không khí đến khối lượng không đổi thu được 16,0 gam chất rắn. Cô cạn dung dịch Z được chất rắn T. Nung T đến khối lượng không đổi thu được 41,05 gam chất rắn. Nồng độ % của muối Fe(NO3)3 có trong dung dịch X gần nhất với giá trị nào dưới đây? A. 14%. B. 28%. C. 37%. D. 12%. Câu 48: Trộn 10,17 gam hỗn hợp X gồm Fe(NO3)2 và Al với 4,64 gam FeCO3 được hỗn hợp Y. Cho Y vào lượng vừa đủ dung dịch chứa 0,56 mol KHSO4 được dung dịch Z chứa 83,41 gam muối sunfat trung hòa và m gam hỗn hợp khí T trong đó có chứa 0,01 mol H2. Thêm NaOH vào Z đến khi toàn bộ muối sắt chuyển hết thành hiđroxit và ngừng khí thoát ra thì cần vừa đủ 0,57 mol NaOH, lọc kết tủa nung trong không khí đến khối lượng không đổi thu được 11,5 gam chất rắn.. Giá trị m là A. 2,52. B. 3,42. C. 2,70. D. 3,22. Câu 49: Cho 51,6 gam hỗn hợp X gồm 2 ancol X và Y (MX < MY) đi qua Al2O3, đun nóng thu được hỗn hợp Y gồm : ba ete, 0,25 mol hai anken, 0,35 mol hai ancol dư và 0,45 mol H2O. Biết rằng hiệu suất tách nước tạo mỗi olefin đối với mỗi ancol đều như nhau và số mol ete là bằng nhau. Phần trăm khối lượng ancol X tham gia phản ứng gần nhất với giá trị nào dưới đây ? A. 59%. B. 44%. C. 56%. D. 42%. Câu 50: Hai ống nghiệm A và B chứa lần lượt dung dịch ZnSO4 và AlCl3, nhỏ từ từ dung dịch NaOH vào 2 ống nghiệm riêng biệt trên thu được kết quả biểu diễn đồ thị bên dưới n↓ 0,4 nNaOH Tổng khối lượng kết tủa ở 2 thí nghiệm khi dùng x mol NaOH có giá trị là ? A. 10,62. B. 14,16. C. 12,39. D. 8,85. -------------HẾT------------ 1C 2A 3A 4B 5A 6D 7A 8C 9D 10B 11D 12D 13B 14A 15B 16B 17D 18D 19B 20B 21C 22A 23D 24B 25A 26C 27D 28A 29B 30C 31C 32A 33D 34D 35C 36B 37A 38A 39A 40A 41D 42A 43A 44B 45B 46D 47A 48B 49A 50A

 

Đồng bộ tài khoản